
MetaCyc Compound Class: a long-chain 2,3,4-saturated fatty acyl CoA

Superclasses: an ester a thioester a coenzyme A-activated compound an acyl-CoA a 2,3,4-saturated fatty acyl CoA
an ester a thioester a coenzyme A-activated compound an acyl-CoA a long-chain acyl-CoA

Acyl-CoAs are oxoacids that have been activated by coenzyme A. They are often classified by the length of their acyl moiety.

Medium-chain acyl-CoAs are derived from fatty acids with aliphatic chains of 6-12 carbons.

Long-chain acyl-CoAs are derived from fatty acids with aliphatic chains of 13-22 carbons.

Very-long-chain fatty acyl-CoAs are derived from fatty acids with aliphatic chains of 23 carbons or longer.

2,3,4-saturated fatty acyl CoAs will not contain any double bonds in the 2, 3, and 4 positions.

a long-chain 2,3,4-saturated fatty acyl CoA compound structure

(R)-2-hydroxy-palmitoyl-CoA ,
(R)-2-hydroxy-stearoyl-CoA ,
13-methylmyristoyl-CoA ,
docosanoyl-CoA ,
heptadecanoyl-CoA ,
icosanoyl-CoA ,
myristoyl-CoA ,
palmitoyl-CoA ,
pentadecanoyl-CoA ,

SMILES: C([R])CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O

Reactions known to consume the compound:

alkane biosynthesis II :
a long-chain aldehyde + coenzyme A + NAD+a long-chain acyl-CoA + NADH + H+

CDP-diacylglycerol biosynthesis I :
a long-chain acyl-CoA + a 1-acyl-sn-glycerol 3-phosphate → a 1,2-diacyl-sn-glycerol 3-phosphate + coenzyme A
a long-chain acyl-CoA + sn-glycerol 3-phosphate → a 1-acyl-sn-glycerol 3-phosphate + coenzyme A

ceramide de novo biosynthesis :
sphinganine + a long-chain acyl-CoA → a dihydroceramide + coenzyme A + H+

cuticular wax biosynthesis :
a very long chain alcohol + a long-chain acyl-CoA → a wax ester + coenzyme A

diacylglycerol and triacylglycerol biosynthesis :
a long-chain acyl-CoA + a 1-acyl-sn-glycerol 3-phosphate → a 1,2-diacyl-sn-glycerol 3-phosphate + coenzyme A
a long-chain acyl-CoA + sn-glycerol 3-phosphate → a 1-acyl-sn-glycerol 3-phosphate + coenzyme A

long chain fatty acid ester synthesis for microdiesel production :
a long-chain acyl-CoA + ethanol → a fatty acid-ethyl ester + coenzyme A

sphingolipid biosynthesis (plants) :
sphinganine + a long-chain acyl-CoA → a dihydroceramide + coenzyme A + H+

wax esters biosynthesis I :
a long-chain acyl-CoA + 2 NADPH + 2 H+ → a long-chain alcohol + coenzyme A + 2 NADP+
a long-chain acyl-CoA + a long-chain alcohol → a long-chain ester + coenzyme A

wax esters biosynthesis II :
a long-chain acyl-CoA + a long-chain alcohol → a long-chain ester + coenzyme A
a long-chain aldehyde + coenzyme A + NAD+a long-chain acyl-CoA + NADH + H+

Not in pathways:
a long-chain acyl-CoA + NADPH + oxygen + H+ → an ω-hydroxy fatty acyl-CoA + NADP+ + H2O

acyl-CoA hydrolysis :
a 2,3,4-saturated fatty acyl CoA + H2O → a 2,3,4-saturated fatty acid + coenzyme A + H+

fatty acid β-oxidation (peroxisome, yeast) , fatty acid β-oxidation II (peroxisome) , fatty acid β-oxidation VI (peroxisome) :
a 2,3,4-saturated fatty acyl CoA + oxygen → a trans-2-enoyl-CoA + hydrogen peroxide

fatty acid β-oxidation I :
a 2,3,4-saturated fatty acyl CoA + an oxidized electron-transfer flavoprotein + H+ → a trans-2-enoyl-CoA + a reduced electron-transfer flavoprotein

