Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
twitter

MetaCyc Compound: ADP

Synonyms: adenosine pyrophosphate, adenosine 5'-pyrophosphate, adenosine-5'-diphosphate, adenosine-diphosphate, adenosine-5-diphosphate

Superclasses: a nucleic acid component a nucleotide a nucleoside diphosphate a ribonucleoside diphosphate a purine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a ribonucleoside diphosphate a purine ribonucleoside 5'-diphosphate
a nucleic acid component
an organic heterocyclic compound an organic heterobicyclic compound a purine a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a purine a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate

Component of: MgADP

Chemical Formula: C10H12N5O10P2

Molecular Weight: 424.18 Daltons

Monoisotopic Molecular Weight: 427.0294147485 Daltons

SMILES: C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])[O-])([O-])=O

InChI: InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/p-3/t4-,6-,7-,10-/m1/s1

InChIKey: InChIKey=XTWYTFMLZFPYCI-KQYNXXCUSA-K

Unification Links: CAS:58-64-0 , ChEBI:456216 , ChemSpider:5414423 , HMDB:HMDB01341 , IAF1260:33496 , KEGG:C00008 , MetaboLights:MTBLC456216 , PubChem:7058055

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -344.92508 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

adenosine deoxyribonucleotides de novo biosynthesis II :
dADP + an oxidized NrdH glutaredoxin-like protein + H2O ← ADP + a reduced NrdH glutaredoxin-like protein

chitin degradation I (archaea) :
D-glucosamine + ADP → D-glucosamine 6-phosphate + AMP + H+

glycolysis V (Pyrococcus) :
β-D-glucose + ADP → β-D-glucose 6-phosphate + AMP + H+

trans-zeatin biosynthesis :
dimethylallyl diphosphate + ADPN6-(Δ2-isopentenyl)-adenosine 5'-diphosphate + diphosphate

Not in pathways:
a nucleoside diphosphate + ATP → a nucleoside triphosphate + ADP
(S)-NADPHX + ADP → AMP + NADPH + phosphate + H+
ADP + (S)-NADHX → AMP + NADH + phosphate + H+
ATP + ADP + H+ → 5',5'''-diadenosine triphosphate + diphosphate


a 2'-deoxyribonucleoside 5'-diphosphate + an oxidized thioredoxin + H2O ← a ribonucleoside diphosphate + a reduced thioredoxin


ribonucleotiden + ribonucleotiden + ATP → ribonucleotidem+n + AMP + diphosphate


a nucleotide + H2O → a nucleoside + phosphate

Reactions known to produce the compound:

