
MetaCyc Compound: 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate

Synonyms: γ-oxalocitramalate, 4-oxalocitramalate, 4-carboxy-4-hydroxy-2-ketoadipate, 4-hydroxy-4-carboxymethyl-2-oxoglutarate, 4-carboxy-4-hydroxy-2-oxoadipate

Superclasses: an acid all carboxy acids a carboxylate a 2-oxo acid
an acid all carboxy acids a carboxylate a tricarboxylate

Chemical Formula: C7H5O8

Molecular Weight: 217.11 Daltons

Monoisotopic Molecular Weight: 220.0219172336 Daltons

2-hydroxy-4-oxobutane-1,2,4-tricarboxylate compound structure

SMILES: C(C(CC(O)(CC(=O)[O-])C(=O)[O-])=O)(=O)[O-]

InChI: InChI=1S/C7H8O8/c8-3(5(11)12)1-7(15,6(13)14)2-4(9)10/h15H,1-2H2,(H,9,10)(H,11,12)(H,13,14)/p-3


Unification Links: ChEBI:58075 , ChemSpider:19951111 , KEGG:C04115 , PubChem:23615207

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -257.83295 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

3-hydroxy-L-homotyrosine biosynthesis :
4-(4-hydroxyphenyl)-2-oxobutanoate + an amino acid → L-homotyrosine + a 2-oxo acid

prodigiosin biosynthesis :
(S)-3-acetyloctanal + an L-amino acid → 2-methyl-3-n-amyl-dihydropyrrole + a 2-oxo acid + H2O

3,3'-thiodipropanoate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropanoate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

Not in pathways:
a 1-acyl 2-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → a 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an acylcholine + H2O → choline + a carboxylate + H+
a β-monogalactosyldiacylglycerol + 2 H2O → 2 a carboxylate + 3-β-D-galactosyl-sn-glycerol + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an S-acylglutathione + H2O → a carboxylate + glutathione
an N-acyl-L-aspartate + H2O → L-aspartate + a carboxylate

Reactions known to both consume and produce the compound:

gallate degradation I :
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ pyruvate + oxaloacetate
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ (1E,3E)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylate + H2O

gallate degradation II :
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ pyruvate + oxaloacetate
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ (1E,3E)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylate + H2O

methylgallate degradation :
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ pyruvate + oxaloacetate
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ (1E,3E)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylate + H2O

protocatechuate degradation I (meta-cleavage pathway) :
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ pyruvate + oxaloacetate
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate ↔ (1E,3E)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylate + H2O

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
an (R)-2-hydroxyacid + an electron-transfer quinone = a 2-oxo acid + an electron-transfer quinol

Not in pathways:
eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a 2-acyl 1-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a triacyl-sn-glycerol + H2O = a 1,2-diacyl-sn-glycerol + a carboxylate + H+
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an oxidized unknown electron acceptor + H2O = a carboxylate + an reduced unknown electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an N-acyl-D-glutamate + H2O = a carboxylate + D-glutamate
an anilide + H2O = aniline + a carboxylate + H+
a 5'-acylphosphoadenosine + H2O = a carboxylate + AMP + 2 H+
a 3-acylpyruvate + H2O = a carboxylate + pyruvate + H+
an N6acyl-L-lysine + H2O = a carboxylate + L-lysine
an N-acyl-D-aspartate + H2O = a carboxylate + D-aspartate

Enzymes inhibited by 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate, sorted by the type of inhibition, are:

Inhibitor (Mechanism unknown) of: threonine dehydratase [Datta87]


Datta87: Datta P, Goss TJ, Omnaas JR, Patil RV (1987). "Covalent structure of biodegradative threonine dehydratase of Escherichia coli: homology with other dehydratases." Proc Natl Acad Sci U S A 1987;84(2);393-7. PMID: 3540965

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Tue Aug 4, 2015, biocyc11.