twitter

MetaCyc Compound Class: 4-hydroxy-4-methyl-2-oxoglutarate

Synonyms: 4-hydroxy-4-carboxy-2-oxovalerate, 4-hydroxy-4-methyl-2-ketoglutarate

Superclasses: an acid all carboxy acids a carboxylate a 2-oxo acid a 2-oxo carboxylate
an acid all carboxy acids a carboxylate a 2-oxo carboxylate

4-hydroxy-4-methyl-2-oxoglutarate compound structure

Chemical Formula: C6H6O6

Instances:
(R)-4-hydroxy-4-methyl-2-oxoglutarate ,
(S)-4-hydroxy-4-methyl-2-oxoglutarate

Molecular Weight: 174.11 Daltons

Monoisotopic Molecular Weight: 176.0320879894 Daltons

SMILES: CC(CC(C([O-])=O)=O)(C([O-])=O)O

InChI: InChI=1S/C6H8O6/c1-6(12,5(10)11)2-3(7)4(8)9/h12H,2H2,1H3,(H,8,9)(H,10,11)/p-2

Unification Links: ChEBI:58276 , EcoCyc:17801 , KEGG:C06033 , PubChem:18706098

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -168.17152 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

dimethylsulfoniopropanoate biosynthesis I (Wollastonia) :
S-methyl-L-methionine + a 2-oxo carboxylate + H+ → 3-dimethylsulfoniopropionaldehyde + CO2 + a standard α amino acid

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

rhizocticin A and B biosynthesis :
2-keto-4-hydroxy-5-phosphonopentanoate + an L-amino acid → 2-amino-4-hydroxy-5-phosphonopentanoate + a 2-oxo carboxylate
2-keto-5-phosphono-3-cis-pentenoate + an L-amino acid → L-2-amino-5-phosphono-3-cis-pentenoate + a 2-oxo carboxylate

Not in pathways:
an (S)-2-hydroxyacid + oxygen → hydrogen peroxide + a 2-oxo carboxylate
a D-amino acid + oxygen + H2O → ammonium + hydrogen peroxide + a 2-oxo carboxylate
a standard α amino acid + oxygen + H2O → ammonium + hydrogen peroxide + a 2-oxo carboxylate
a D-amino acid[in] + an electron-transfer quinone[membrane] + H2O[in]a 2-oxo carboxylate[in] + ammonium[in] + an electron-transfer quinol[membrane]

prodigiosin biosynthesis :
(S)-3-acetyloctanal + an L-amino acid → 2-methyl-3-n-amyl-dihydropyrrole + a 2-oxo acid + H2O

3,3'-thiodipropanoate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropanoate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

Not in pathways:
a 1-acyl 2-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → a 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an acylcholine + H2O → choline + a carboxylate + H+
a 1,2-diacyl-3-β-D-galactosyl-sn-glycerol + 2 H2O → 2 a carboxylate + 3-β-D-galactosyl-sn-glycerol + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an S-acylglutathione + H2O → a carboxylate + glutathione
an N-acyl-L-aspartate + H2O → L-aspartate + a carboxylate

Reactions known to both consume and produce the compound:

dimethylsulfoniopropanoate biosynthesis III (algae) , ethylene biosynthesis III (microbes) :
L-methionine + a 2-oxo carboxylate ↔ 2-oxo-4-methylthiobutanoate + a standard α amino acid

glucosinolate biosynthesis from dihomomethionine :
2-oxo-6-methylthiohexanoate + a standard α amino acid ↔ L-dihomomethionine + a 2-oxo carboxylate

glucosinolate biosynthesis from hexahomomethionine :
2-oxo-10-methylthiodecanoate + a standard α amino acid ↔ hexahomomethionine + a 2-oxo carboxylate

glucosinolate biosynthesis from pentahomomethionine :
2-oxo-9-methylthiononanoate + a standard α amino acid ↔ pentahomomethionine + a 2-oxo carboxylate

glucosinolate biosynthesis from tetrahomomethionine :
2-oxo-8-methylthiooctanoate + a standard α amino acid ↔ tetrahomomethionine + a 2-oxo carboxylate

glucosinolate biosynthesis from trihomomethionine :
2-oxo-7-methylthioheptanoate + a standard α amino acid ↔ trihomomethionine + a 2-oxo carboxylate