(4R)-carveol and (4R)-dihydrocarveol degradation , limonene degradation I (D-limonene) : (3R)-3-isopropenyl-6-oxoheptanoate + ATP + coenzyme A → (3R)-3-isopropenyl-6-oxoheptanoyl-CoA + ADP + phosphate (4S)-carveol and (4S)-dihydrocarveol degradation , limonene degradation II (L-limonene) : (3S)-3-isopropenyl-6-oxoheptanoate + ATP + coenzyme A → (3S)-3-isopropenyl-6-oxoheptanoyl-CoA + ADP + phosphate 1,3-propanediol biosynthesis (engineered) : ATP + β-D-fructofuranose 6-phosphate → ADP + fructose 1,6-bisphosphate + H+ β-D-glucose + ATP → β-D-glucose 6-phosphate + ADP + H+ 1,4-dihydroxy-2-naphthoate biosynthesis II (plants) : ATP + 2-succinylbenzoate + coenzyme A → 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + ADP + phosphate 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3) : D-myo-inositol (1,4,5)-trisphosphate + ATP → D-myo-inositol (1,3,4,5)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,4,5)-trisphosphate + ATP → D-myo-inositol (1,4,5,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,3,4,5)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol (1,4,5,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian) : D-myo-inositol (1,4,5)-trisphosphate + ATP → D-myo-inositol (1,3,4,5)-tetrakisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (1,3,4)-trisphosphate + ATP → D-myo-inositol (1,3,4,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza) : myo-inositol + ATP → 1D-myo-inositol 3-monophosphate + ADP + H+ D-myo-inositol (3,4,5,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ 1D-myo-inositol 3-monophosphate + ATP → D-myo-inositol (3,4)-bisphosphate + ADP + H+ D-myo-inositol (3,4)-bisphosphate + ATP → D-myo-inositol (3,4,6)-trisphosphate + ADP + H+ D-myo-inositol (3,4,6)-trisphosphate + ATP → D-myo-inositol (3,4,5,6)-tetrakisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium) : myo-inositol + ATP → 1D-myo-inositol 3-monophosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ 1D-myo-inositol 3-monophosphate + ATP → D-myo-inositol (3,6)-bisphosphate + ADP + H+ D-myo-inositol (3,6)-bisphosphate + ATP → D-myo-inositol (3,4,6)-trisphosphate + ADP + H+ D-myo-inositol (3,4,6)-trisphosphate + ATP → D-myo-inositol (1,3,4,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3) : D-myo-inositol (1,3,4,5)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (1,3,4)-trisphosphate + ATP → D-myo-inositol (1,3,4,5)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,3,4)-trisphosphate + ATP → D-myo-inositol (1,3,4,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ 2-O-α-mannosyl-D-glycerate degradation , D-galactarate degradation I , D-glucarate degradation I , Entner-Doudoroff pathway II (non-phosphorylative) , formaldehyde assimilation I (serine pathway) : D-glycerate + ATP → 2-phospho-D-glycerate + ADP + H+ 3,3'-dithiodipropionate degradation : 3-sulfinopropionate + ATP + coenzyme A → 3-sulfinopropanoyl-CoA + ADP + phosphate 3-amino-5-hydroxybenzoate biosynthesis : kanosamine + ATP → D-kanosamine 6-phosphate + ADP + H+ 3-hydroxypropanoate cycle , 3-hydroxypropanoate/4-hydroxybutanate cycle , fatty acid biosynthesis initiation I , glyoxylate assimilation , jadomycin biosynthesis , octanoyl-ACP biosynthesis (mitochondria, yeast) : ATP + acetyl-CoA + hydrogen carbonate → malonyl-CoA + ADP + phosphate + H+ 3-phosphoinositide biosynthesis : an L-1-phosphatidyl-inositol + ATP → a 1-phosphatidyl-1D-myo-inositol 3-phosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 4-phosphate + ATP → a 1-phosphatidyl-1D-myo-inositol 3,4-bisphosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 3-phosphate + ATP → 1-phosphatidyl-1D-myo-inositol 3,5-bisphosphate + ADP + H+ an L-1-phosphatidyl-inositol + ATP → a 1-phosphatidyl-1D-myo-inositol 4-phosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 4,5-bisphosphate + ATP → 1-phosphatidyl-1D-myo-inositol 3,4,5-trisphosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 4-phosphate + ATP → a 1-phosphatidyl-1D-myo-inositol 4,5-bisphosphate + ADP + H+ 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis : 4-amino-2-methyl-5-phosphomethylpyrimidine + ATP → 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP 4-amino-2-methyl-5-phosphomethylpyrimidine biosynthesis (yeast) : 4-amino-2-methyl-5-phosphomethylpyrimidine + ATP → 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP ATP + pyridoxine → ADP + pyridoxine 5'-phosphate + H+ pyridoxal + ATP → pyridoxal 5'-phosphate + ADP + H+ 4-methyl-5(β-hydroxyethyl)thiazole salvage (yeast) : ATP + 4-methyl-5-(β-hydroxyethyl)thiazole → ADP + 4-methyl-5-(2-phosphonooxyethyl)thiazole + H+ 5,6-dimethylbenzimidazole biosynthesis , flavin biosynthesis I (bacteria and plants) , flavin biosynthesis III (fungi) , flavin biosynthesis IV (mammalian) : riboflavin + ATP → ADP + FMN + H+ 5-aminoimidazole ribonucleotide biosynthesis I : ATP + N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + L-glutamine + H2O → L-glutamate + ADP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine + phosphate + H+ ATP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine → ADP + 5-amino-1-(5-phospho-β-D-ribosyl)imidazole + phosphate + H+ 5-phospho-β-D-ribosylamine + ATP + glycine → ADP + N1-(5-phospho-β-D-ribosyl)glycinamide + phosphate + H+ 5-aminoimidazole ribonucleotide biosynthesis II : ATP + N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + L-glutamine + H2O → L-glutamate + ADP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine + phosphate + H+ ATP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine → ADP + 5-amino-1-(5-phospho-β-D-ribosyl)imidazole + phosphate + H+ 5-phospho-β-D-ribosylamine + ATP + glycine → ADP + N1-(5-phospho-β-D-ribosyl)glycinamide + phosphate + H+ N1-(5-phospho-β-D-ribosyl)glycinamide + formate + ATP → N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + ADP + phosphate + H+ 5-dehydro-4-deoxy-D-glucuronate degradation , D-fructuronate degradation , D-galacturonate degradation I , Entner-Doudoroff pathway III (semi-phosphorylative) : 2-dehydro-3-deoxy-D-gluconate + ATP → 2-dehydro-3-deoxy-D-gluconate 6-phosphate + ADP + H+ acetyl-CoA biosynthesis III (from citrate) , reductive TCA cycle I : oxaloacetate + acetyl-CoA + ADP + phosphate ← citrate + ATP + coenzyme A acetylaszonalenin