3,3'-thiodipropanoate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

diacylglycerol and triacylglycerol biosynthesis :
an acyl-CoA + a 1,2-diacyl-sn-glycerol → a triacyl-sn-glycerol + coenzyme A

dimethylsulfoniopropanoate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

methyl ketone biosynthesis :
an acyl-CoA + oxygen → a trans-2-enoyl-CoA + hydrogen peroxide

phosphatidylcholine biosynthesis VII :
an acyl-CoA + sn-glycero-3-phosphocholine → a 1-acyl 2-lyso-phosphatidylcholine + coenzyme A

Not in pathways:
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an acyl-CoA + 2 a ferrocytochrome b5 + oxygen + 2 H+ → a cis Δ11 acyl-CoA + 2 a ferricytochrome b5 + 2 H2O

Reactions known to produce the compound:

alkane biosynthesis II , long chain fatty acid ester synthesis for microdiesel production , long-chain fatty acid activation , phosphatidylcholine acyl editing , wax esters biosynthesis II :
a long-chain fatty acid + ATP + coenzyme A → a long-chain acyl-CoA + AMP + diphosphate

fatty acid β-oxidation (peroxisome, yeast) :
a 2,3,4-saturated fatty acyl CoA + acetyl-CoA ← a 3-oxoacyl-CoA + coenzyme A
a 2,3,4-saturated fatty acid + ATP + coenzyme A → a 2,3,4-saturated fatty acyl CoA + AMP + diphosphate

fatty acid β-oxidation I :
a 2,3,4-saturated fatty acyl CoA + acetyl-CoA ← a 3-oxoacyl-CoA + coenzyme A
a 2,3,4-saturated fatty acid + ATP + coenzyme A → a 2,3,4-saturated fatty acyl CoA + AMP + diphosphate

fatty acid β-oxidation II (peroxisome) :
a 2,3,4-saturated fatty acyl CoA + acetyl-CoA ← a 3-oxoacyl-CoA + coenzyme A
a 2,3,4-saturated fatty acid + ATP + coenzyme A → a 2,3,4-saturated fatty acyl CoA + AMP + diphosphate

fatty acid β-oxidation VI (peroxisome) :
a 2,3,4-saturated fatty acyl CoA + acetyl-CoA ← a 3-oxoacyl-CoA + coenzyme A
a 2,3,4-saturated fatty acid + ATP + coenzyme A → a 2,3,4-saturated fatty acyl CoA + AMP + diphosphate

Not in pathways:
a 2,3,4-saturated fatty acyl CoA + NADP+ ← a trans-2-enoyl-CoA + NADPH + H+

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-CoA + NADP+ ← a 2-enoyl-CoA + NADPH + H+
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to both consume and produce the compound:

mitochondrial L-carnitine shuttle :
a long-chain acyl-CoA + L-carnitine ↔ an O-acyl-L-carnitine + coenzyme A

Not in pathways:
a 2,3,4-saturated fatty acyl CoA + acetate ↔ a 2,3,4-saturated fatty acid + acetyl-CoA

phosphatidylcholine acyl editing , phosphatidylcholine biosynthesis VII :
an acyl-CoA + a 1-acyl 2-lyso-phosphatidylcholine ↔ a phosphatidylcholine + coenzyme A

Not in pathways:
an acyl-CoA + NAD+ ↔ a trans-2-enoyl-CoA + NADH + H+

In Reactions of unknown directionality:

Not in pathways:
a long-chain 2,3,4-saturated fatty acyl CoA + an oxidized electron-transfer flavoprotein + H+ = a long-chain trans-2,3-dehydroacyl-CoA + a reduced electron-transfer flavoprotein

fatty acids biosynthesis (yeast) :
acetyl-CoA + n malonyl-CoA + 2n NADPH + 4n H+ = a long-chain acyl-CoA + n CO2 + n coenzyme A + 2n NADP+

