Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
twitter

Homo sapiens Compound: L-dopa

Synonyms: DOPA, 3-hydroxytyrosine, 3,4-dihydroxy-L-phenylalanine, dihydroxyphenylalanine, L-dihydroxy-phenylalanine, levodopa

Superclasses: an alcohol a diol a benzenediol a catechol
an amino acid or its derivative an amino acid an alpha amino acid a non-standard alpha amino acid
an aromatic compound a benzenediol a catechol

Chemical Formula: C9H11NO4

Molecular Weight: 197.19 Daltons

Monoisotopic Molecular Weight: 197.0688078467 Daltons

L-dopa compound structure

SMILES: C(C(CC1(C=CC(O)=C(O)C=1))[N+])(=O)[O-]

InChI: InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1

InChIKey: InChIKey=WTDRDQBEARUVNC-LURJTMIESA-N

Unification Links: CAS:59-92-7 , ChEBI:57504 , HMDB:HMDB00181 , KEGG:C00355 , MetaboLights:MTBLC57504 , NCI:118381 , PubChem:6971033

Reactions known to consume the compound:

catecholamine biosynthesis :
L-dopa + H+ → dopamine + CO2

L-dopa degradation :
L-dopa + S-adenosyl-L-methionine → 3-O-methyldopa + S-adenosyl-L-homocysteine + H+

Not in pathways:
L-dopa + 0.5 oxygen → dopaquinone + H2O

Not in pathways:
a catechol + S-adenosyl-L-methionine → a guaiacol + S-adenosyl-L-homocysteine + H+

Reactions known to produce the compound:

(S)-reticuline biosynthesis :
L-tyrosine + 0.5 oxygen → L-dopa

catecholamine biosynthesis :
tetrahydrobiopterin + L-tyrosine + oxygen → 4α-hydroxy-tetrahydrobiopterin + L-dopa

L-dopachrome biosynthesis :
leucodopachrome + dopaquinone → L-dopachrome + L-dopa

Not in pathways:
a protein + H2O → a protein + an α amino acid

Not in pathways:
RH + a reduced [NADPH-hemoprotein reductase] + oxygen → ROH + an oxidized [NADPH-hemoprotein reductase] + H2O
α-L-fucoside + H2O → L-fucopyranose + an alcohol
a β-D-glucuronoside + H2O → D-glucopyranuronate + an alcohol
an N-acetyl-β-D-hexosaminide + H2O → an N-acetyl-β-D-hexosamine + an alcohol
a phosphate monoester + H2O → an alcohol + phosphate
an organic molecule + H2O + 2 oxygen → an alcohol + 2 superoxide + 2 H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
a glycerophosphodiester + H2O → an alcohol + sn-glycerol 3-phosphate + H+
a phosphate monoester + H2O → an alcohol + phosphate

Reactions known to both consume and produce the compound:

(S)-reticuline biosynthesis :
L-dopa + 2-oxoglutarate ↔ 3,4-dihydroxyphenylpyruvate + L-glutamate

In Reactions of unknown directionality:

Not in pathways:
a 5-L-glutamyl-[peptide] + an amino acid = a 5-L-glutamyl-amino acid + a peptide

Not in pathways:
an alcohol + NADP+ = an aldehyde + NADPH + H+
an alcohol + 3'-phosphoadenylyl-sulfate = adenosine 3',5'-bisphosphate + an organosulfate + H+
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
a reduced thioredoxin + an organic hydroperoxide = an oxidized thioredoxin + an alcohol + H2O
2 protein cysteines + an organic hydroperoxide = a protein disulfide + an alcohol + H2O

This compound has been characterized as an alternative substrate of the following enzymes: L-tryptophan decarboxylase , catechol O-methyltransferase


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of HumanCyc: Genome Biology 6(1):1-17 2004
Page generated by SRI International Pathway Tools version 19.0 on Thu Sep 3, 2015, BIOCYC14A.