biosynthesis : L-tryptophan + anthranilate + 2 ATP → (R)-benzodiazepinedione + 2 ADP + 2 phosphate + H+ adenine and adenosine salvage II : adenosine + ATP → AMP + ADP + H+ adenine and adenosine salvage V : inosine + ATP → IMP + ADP + H+ adenosine deoxyribonucleotides de novo biosynthesis , adenosine deoxyribonucleotides de novo biosynthesis II : dADP + ATP → dATP + ADP adenosine ribonucleotides de novo biosynthesis : ATP + AMP ↔ 2 ADP adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I : adenosyl-cobyrinate a,c-diamide + 4 L-glutamine + 4 ATP + 4 H2O → 4 L-glutamate + adenosylcobyrate + 4 ADP + 4 phosphate + 4 H+ adenosylcobyrate + (R)-1-amino-2-propanol O-2-phosphate + ATP → adenosyl-cobinamide phosphate + ADP + phosphate + H+ adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II : adenosyl-cobyrinate a,c-diamide + 4 L-glutamine + 4 ATP + 4 H2O → 4 L-glutamate + adenosylcobyrate + 4 ADP + 4 phosphate + 4 H+ adenosylcobyrate + (R)-1-amino-2-propanol O-2-phosphate + ATP → adenosyl-cobinamide phosphate + ADP + phosphate + H+ adenosylcobalamin salvage from cobinamide II : adenosylcobyrate + (R)-1-amino-2-propanol O-2-phosphate + ATP → adenosyl-cobinamide phosphate + ADP + phosphate + H+ ADP-L-glycero-β-D-manno-heptose biosynthesis : D-glycero-D-manno-heptose 7-phosphate + ATP → D-glycero-β-D-manno-heptose 1,7-bisphosphate + ADP + H+ aerobactin biosynthesis : N6-acetyl-N6-hydroxy-L-lysine + citrate + 2 ATP + H2O → N1-citryl-N6-acetyl-N6-hydroxy-L-lysine + 2 ADP + 2 phosphate + 2 H+ N6-acetyl-N6-hydroxy-L-lysine + N1-citryl-N6-acetyl-N6-hydroxy-L-lysine + 2 ATP + H2O → aerobactin + 2 ADP + 2 phosphate + 2 H+ alginate degradation : alginate[extracellular space] + ATP + H2O → alginate[cytosol] + ADP + phosphate + H+ 2-dehydro-3-deoxy-D-gluconate + ATP → 2-dehydro-3-deoxy-D-gluconate 6-phosphate + ADP + H+ aminopropanol phosphate biosynthesis I : L-threonine + ATP → L-threonine 3-O-phosphate + ADP + H+ aminopropanol phosphate biosynthesis II : (R)-1-aminopropan-2-ol + ATP → (R)-1-amino-2-propanol O-2-phosphate + ADP + H+ ammonia assimilation cycle I , ammonia assimilation cycle II , glutamine biosynthesis I , glutamine biosynthesis III , nitrate reduction II (assimilatory) , nitrate reduction V (assimilatory) , nitrate reduction VI (assimilatory) : ammonium + L-glutamate + ATP → L-glutamine + ADP + phosphate + H+ anhydromuropeptides recycling : 1,6-anhydro-N-acetyl-β-muramate + ATP + H2O → N-acetyl-β-muramate 6-phosphate + ADP + H+ UDP-N-α-D-acetylmuramate + L-alanyl-γ-D-glutamyl-meso-diaminopimelate + ATP → UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimelate + ADP + phosphate + H+ aniline degradation : ATP + L-glutamate + aniline → ADP + N5-phenyl-L-glutamine + phosphate arginine biosynthesis I (via L-ornithine) , arginine biosynthesis II (acetyl cycle) , arginine biosynthesis III (via N-acetyl-L-citrulline) , UMP biosynthesis : 2 ATP + L-glutamine + hydrogen carbonate + H2O → L-glutamate + carbamoyl-phosphate + 2 ADP + phosphate + 2 H+ arginine biosynthesis IV (archaebacteria) : 2 ATP + L-glutamine + hydrogen carbonate + H2O → L-glutamate + carbamoyl-phosphate + 2 ADP + phosphate + 2 H+ an [L-2-aminoadipate carrier protein]-L-glutamate + ATP → an [L-2-aminoadipate carrier protein]-L-glutamate 5-phosphate + ADP L-glutamate + a [LysW protein]-L-glutamate + ATP → an [L-2-aminoadipate carrier protein]-L-glutamate + ADP + phosphate + H+ arsenate detoxification II (glutaredoxin) : arsenite[cytosol] + ATP + H2O → arsenite[periplasmic space] + ADP + phosphate + H+ asparagine biosynthesis III (tRNA-dependent) : L-glutamine + L-aspartyl-tRNAasn + ATP + H2O → L-glutamate + L-asparaginyl-tRNAasn + ADP + phosphate + H+ bacteriochlorophyll a biosynthesis : 3-hydroxyethylchlorophyllide a + ATP + a reduced electron acceptor + H2O → 2-desacetyl-2-hydroxyethyl bacteriochlorophyllide a + ADP + an oxidized electron acceptor + phosphate 3-vinyl-bacteriochlorophyllide a + ADP + an oxidized electron acceptor + phosphate ← chlorophyllide a + ATP + a reduced electron acceptor + H2O Bifidobacterium shunt , GDP-glucose biosynthesis , glucose and glucose-1-phosphate degradation , glycogen degradation I , sucrose biosynthesis II , trehalose degradation II (trehalase) , trehalose degradation V , UDP-N-acetyl-D-galactosamine biosynthesis II : β-D-glucose + ATP → β-D-glucose 6-phosphate + ADP + H+ biotin biosynthesis from 8-amino-7-oxononanoate I , biotin biosynthesis from 8-amino-7-oxononanoate II : CO2 + 7,8-diaminopelargonate + ATP → dethiobiotin + ADP + phosphate + 3 H+ biotin-carboxyl carrier protein assembly : a biotinylated [BCCP dimer] + hydrogen carbonate + ATP → a carboxylated-biotinylated [BCCP dimer] + ADP + phosphate + H+ ATP + acetyl-CoA + a carboxylated-biotinylated [BCCP dimer] + H2O → malonyl-CoA + a biotinylated [BCCP dimer] + ADP + phosphate + H+ butirosin biosynthesis : a BtrI acyl-carrier protein + L-glutamate + ATP → an L-glutamyl-[BtrI acyl-carrier protein] + ADP + phosphate a 4-amino butanoyl-[BtrI acyl-carrier protein] + L-glutamate + ATP → a 4-(γ-L-glutamylamino)butanoyl-[BtrI acyl-carrier protein] + ADP + phosphate + H+ C4 photosynthetic carbon assimilation cycle, PEPCK type , gluconeogenesis I , superpathway of glyoxylate cycle and fatty acid degradation : oxaloacetate + ATP → CO2 + phosphoenolpyruvate + ADP candicidin biosynthesis : 4-aminobenzoate + ATP + coenzyme A → 4-aminobenzoyl-CoA + ADP + phosphate carnosine biosynthesis : β-alanine + L-histidine + ATP → carnosine + ADP + phosphate + H+ CDP-2-glycerol biosynthesis : glycerol + ATP → glycerol 2-phosphate + ADP + H+ ceramide degradation : a sphingoid base + ATP → a sphingoid 1-phosphate + ADP + H+ chitin derivatives degradation : N-acetyl-β-D-glucosamine + ATP → N-acetyl-D-glucosamine 6-phosphate + ADP + H+ D-glucosamine + ATP → D-glucosamine 6-phosphate + ADP + H+ chlorophyllide a biosynthesis I (aerobic, light-dependent) : ATP + protoporphyrin IX + Mg2+ + H2O → Mg-protoporphyrin + ADP + phosphate + 3 H+ chlorophyllide a biosynthesis II (anaerobic) : ATP + protoporphyrin IX + Mg2+ + H2O → Mg-protoporphyrin + ADP + phosphate + 3 H+ chlorophyllide a + an oxidized ferredoxin + 2 ADP + 2 phosphate ← protochlorophyllide a + a reduced ferredoxin + 2 ATP + 2 H2O

