Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store

Escherichia coli K-12 substr. MG1655 Compound: L-lysine

Abbrev Name: lys

Synonyms: K, lysine, L-lys, lys, 2,6-diaminohexanoic acid, lysine acid

Superclasses: an acidall carboxy acidsa carboxylatean amino acida basic amino acid
an acidall carboxy acidsa carboxylatean amino acida polar amino acida positively-charged polar amino acid
an acidall carboxy acidsa carboxylatean amino acidan alpha amino acida non-standard alpha amino acidan L-lysine or meso-2,6-diaminoheptanedioate
an acidall carboxy acidsa carboxylatean amino acidan alpha amino acida standard alpha amino acid
an acidall carboxy acidsa carboxylatean amino acidan L-amino acid
an amino acid or its derivativean amino acida basic amino acid
an amino acid or its derivativean amino acida polar amino acida positively-charged polar amino acid
an amino acid or its derivativean amino acidan alpha amino acida non-standard alpha amino acidan L-lysine or meso-2,6-diaminoheptanedioate
an amino acid or its derivativean amino acidan alpha amino acida standard alpha amino acid
an amino acid or its derivativean amino acidan L-amino acid

Component of: ArgP-lysine

Chemical Formula: C6H15N2O2

Molecular Weight: 147.2 Daltons

Monoisotopic Molecular Weight: 148.1211777682 Daltons

L-lysine compound structure

pKa 1: 2.2

pKa 2: 8.9

pKa 3: 10.28

SMILES: C([N+])CCCC([N+])C([O-])=O

InChI: InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/p+1/t5-/m0/s1


Unification Links: CAS:56-87-1, ChEBI:32551, HMDB:HMDB00182, IAF1260:33655, KEGG:C00047, MetaboLights:MTBLC32551, PubChem:5460926

Standard Gibbs Free Energy of Formation (ΔfG in kcal/mol): -84.04

Reactions known to consume the compound:

aminopropylcadaverine biosynthesis , L-lysine degradation I :
L-lysine + H+ → CO2 + cadaverine

tRNA charging :
L-lysine + a tRNAlys + ATP + H+ → an L-lysyl-[tRNAlys] + AMP + diphosphate

Not in pathways:
a cytidine34 in tRNAIle2 + L-lysine + ATP → a lysidine34 in tRNAIle2 + AMP + diphosphate + 2 H+

Reactions known to produce the compound:

L-lysine biosynthesis I :
meso-diaminopimelate + H+L-lysine + CO2

Not in pathways:
a peptide with an N-terminal X-L-proline + H2O → a standard α amino acid + a peptide with an N-terminal L-proline + H+
a peptide + H2O → a standard α amino acid + a peptide
a protein + H2O → a peptide + a standard α amino acid
a protein + H2O → a peptide + a standard α amino acid
a protein + H2O → a standard α amino acid + a peptide
β-aspartyl dipeptide + H2O → L-aspartate + a standard α amino acid
a dipetide with an N-terminal L-aspartate + H2O → L-aspartate + a standard α amino acid
a tripeptide + H2O → a dipeptide + a standard α amino acid
a dipeptide with proline at the C-terminal + H2O → L-proline + a standard α amino acid
a dipeptide + H2O → 2 a standard α amino acid

Not in pathways:
a polypeptide + H2O → a polypeptide + an L-amino acid

Not in pathways:
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
a 1-acyl 2-lyso-phosphatidylcholine + H2O → a carboxylate + sn-glycero-3-phosphocholine + H+

Reactions known to both consume and produce the compound:

fructoselysine and psicoselysine degradation :
fructoselysine 6-phosphate + H2O ↔ β-D-glucose 6-phosphate + L-lysine

In Reactions of unknown directionality:

Not in pathways:
ArgP + L-lysine = ArgP-lysine
L-lysine = (R)-β-lysine

Not in pathways:
L-methionine + a 2-oxo carboxylate = 2-oxo-4-methylthiobutanoate + a standard α amino acid