L-asparagine degradation II :
a 2-oxo carboxylate + L-asparagine ↔ 2-oxosuccinamate + a standard α amino acid

L-homomethionine biosynthesis :
L-methionine + a 2-oxo carboxylate ↔ 2-oxo-4-methylthiobutanoate + a standard α amino acid
2-oxo-5-methylthiopentanoate + a standard α amino acid ↔ L-homomethionine + a 2-oxo carboxylate

Not in pathways:
L-alanine + a 2-oxo carboxylate ↔ pyruvate + an L-amino acid
L-ornithine + a 2-oxo carboxylate ↔ a standard α amino acid + L-glutamate-5-semialdehyde

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
2-oxo-4-carboxypent-4-enoate + H2O = 4-hydroxy-4-methyl-2-oxoglutarate
4-hydroxy-4-methyl-2-oxoglutarate = 2 pyruvate

Not in pathways:
S-ureidoglycine + a 2-oxo carboxylate = oxalurate + an L-amino acid
a 2-oxo carboxylate + H+ = an aldehyde + CO2
a 2-oxo carboxylate + 2 an oxidized ferredoxin + coenzyme A = an acyl-CoA + CO2 + 2 a reduced ferredoxin + H+
a (2S)-2-hydroxycarboxylate + NAD(P)+ = a 2-oxo carboxylate + NAD(P)H + H+
an L-amino acid + NAD+ + H2O = a 2-oxo carboxylate + ammonium + NADH + H+
an (R)-2-hydroxycarboxylate + NAD+ = a 2-oxo carboxylate + NADH + H+
a (2R)-hydroxy-carboxylate + an unknown oxidized electron acceptor = a 2-oxo carboxylate + an unknown reduced electron acceptor
a (2S)-2-hydroxycarboxylate + NAD+ = a 2-oxo carboxylate + NADH + H+
an (R)-2-hydroxycarboxylate + NADP+ = a 2-oxo carboxylate + NADPH + H+
2-oxoaldehyde + NAD+ + H2O = a 2-oxo carboxylate + NADH + 2 H+
2-oxoaldehyde + NADP+ + H2O = a 2-oxo carboxylate + NADPH + 2 H+

Not in pathways:
an (R)-2-hydroxyacid + an electron-transfer quinone = a 2-oxo acid + an electron-transfer quinol

Not in pathways:
eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a 2-acyl 1-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a triacyl-sn-glycerol + H2O = a 1,2-diacyl-sn-glycerol + a carboxylate + H+
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an unknown oxidized electron acceptor + H2O = a carboxylate + an unknown reduced electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid

In Redox half-reactions:
a 2-oxo carboxylate[in] + ammonium[in] + 2 H+[in] + 2 e-[membrane] → a D-amino acid[in] + H2O[in]

Enzymes inhibited by 4-hydroxy-4-methyl-2-oxoglutarate, sorted by the type of inhibition, are:

Inhibitor (Mechanism unknown) of: threonine dehydratase [Datta87]

This compound has been characterized as an alternative substrate of the following enzymes: 4-carboxy-4-hydroxy-2-oxoadipate aldolase


References

Datta87: Datta P, Goss TJ, Omnaas JR, Patil RV (1987). "Covalent structure of biodegradative threonine dehydratase of Escherichia coli: homology with other dehydratases." Proc Natl Acad Sci U S A 1987;84(2);393-7. PMID: 3540965

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Sat May 30, 2015, biocyc12.