Reactions known to both consume and produce the compound:

1-butanol autotrophic biosynthesis :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

3-hydroxypropanoate cycle , 3-hydroxypropanoate/4-hydroxybutanate cycle , propionyl CoA degradation :
propanoyl-CoA + ATP + hydrogen carbonate ↔ (S)-methylmalonyl-CoA + ADP + phosphate + H+

acetate formation from acetyl-CoA I , acetylene degradation , gallate degradation III (anaerobic) , lysine fermentation to acetate and butyrate , methanogenesis from acetate , purine nucleobases degradation I (anaerobic) , purine nucleobases degradation II (anaerobic) , pyruvate fermentation to acetate II , pyruvate fermentation to acetate IV , superpathway of fermentation (Chlamydomonas reinhardtii) :
ATP + acetate ↔ ADP + acetyl phosphate

acetate formation from acetyl-CoA II , pyruvate fermentation to acetate III :
acetate + ATP + coenzyme A ↔ acetyl-CoA + ADP + phosphate

adenosine deoxyribonucleotides de novo biosynthesis , adenosine deoxyribonucleotides de novo biosynthesis II :
dADP + an oxidized thioredoxin + H2O ↔ ADP + a reduced thioredoxin

adenosine nucleotides degradation IV , PRPP biosynthesis II :
α-D-ribose 1,5-bisphosphate + ATP ↔ 5-phospho-α-D-ribose 1-diphosphate + ADP

adenosine ribonucleotides de novo biosynthesis :
ATP + 3 H+[in] + H2O ↔ ADP + phosphate + 4 H+[out]

adenosylcobalamin salvage from cobinamide I :
adenosylcobinamide + ATP ↔ adenosyl-cobinamide phosphate + ADP + H+

allantoin degradation IV (anaerobic) , citrulline degradation :
ammonium + CO2 + ATP ↔ carbamoyl-phosphate + ADP + 2 H+

anaerobic energy metabolism (invertebrates, cytosol) , Entner-Doudoroff pathway II (non-phosphorylative) , Entner-Doudoroff pathway III (semi-phosphorylative) , photosynthetic 3-hydroxybutyrate biosynthesis (engineered) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

anaerobic energy metabolism (invertebrates, mitochondrial) :
succinate[mitochondrial lumen] + ATP[mitochondrial lumen] + coenzyme A[mitochondrial lumen] ↔ succinyl-CoA[mitochondrial lumen] + ADP[mitochondrial lumen] + phosphate[mitochondrial lumen]
propanoyl-CoA + ATP + hydrogen carbonate ↔ (S)-methylmalonyl-CoA + ADP + phosphate + H+

arginine biosynthesis II (acetyl cycle) , arginine biosynthesis III (via N-acetyl-L-citrulline) , ornithine biosynthesis :
N-acetyl-L-glutamate + ATP ↔ N-acetylglutamyl-phosphate + ADP

benzoyl-CoA degradation II (anaerobic) , benzoyl-CoA degradation III (anaerobic) :
cyclohex-1,5-diene-1-carbonyl-CoA + an oxidized ferredoxin + 2 ADP + 2 phosphate ↔ benzoyl-CoA + a reduced ferredoxin + 2 ATP + 2 H2O

Bifidobacterium shunt :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
ATP + acetate ↔ ADP + acetyl phosphate

Calvin-Benson-Bassham cycle :
D-ribulose 5-phosphate + ATP ↔ D-ribulose-1,5-bisphosphate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

chorismate biosynthesis from 3-dehydroquinate :
shikimate + ATP ↔ shikimate 3-phosphate + ADP + H+

creatine-phosphate biosynthesis :
creatine + ATP ↔ creatine-phosphate + ADP + H+

D-arabinose degradation II , ribitol degradation :
ATP + D-ribulose ↔ ADP + D-ribulose 5-phosphate + H+

D-galactose degradation V (Leloir pathway) , galactose degradation I (Leloir pathway) , galactose degradation III , stachyose degradation :
α-D-galactose + ATP ↔ α-D-galactose 1-phosphate + ADP + H+

ectoine biosynthesis , grixazone biosynthesis , homoserine biosynthesis , lysine biosynthesis I , lysine biosynthesis II , lysine biosynthesis III , lysine biosynthesis VI , norspermidine biosynthesis , spermidine biosynthesis II :
L-aspartate + ATP ↔ L-aspartyl-4-phosphate + ADP

ethylmalonyl pathway , formaldehyde assimilation I (serine pathway) :
(S)-malate + ATP + coenzyme A ↔ (S)-malyl-CoA + ADP + phosphate

formaldehyde assimilation III (dihydroxyacetone cycle) , gluconeogenesis I , gluconeogenesis III , sucrose biosynthesis I (from photosynthesis) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

gluconeogenesis II (Methanobacterium thermoautotrophicum) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
β-D-fructofuranose 6-phosphate + ADP ↔ fructose 1,6-bisphosphate + AMP + H+