Not in pathways:
a long-chain acyl-CoA + n malonyl-CoA = a very long chain fatty acyl-CoA + n CO2 + n coenzyme A
a long-chain acyl-CoA + glycerone phosphate = an acylglycerone phosphate + coenzyme A
a long-chain acyl-CoA + a 1-acyl-sn-glycerol 3-phosphate = a 1,2-diacyl-sn-glycerol 3-phosphate + coenzyme A
a long-chain acyl-CoA + H2O = a long-chain fatty acid + coenzyme A + H+
a long-chain aldehyde + coenzyme A + NADP+ = a long-chain acyl-CoA + NADPH + H+

Not in pathways:
an acyl-CoA + n (R)-methylmalonyl-CoA + 2n NADPH + 2n H+ = a multi-methyl-branched acyl-CoA + n CO2 + n coenzyme A + 2n NADP+
an acyl-CoA + glycine = an N-acylglycine + coenzyme A
a 2-acyl 1-lyso-phosphatidylcholine + an acyl-CoA = a phosphatidylcholine + coenzyme A
a 2-monoglyceride + an acyl-CoA = a 1,2-diacyl-sn-glycerol + coenzyme A
an acyl-CoA + 1-O-alkyl-2-acetyl-sn-glycerol = a 1-O-alkyl-2-acetyl-3-acyl-sn-glycerol + coenzyme A
an acyl-CoA + a 1-alkenylglycerophosphoethanolamine = an O-1-alk-1-enyl-2-acyl-sn-glycero-3-phosphoethanolamine + coenzyme A
an acyl-CoA + cholesterol = a cholesterol ester + coenzyme A
an acyl-CoA + pseudotropine = an O-acylpseudotropine + coenzyme A + H+
an acyl-CoA + a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine = a 1-organyl-2-acyl-sn-glycero-3-phosphocholine + coenzyme A
an acyl-CoA + NADP+ = a cis-2-enoyl-CoA + NADPH + H+
an acyl-CoA + sn-glycerol 3-phosphate = a 2-acyl-sn-glycerol 3-phosphate + coenzyme A
an acyl-CoA + tropine = an O-acyltropine + coenzyme A + H+
an acyl-CoA + L-glutamine = an N-acyl-L-glutamine + coenzyme A
an acyl-CoA + a 2-acyl-sn-glycerol 3-phosphate = a 1,2-diacyl-sn-glycerol 3-phosphate + coenzyme A
a 1-acyl-sn-glycero-3-phospho-D-myo-inositol + an acyl-CoA = an L-1-phosphatidyl-inositol + coenzyme A
an acyl-CoA + a 1-O-(alk-1-enyl)glycero-3-phosphocholine = a plasmenylcholine + coenzyme A
an acyl-CoA + a sphingoid base = a ceramide + coenzyme A + H+
all-trans-retinol + an acyl-CoA = an all-trans-retinyl ester + coenzyme A

In Transport reactions:
a long-chain acyl-CoA[peroxisomal membrane] + ATP + H2O ↔ a long-chain acyl-CoA[peroxisomal membrane] + ADP + phosphate + H+

Enzymes inhibited by a long-chain 2,3,4-saturated fatty acyl CoA, sorted by the type of inhibition, are:

Inhibitor (Mechanism unknown) of: glycerol-3-phosphate dehydrogenase [Edgar79] , 4-hydroxybenzoate-polyprenyltransferase [Kawahara91]

Created 08-Oct-2010 by Caspi R , SRI International


Edgar79: Edgar JR, Bell RM (1979). "Biosynthesis in Escherichia coli of sn-glycerol 3-phosphate, a precursor of phospholipid. Palmitoyl-CoA inhibition of the biosynthetic sn-glycerol-3-phosphate dehydrogenase." J Biol Chem 1979;254(4);1016-21. PMID: 368067

Kawahara91: Kawahara, K., Koizumi, N., Kawaji, H., Oishi, K., Uchida, K. (1991). "Partial Purification and Characterization of 4-Hydroxybenzoate-polyprenyltransferase in Ubiquinone Biosynthesis of Pseudomonas putida." Agricultural and biological chemistry 55(9):2307-2311.

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Sun Aug 2, 2015, BIOCYC14B.