
Escherichia coli K-12 substr. MG1655 Compound: D-phenylalanine

Synonyms: D-α-amino-β-phenylpropionic acid

Superclasses: an acid all carboxy acids a carboxylate an amino acid a D-amino acid an aromatic D-amino acid
an acid all carboxy acids a carboxylate an amino acid an aromatic amino acid an aromatic D-amino acid
an amino acid or its derivative an amino acid a D-amino acid an aromatic D-amino acid
an amino acid or its derivative an amino acid an aromatic amino acid an aromatic D-amino acid

Chemical Formula: C9H11NO2

Molecular Weight: 165.19 Daltons

Monoisotopic Molecular Weight: 165.0789786025 Daltons

D-phenylalanine compound structure

SMILES: C([O-])(=O)C([N+])CC1(C=CC=CC=1)

InChI: InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1


Unification Links: CAS:673-06-3 , ChEBI:57981 , KEGG:C02265 , MetaboLights:MTBLC57981 , PubChem:6919011

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -51.05

Reactions known to consume the compound:

Not in pathways:
a D-amino acid + an electron-transfer quinone[inner membrane] + H2O → ammonium + a 2-oxo carboxylate + an electron-transfer quinol[inner membrane]

Reactions known to produce the compound:

Not in pathways:
a D-aminoacyl-[tRNA] + H2O → a D-amino acid + an uncharged tRNA + 2 H+

Not in pathways:
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
a 1-acyl 2-lyso-phosphatidylcholine + H2O → a carboxylate + sn-glycero-3-phosphocholine + H+

Reactions known to both consume and produce the compound:

Not in pathways:
an aromatic amino acid + 2-oxoglutarate ↔ an aromatic oxo-acid + L-glutamate

In Reactions of unknown directionality:

Not in pathways:
a 5-L-glutamyl-[peptide][periplasmic space] + an amino acid[periplasmic space] = a 5-L-glutamyl-amino acid[periplasmic space] + a peptide[periplasmic space]

Not in pathways:
a 2-acyl 1-lyso-phosphatidylcholine + H2O = a carboxylate + sn-glycero-3-phosphocholine + H+
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]

In Transport reactions:
an aromatic amino acid[cytosol]an aromatic amino acid[periplasmic space]

In Redox half-reactions:
a 2-oxo carboxylate[in] + ammonium[in] + 2 H+[in] + 2 e-[membrane]a D-amino acid[in] + H2O[in]

This compound has been characterized as an alternative substrate of the following enzymes: D-amino-acid:quinone oxidoreductase (deaminating)

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of EcoCyc: Nucleic Acids Research 41:D605-12 2013
Page generated by SRI International Pathway Tools version 19.0 on Sun Aug 2, 2015, BIOCYC14B.