glycerol degradation I :
glycerol + ATP ↔ sn-glycerol 3-phosphate + ADP + H+

glycerol degradation to butanol :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

glycogen biosynthesis I (from ADP-D-Glucose) , starch biosynthesis :
ADP-α-D-glucose + (1,4-α-D-glucosyl)(n)ADP + (1,4-α-D-glucosyl)(n+1)

glycolysis I (from glucose 6-phosphate) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

glycolysis II (from fructose 6-phosphate) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

glycolysis III (from glucose) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

glycolysis IV (plant cytosol) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

glycolysis V (Pyrococcus) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
β-D-fructofuranose 6-phosphate + ADP ↔ fructose 1,6-bisphosphate + AMP + H+

glycolysis VI (metazoan) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

heterolactic fermentation :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

incomplete reductive TCA cycle , pyruvate fermentation to acetate V , pyruvate fermentation to acetate VI , reductive TCA cycle I , reductive TCA cycle II , TCA cycle I (prokaryotic) , TCA cycle II (plants and fungi) , TCA cycle III (animals) , TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase) , TCA cycle VI (obligate autotrophs) :
succinate[mitochondrial lumen] + ATP[mitochondrial lumen] + coenzyme A[mitochondrial lumen] ↔ succinyl-CoA[mitochondrial lumen] + ADP[mitochondrial lumen] + phosphate[mitochondrial lumen]

isoprene biosynthesis II (engineered) :
(R)-mevalonate 5-phosphate + ATP ↔ (R)-mevalonate diphosphate + ADP
(R)-mevalonate + ATP ↔ (R)-mevalonate 5-phosphate + ADP + H+

L-1,2-propanediol degradation , threonine degradation I :
ATP + propanoate ↔ ADP + propanoyl phosphate

methylaspartate cycle :
succinate[mitochondrial lumen] + ATP[mitochondrial lumen] + coenzyme A[mitochondrial lumen] ↔ succinyl-CoA[mitochondrial lumen] + ADP[mitochondrial lumen] + phosphate[mitochondrial lumen]
propanoyl-CoA + ATP + hydrogen carbonate ↔ (S)-methylmalonyl-CoA + ADP + phosphate + H+

mevalonate pathway I :
(R)-mevalonate 5-phosphate + ATP ↔ (R)-mevalonate diphosphate + ADP
(R)-mevalonate + ATP ↔ (R)-mevalonate 5-phosphate + ADP + H+

mevalonate pathway II (archaea) :
(R)-mevalonate + ATP ↔ (R)-mevalonate 5-phosphate + ADP + H+
isopentenyl phosphate + ATP ↔ isopentenyl diphosphate + ADP

mevalonate pathway III (archaea) :
isopentenyl phosphate + ATP ↔ isopentenyl diphosphate + ADP

mixed acid fermentation :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
ATP + acetate ↔ ADP + acetyl phosphate

phosphatidate metabolism, as a signaling molecule :
a 1,2-diacyl-sn-glycerol 3-phosphate + ATP ↔ a 1,2-diacyl-sn-glycerol 3-diphosphate + ADP

pyruvate fermentation to butanoate :
butanoate + ATP ↔ butanoyl phosphate + ADP

Rubisco shunt :
D-ribulose 5-phosphate + ATP ↔ D-ribulose-1,5-bisphosphate + ADP + H+
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

selenocysteine biosynthesis II (archaea and eukaryotes) :
L-seryl-tRNAsec + ATP ↔ O-phospho-L-seryl-tRNASec + ADP

sulfate activation for sulfonation :
adenosine 5'-phosphosulfate + ATP ↔ 3'-phosphoadenylyl-sulfate + ADP + H+

superpathway of glucose and xylose degradation :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

trehalose biosynthesis II :
α-D-glucose 6-phosphate + ADP-α-D-glucose ↔ α,α-trehalose 6-phosphate + ADP + H+

Not in pathways:
an isocitrate dehydrogenase + ATP ↔ a phosphorylated isocitrate dehydrogenase + ADP
L-arginine + ATP ↔ Nω-phospho-L-arginine + ADP + H+
guanidinoacetate + ATP ↔ guanidinoacetate-phosphate + ADP + H+
lombricine + ATP ↔ N-phospholombricine + ADP + H+
a reduced nitrogenase-reductase + an oxidized nitrogenase + 16 ATP ↔ an oxidized nitrogenase-reductase + a reduced nitrogenase + 16 ADP + 16 phosphate
taurocyamine + ATP ↔ N(ω)-phosphotaurocyamine + ADP + 2 H+
ATP + (polyphosphate)(n)ADP + (polyphosphate)(n+1)
propanoate + ATP + coenzyme A ↔ propanoyl-CoA + ADP + phosphate
thiamin diphosphate + ADP + H+ ↔ adenosine thiamine triphosphate + phosphate

trehalose biosynthesis VI :
an NDP-α-D-glucose + D-glucopyranose ↔ α,α-trehalose + a nucleoside diphosphate + H+


(ribonucleotides)(n) + phosphate ↔ (ribonucleotides)(n-1) + a nucleoside diphosphate

In Reactions of unknown directionality:

