Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store

MetaCyc Compound: (2E,6E)-farnesal

Synonyms: (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal, (2-trans,6-trans)-3,7,11-trimethyldodeca-2,6,10-trienal, (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienal, E,E-farnesal, 2-trans-6-trans-farnesal

Superclasses: an aldehyde or ketonean aldehyde

Citations: [Bede01]

Chemical Formula: C15H24O

Molecular Weight: 220.35 Daltons

Monoisotopic Molecular Weight: 220.1827153925 Daltons

(2<i>E</i>,6<i>E</i>)-farnesal compound structure


InChI: InChI=1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+


Unification Links: ChEBI:15894, ChemSpider:4444210, HMDB:HMDB60356, KEGG:C03461, PubChem:5280598

Standard Gibbs Free Energy of Formation (ΔfG in kcal/mol): 291.93692Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

juvenile hormone III biosynthesis I , juvenile hormone III biosynthesis II :
(2E,6E)-farnesal + NAD+ + H2O → (2E,6E)-farnesoate + NADH + 2 H+

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+

Not in pathways:
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+

Reactions known to produce the compound:

farnesylcysteine salvage pathway :
S-(2E,6E)-farnesyl-L-cysteine + oxygen + H2O → (2E,6E)-farnesal + L-cysteine + hydrogen peroxide

ceramide degradation :
a sphingoid 1-phosphate → O-phosphoethanolamine + an aldehyde

two-component alkanesulfonate monooxygenase :
an alkylsulfonate + FMNH2 + oxygen → an aldehyde + sulfite + FMN + H2O + 2 H+

Not in pathways:
a primary amine[periplasm] + H2O[periplasm] + oxygen[periplasm]an aldehyde[periplasm] + ammonium[periplasm] + hydrogen peroxide[periplasm]
an aliphatic amine + H2O + oxygen → an aldehyde + ammonium + hydrogen peroxide
a monoamine + H2O + oxygen → an aldehyde + a primary amine + hydrogen peroxide
a primary alcohol + oxygen → hydrogen peroxide + an aldehyde

Not in pathways:
a nitroalkane + oxygen + H2O → an aldehyde or ketone + nitrite + hydrogen peroxide + H+

Reactions known to both consume and produce the compound:

farnesylcysteine salvage pathway , juvenile hormone III biosynthesis I , juvenile hormone III biosynthesis II :
(2E,6E)-farnesol + NADP+(2E,6E)-farnesal + NADPH + H+

Not in pathways:
a primary alcohol + NAD+an aldehyde + NADH + H+

In Reactions of unknown directionality:

Not in pathways:
(2E,6E)-farnesol + NAD+ = (2E,6E)-farnesal + NADH + H+

Not in pathways:
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an aldehyde + 2 an oxidized ferredoxin [iron-sulfur] cluster + H2O = a carboxylate + 2 a reduced ferredoxin [iron-sulfur] cluster + 3 H+
an aldehyde + an oxidized unknown electron acceptor + H2O = a carboxylate + an reduced unknown electron acceptor + H+
an aldehyde[periplasm] + FAD[periplasm] + H2O[periplasm] = a carboxylate[periplasm] + FADH2[periplasm]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a primary alcohol + 2 an oxidized cytochrome cL = an aldehyde + 2 a reduced cytochrome cL + 2 H+
an aliphatic amine + an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + a reduced cytochrome c550
an alkylamine + 2 an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + 2 a reduced cytochrome c550
a 2-oxo carboxylate + H+ = an aldehyde + CO2
an alcohol + NADP+ = an aldehyde + NADPH + H+
a primary alcohol + an oxidized unknown electron acceptor = an aldehyde + an reduced unknown electron acceptor
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
a primary alcohol + an oxidized azurin = an aldehyde + a reduced azurin
a 1-O-(alk-1-enyl)glycero-3-phosphocholine + H2O = sn-glycero-3-phosphocholine + an aldehyde
a 1-alkenylglycerophosphoethanolamine + H2O = sn-glycero-3-phosphoethanolamine + an aldehyde
a primary alcohol + 2 an oxidized cytochrome c550 = an aldehyde + 2 a reduced cytochrome c550

This compound has been characterized as an alternative substrate of the following enzymes: geranial lyase


Bede01: Bede JC, Teal PE, Goodman WG, Tobe SS (2001). "Biosynthetic pathway of insect juvenile hormone III in cell suspension cultures of the sedge Cyperus iria." Plant Physiol 127(2);584-93. PMID: 11598232

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by Pathway Tools version 19.5 (software by SRI International) on Fri Feb 12, 2016, biocyc12.