Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
twitter

MetaCyc Compound: (2E,6E)-farnesal

Synonyms: (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal, (2-trans,6-trans)-3,7,11-trimethyldodeca-2,6,10-trienal, (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienal, E,E-farnesal, 2-trans-6-trans-farnesal

Superclasses: an aldehyde or ketone an aldehyde

Citations: [Bede01]

Chemical Formula: C15H24O

Molecular Weight: 220.35 Daltons

Monoisotopic Molecular Weight: 220.1827153925 Daltons

SMILES: CC(C)=CCCC(C)=CCCC(C)=CC=O

InChI: InChI=1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+

InChIKey: InChIKey=YHRUHBBTQZKMEX-YFVJMOTDSA-N

Unification Links: ChEBI:15894 , ChemSpider:4444210 , HMDB:HMDB60356 , KEGG:C03461 , PubChem:5280598

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 291.93692 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

juvenile hormone III biosynthesis I , juvenile hormone III biosynthesis II :
(2E,6E)-farnesal + NAD+ + H2O → (2-trans-6-trans)-farnesoate + NADH + 2 H+

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+

Not in pathways:
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+

Reactions known to produce the compound:

farnesylcysteine salvage pathway :
S-(2E,6E)-farnesyl-L-cysteine + oxygen + H2O → (2E,6E)-farnesal + L-cysteine + hydrogen peroxide

ceramide degradation :
a sphingoid 1-phosphate → phosphoryl-ethanolamine + an aldehyde

two-component alkanesulfonate monooxygenase :
an alkanesulfonate + FMNH2 + oxygen → an aldehyde + sulfite + FMN + H2O + 2 H+

Not in pathways:
a primary amine[periplasmic space] + H2O[periplasmic space] + oxygen[periplasmic space]an aldehyde[periplasmic space] + ammonium[periplasmic space] + hydrogen peroxide[periplasmic space]
an aliphatic amine + H2O + oxygen → an aldehyde + ammonium + hydrogen peroxide
a monoamine + H2O + oxygen → an aldehyde + a primary amine + hydrogen peroxide
a primary alcohol + oxygen → hydrogen peroxide + an aldehyde


a nitroalkane + oxygen + H2O → an aldehyde or ketone + nitrite + hydrogen peroxide + H+

Reactions known to both consume and produce the compound:

farnesylcysteine salvage pathway , juvenile hormone III biosynthesis I , juvenile hormone III biosynthesis II :
(2E,6E)-farnesol + NADP+(2E,6E)-farnesal + NADPH + H+

Not in pathways:
a primary alcohol + NAD+an aldehyde + NADH + H+

In Reactions of unknown directionality:

Not in pathways:
(2E,6E)-farnesol + NAD+ = (2E,6E)-farnesal + NADH + H+


an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + an oxidized electron acceptor + H2O = a carboxylate + a reduced electron acceptor + H+
an aldehyde + pyrroloquinoline quinone + H2O = a carboxylate + pyrroloquinoline quinol + H+
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
an aliphatic amine + an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + a reduced cytochrome c550
an alkylamine + 2 an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + 2 a reduced cytochrome c550
a 2-oxo carboxylate + H+ = an aldehyde + CO2
an alcohol + NADP+ = an aldehyde + NADPH + H+
a primary alcohol + an oxidized electron acceptor = an aldehyde + a reduced electron acceptor
a primary alcohol + 2 an oxidized cytochrome cL = an aldehyde + 2 a reduced cytochrome cL
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
a primary alcohol + an oxidized azurin = an aldehyde + a reduced azurin
a 1-O-(alk-1-enyl)glycero-3-phosphocholine + H2O = sn-glycero-3-phosphocholine + an aldehyde
a 1-alkenylglycerophosphoethanolamine + H2O = sn-glycero-3-phosphoethanolamine + an aldehyde
a primary alcohol + 2 an oxidized cytochrome c550 = an aldehyde + 2 a reduced cytochrome c550


References

Bede01: Bede JC, Teal PE, Goodman WG, Tobe SS (2001). "Biosynthetic pathway of insect juvenile hormone III in cell suspension cultures of the sedge Cyperus iria." Plant Physiol 127(2);584-93. PMID: 11598232

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Mon Nov 24, 2014, biocyc13.