Not in pathways: deoxy-5-methylcytidylate + ATP = 5-methyldeoxycytidine diphosphate + ADP (2E,6E)-farnesyl diphosphate + ATP = farnesyl triphosphate + ADP a nucleoside triphosphate + AMP = a nucleoside diphosphate + ADP guanidinoethyl methyl phosphate + ATP = N'-phosphoguanidinoethyl methyl phosphate + ADP + H+ agmatine + ATP = N4-Phosphoagmatine + ADP + 2 H+ L-glutamate + ATP = α-L-glutamyl phosphate + ADP formate + ATP = formyl phosphate + ADP ATP + a tau protein = ADP + an O-phospho-tau protein ATP + a tropomyocin = ADP + an O-phosphotropomyocin viomycin + ATP = O-phosphoviomycin + ADP + H+ xylitol + ATP = xylitol 5-phosphate + ADP + H+ ATP + [a DNA-directed RNA-polymerase] = ADP + phospho-[DNA-directed RNA-polymerase] a 5'-dephospho-DNA + ATP = a 5'-phospho-DNA + ADP D-sedoheptulose + ATP = D-sedoheptulose 7-phosphate + ADP + H+ streptomycin + ATP = streptomycin 3''-phosphate + ADP + H+ pantetheine + ATP = 4'-phosphopantetheine + ADP + H+ α-D-glucose 1-phosphate + ATP = α-glucose 1,6-bisphosphate + ADP + H+ D-hamamelose + ATP = D-hamamelose 2'-phosphate + ADP + H+ hygromycin-B + ATP = 7''-O-phosphohygromycin B + ADP + H+ ATP + dephospho-[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase = ADP + [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase erythritol + ATP = D-erythritol 4-phosphate + ADP + H+ β-D-cellobiose + ATP = β-D-cellobiose 6'-phosphate + ADP + H+ L-ascorbate + ATP = 2-phospho-L-ascorbate + ADP + H+ isobutyrate + ATP = 2-methylpropanoyl phosphate + ADP sn-glycerol 3-phosphate + ADP-α-D-glucose = ADP + 2-(β-D-glucosyl)-sn-glycerol 3-phosphate + H+ 5',5'''-diadenosine triphosphate + H2O = AMP + ADP + 2 H+ dihydrostreptomycin 6-phosphate + ATP = dihydrostreptomycin 3'-α-6-bisphosphate + ADP + H+ ATP + a 3-hydroxy-3-methylglutaryl-CoA reductase = ADP + a 3-hydroxy-3-methylglutaryl-CoA reductase-phosphate D-myo-inositol (1,4,5,6)-tetrakisphosphate + ATP = D-myo-inositol (1,2,4,5,6)-pentakisphosphate + ADP + H+ D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP = 1D-myo-inositol (1,2,3,4,6)-pentakisphosphate + ADP + H+ 1D-myo-inositol (1,2,3,4,6)-pentakisphosphate + ATP = 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ ATP + N-acetyl-α-D-galactosamine = ADP + N-acetyl-α-D-galactosamine 1-phosphate + H+ ADP-α-D-glucose + a protein = α-D-glucosyl-protein + ADP ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + myosin light-chain + H+ = ADP + myosin light-chain phosphate Goodpasture antigen-binding protein + ATP = Goodpasture antigen-binding phosphoprotein + ADP Fas-activated serine/threonine protein + ATP = Fas-activated serine/threonine phosphoprotein + ADP ATP + a receptor protein = ADP + a phosphorylated receptor protein ATP + mitogen-activated protein kinase kinase = ADP + phosphorylated mitogen-activated protein kinase kinase ATP + a protein = ADP + a phosphoprotein ATP + elongation-factor 2 = ADP + phosphorylated elongation-factor 2 ATP + a G-protein-coupled-receptor = ADP + a phosphorylated G-protein-coupled-receptor ATP + an IκB protein = ADP + a phosphorylated IκB protein ATP + [tyrosine-3-monooxygenase] = ADP + phosphorylated [tyrosine-3-monooxygenase] a rhodopsin + ATP = a phosphorhodopsin + ADP ATP + a branched-chain 2-keto acid dehydrogenase = ADP + a phosphorylated branched-chain 2-keto acid dehydrogenase ATP + a pyruvate dehydrogenase = ADP + a phosphorylated pyruvate dehydrogenase ATP + a β-adrenergic receptor = ADP + a phosphorylated β-adrenergic receptor di-trans,octa-cis-undecaprenol + ATP = di-trans,octa-cis-undecaprenyl phosphate + ADP + H+ a phosphorylase b + 2 ATP = a phosphorylase a + 2 ADP a myosin heavy chain + ATP = a myosin-heavy chain-phosphate + ADP hygromycin-B + ATP = 4-O-phosphohygromycin + ADP + H+ D-myo-inositol (4,5)-bisphosphate + ATP = D-myo-inositol (1,4,5)-trisphosphate + ADP + H+ 3 N-hydroxy-N-succinylcadaverine + ATP = desferrioxamine G1 + ADP + phosphate + H+ + H2O α-Kdo-(2->4)-α-Kdo-(2->6)-lipid IVA + ADP-L-glycero-β-D-manno-heptose = heptosyl-Kdo2-lipid IVA + ADP + H+ α-Kdo-(2→6)-lipid IVA + ATP = 4-O-phospho-α-Kdo-(2→6)-lipid IVA + ADP + H+ a supercoiled duplex DNA + ATP = a single stranded DNA + ADP + phosphate hypotaurocyamine + ATP = Nω-phosphohypotaurocyamine + ADP + H+ a [protein]-N6-D-psicosyl-L-lysine + ATP = a [protein]-N6-(O3)-phospho-D-psicosyl-L-lysine + ADP a [protein]-N6-D-erythrulosyl-L-lysine + ATP = a [protein]-N6-(O3)-phospho-D-erythrulosyl-L-lysine + ADP 1-O-alkyl-sn-glycerol + ATP = a 1-alkyl-sn-glycerol 3-phosphate + ADP + H+ (2E,6E)-farnesol + ATP = 2-trans,-6-trans-farnesyl monophosphate + ADP + H+ geraniol + ATP = geranyl monophosphate + ADP + H+ geranylgeraniol + ATP = all-trans-geranyl-geranyl monophosphate + ADP + H+ MEK + 2 ATP = 2 ADP + phospho-MEK 2 ATP + ERK = phospho-ERK + 2 ADP a kanamycin + ATP = a kanamycin 3-phosphate + ADP + H+ an N-acetyl-D-hexosamine + ATP = an N-acetyl-α-D-hexosamine 1-phosphate + ADP + H+ a 1-monoglyceride + ATP = a 1-acyl-sn-glycerol 3-phosphate + ADP + H+ peroxiredoxin-(S-hydroxy-S-oxocysteine) + ATP + a protein dithiol = peroxiredoxin-(S-hydroxycysteine) + ADP + a protein disulfide + phosphate + H+ an N5-formyl-tetrahydrofolate + L-glutamate + ATP = 5-formyl-THF-Glun+1 + ADP + phosphate a [protein]-N6-D-fructosyl-L-lysine + ATP = a [protein]-N6-(3-O-phospho-D-fructosyl)-L-lysine + ADP + H+ a [protein]-N6-D-ribulosyl-L-lysine + ATP = a [protein]-N6-(3-O-phospho-D-ribulosyl)-L-lysine + ADP poly (D-glutamate)n + L-glutamate + ATP = poly (D-glutamate)(n+1) + ADP + phosphate a [Co(II) methylamine-specific corrinoid protein] + ATP + a reduced electron acceptor = a [Co(I) methylamine-specific corrinoid protein] + ADP + an oxidized electron acceptor + phosphate a [Co(II) dimethylamine-specific corrinoid protein] + ATP + a reduced electron acceptor = a [Co(I) dimethylamine-specific corrinoid protein] + ADP + an oxidized electron acceptor + phosphate a [Co(II) trimethylamine-specific corrinoid protein] + ATP + a reduced electron acceptor = a [Co(I) trimethylamine-specific corrinoid protein] + ADP + an oxidized electron acceptor + phosphate oleandomycin + ATP = oleandomycin 2'-O-phosphate + ADP + H+ 5',5'''-diadenosine pentaphosphate + H2O = ADP + ATP + 2 H+ D-ornithine + L-lysine + ATP = D-ornithyl-Nε-L-lysine + ADP + phosphate D-myo-inositol (1,4,5)-trisphosphate + 2 ATP = D-myo-inositol 1,3,4,5,6-pentakisphosphate + 2 ADP + 2 H+ ATP + α-maltose = ADP + α-maltose 1-phosphate + H+ ATP + UDP-N-acetyl-α-D-glucosamine = ADP + UDP-N-acetyl-α-D-glucosamine 3'-phosphate + H+ a double stranded DNA + ATP = a negatively supercoiled DNA + ADP + phosphate a 1-phosphatidyl-1D-myo-inositol 3-phosphate + ATP = a 1-phosphatidyl-1D-myo-inositol 3,4-bisphosphate + ADP + H+ a ceramide + ATP = a ceramide 1-phosphate + ADP + H+ an N-acyl-D-mannosamine + ATP = an N-acyl-α-D-mannosamine 6-phosphate + ADP + H+ ATP + ribulose = ADP + L(or D)-ribulose 5-phosphate + H+ a D-hexose + ATP = D-hexose 6-phosphate + ADP + H+ an [acetyl-CoA carboxylase] + ATP + H2O = an [acetyl-CoA carboxylase] phosphate + ADP + 2 H+ 4-methylbenzoyl-CoA + 2 ATP + a reduced electron acceptor + 2 H2O = 4-methylcyclohex-1,5-diene-1-carbonyl-CoA + 2 ADP + an oxidized electron acceptor + 2 phosphate + 2 H+ ATP + a diphospho-1D-myo-inositol pentakisphosphate = ADP + a bis(diphospho)-1D-myo-inositol tetrakisphosphate ATP + (S)-NADPHX = ADP + NADPH + phosphate + H+ 2'-deoxycytidine + ATP = dCMP + ADP + H+ ATP + IDP = ITP + ADP carbamate + ATP = carbamoyl-phosphate + ADP 2'-deoxyribose + ATP = 2-deoxy-D-ribose 5-phosphate + ADP + H+ ATP + dIDP = ADP + dITP cob(II)yrinate c-monoamide + L-glutamine + ATP + H2O = cob(II)yrinate a,c-diamide + L-glutamate + ADP + phosphate + H+ α-D-ribose 5-phosphate + ATP = α-D-ribose 1,5-bisphosphate + ADP + H+ ATP + [low-density-lipoprotein receptor]-L-serine = ADP + [low-density-lipoprotein receptor]-O-phospho-L-serine + H+ cobyrinate + L-glutamine + ATP + H2O = cob(II)yrinate c-monoamide + L-glutamate + ADP + phosphate + H+ ATP + α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)-[α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)]n-α-D-Man-(1→3)-α-D-Man-(1→3)-α-D-GlcNAc-diphospho-ditrans,octacis-undecaprenol = ADP + 3-O-phospho-α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)-[α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)]n-α-D-Man-(1→3)-α-D-Man-(1→3)-α-D-GlcNAc-diphospho-ditrans,octacis-undecaprenol aldehydo-D-arabinose + ATP = D-arabinose 5-phosphate + ADP + H+ D-tagatofuranose + ATP = D-tagatofuranose 6-phosphate + ADP + H+ ATP + O2-[N-acetyl-β-D-galactosaminyl-(1→3)-N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosyl]-L-threonyl-[protein] = ADP + O2-[N-acetyl-β-D-galactosaminyl-(1→3)-N-acetyl-β-D-glucosaminyl-(1→4)-α-D-(6-phospho)mannosyl]-L-threonyl-[protein] + H+ ammonium + ATP = phosphoramidate + ADP + 2 H+ 6 a reduced flavodoxin + N2 + n ATP + 6 H+ = 6 an oxidized flavodoxin + 2 ammonium + n ADP + n phosphate ATP + a [protein]-L-serine = ADP + a protein L-serine phosphate + H+ ATP + a [protein]-L-threonine = ADP + a [protein] L-threonine phosphate + H+ O-alkylglycerone + ATP = 1-alkyl-glycerone 3-phosphate + ADP + H+ a [protein]-L-histidine + ATP = a protein-Nτ-phospho-L-histidine + ADP + H+ ATP + a [protein]-L-histidine = a protein-Nπ-phospho-L-histidine + ADP + H+ sucrose + ATP = sucrose 6-phosphate + ADP + H+ N6-L-threonylcarbamoyladenine37 in tRNA + ATP = cyclic N6-L-threonylcarbamoyladenosine 37 in tRNA + ADP + phosphate 4-hydroxy-2,2'-bipyrrole-5-carbaldehyde + 2-methyl-3-n-amyl-pyrrole + ATP = norprodigiosin + ADP + phosphate + H+ 4-methoxy-2,2'-bipyrrole-5-carbaldehyde + 2-undecylpyrrole + ATP = undecylprodigiosin + ADP + phosphate + H+ a [protein]-L-arginine + ATP = a [protein]-Nω-phospho-L-arginine + ADP + H+ (deoxynucleotides)(m) + ADP + (deoxynucleotides)(n) = (deoxynucleotides)(n+m) + AMP + phosphate ADP + H2O + H+ = IDP + ammonium a pyruvate,water dikinase + ADP = [a pyruvate, water dikinase]-phosphate + AMP + H+ a pyruvate,phosphate dikinase + ADP = a [pyruvate,phosphate dikinase]-phosphate + AMP + H+ an α-D-aldose 1-phosphate + ADP + H+ = an ADP-aldose + phosphate ADP + H2O = AMP + phosphate + H+ thymidine + ADP = dTMP + AMP + H+ D-ribose 5-phosphate + ADP + H+ = ADP-D-ribose + phosphate ATP + ADP + H+ = 5',5'''-diadenosine tetraphosphate + phosphate