Not in pathways:
a 5-L-glutamyl-[peptide][periplasm] + an amino acid[periplasm] = a 5-L-glutamyl-amino acid[periplasm] + a peptide[periplasm]

Not in pathways:
a 2-acyl 1-lyso-phosphatidylcholine + H2O = a carboxylate + sn-glycero-3-phosphocholine + H+
an aldehyde[periplasm] + FAD[periplasm] + H2O[periplasm] = a carboxylate[periplasm] + FADH2[periplasm]

In Transport reactions:
L-lysine[periplasm] + H+[periplasm]L-lysine[cytosol] + H+[cytosol],
cadaverine[cytosol] + L-lysine[periplasm] → cadaverine[periplasm] + L-lysine[cytosol],
L-lysine[periplasm] + ATP + H2O → L-lysine[cytosol] + ADP + phosphate + H+,
an amino acid[periplasm]an amino acid[extracellular space]

Enzymes inhibited by L-lysine, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: arginine decarboxylase, degradative [Blethen68], cadaverine:H+ symporter [Soksawatmaekhin04] Inhibitor (Noncompetitive) of: homoserine kinase [Chassagnole01] Inhibitor (Allosteric) of: aspartate kinase [Kotaka06, Chassagnole01] Inhibitor (Mechanism unknown) of: acetolactate synthase [Gollop82], acetohydroxybutanoate synthase [Gollop82], aspartate kinase [Stadtman61a], diaminopimelate decarboxylase [White65]

This compound has been characterized as a cofactor or prosthetic group of the following enzymes: Ap4A synthetase, Ap3A synthetase

This compound has been characterized as an alternative substrate of the following enzymes: leucine efflux transporter

In Growth Media: Neidhardt EZ rich defined medium, ATCC medium 57, PMA nitrogen source test + lys, PMA carbon source test + lys


Blethen68: Blethen SL, Boeker EA, Snell EE (1968). "Argenine decarboxylase from Escherichia coli. I. Purification and specificity for substrates and coenzyme." J Biol Chem 1968;243(8);1671-7. PMID: 4870599

Chassagnole01: Chassagnole C, Rais B, Quentin E, Fell DA, Mazat JP (2001). "An integrated study of threonine-pathway enzyme kinetics in Escherichia coli." Biochem J 356(Pt 2);415-23. PMID: 11368768

Gollop82: Gollop N, Tavori H, Barak Z (1982). "Acetohydroxy acid synthase is a target for leucine containing peptide toxicity in Escherichia coli." J Bacteriol 149(1);387-90. PMID: 7033214

Kotaka06: Kotaka M, Ren J, Lockyer M, Hawkins AR, Stammers DK (2006). "Structures of R- and T-state Escherichia coli aspartokinase III. Mechanisms of the allosteric transition and inhibition by lysine." J Biol Chem 281(42);31544-52. PMID: 16905770

Soksawatmaekhin04: Soksawatmaekhin W, Kuraishi A, Sakata K, Kashiwagi K, Igarashi K (2004). "Excretion and uptake of cadaverine by CadB and its physiological functions in Escherichia coli." Mol Microbiol 51(5);1401-12. PMID: 14982633

Stadtman61a: Stadtman, E.R., Cohen, G.N., LeBras, G., Robichon-Szulmajster, H. (1961). "Feed-back Inhibition and Repression of Aspartokinase Activity in Escherichia coli and Saccharomyces cerevisiae." J. Biol. Chem.

White65: White PJ, Kelly B (1965). "Purification and properties of diaminopimelate decarboxylase from Escherichia coli." Biochem J 96;75-84. PMID: 14343156

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of EcoCyc: Nucleic Acids Research 41:D605-12 2013
Page generated by Pathway Tools version 19.5 (software by SRI International) on Fri Apr 29, 2016, biocyc13.