In Transport reactions:
an oligosaccharide[extracellular space] + ATP + H2O ↔ an oligosaccharide[cytosol] + ADP + phosphate ,
an oligopeptide[extracellular space] + ATP + H2O ↔ an oligopeptide[cytosol] + ADP + phosphate ,
a teichoic acid[cytosol] + ATP + H2O ↔ a teichoic acid[cell wall] + ADP + phosphate ,
a peptide[cytosol] + ATP + H2O ↔ a peptide[extracellular space] + ADP + phosphate ,
a xenobiotic[cytosol] + ATP + H2O ↔ a xenobiotic[extracellular space] + ADP + phosphate ,
a vitamin B12[extracellular space] + ATP + H2O ↔ a vitamin B12[cytosol] + ADP + phosphate ,
a β-D glucan[cytosol] + ATP + H2O ↔ a β-D glucan[extracellular space] + ADP + phosphate ,
α factor[cytosol] + ATP + H2O ↔ α factor[extracellular space] + ADP + phosphate ,
a monosaccharide[extracellular space] + ATP + H2O ↔ a monosaccharide[cytosol] + ADP + phosphate ,
a polar amino acid[extracellular space] + ATP + H2O ↔ a polar amino acid[cytosol] + ADP + phosphate ,
a non-polar amino acid[extracellular space] + ATP + H2O ↔ a non-polar amino acid[cytosol] + ADP + phosphate ,
a polyamine[extracellular space] + ATP + H2O ↔ a polyamine[cytosol] + ADP + phosphate ,
chloride[cytosol] + ATP + H2O ↔ chloride[extracellular space] + ADP + phosphate + H+ ,
a capsular polysaccharide[in] + ATP + H2O ↔ a capsular polysaccharide[out] + ADP + phosphate ,
ATP + K+[out] + H2O + H+[in]ADP + K+[in] + phosphate + H+[in] + H+[in] ,
chloride[extracellular space] + ATP + H2O ↔ chloride[cytosol] + ADP + phosphate + H+ ,
ATP + K+[out] + H2O ↔ ADP + K+[in] + phosphate + H+ ,
sn-glycerol 3-phosphate[extracellular space] + ATP + H2O ↔ sn-glycerol 3-phosphate[cytosol] + ADP + phosphate + H+ ,
Ni2+[extracellular space] + ATP + H2O ↔ Ni2+[cytosol] + ADP + phosphate + H+ ,
sulfate[extracellular space] + ATP + H2O ↔ sulfate[cytosol] + ADP + phosphate + H+ ,
nitrate[extracellular space] + ATP + H2O ↔ nitrate[cytosol] + ADP + phosphate + H+ ,
phosphonate[extracellular space] + ATP + H2O ↔ phosphonate[cytosol] + ADP + phosphate + H+ ,
molybdate[extracellular space] + ATP + H2O ↔ molybdate[cytosol] + ADP + phosphate + H+ ,
Cd2+[cytosol] + ATP + H2O ↔ Cd2+[extracellular space] + ADP + phosphate + H+ ,
Fe3+[extracellular space] + ATP + H2O ↔ Fe3+[cytosol] + ADP + phosphate + H+ ,
Mn2+[extracellular space] + ATP + H2O ↔ Mn2+[cytosol] + ADP + phosphate + H+ ,
taurine[extracellular space] + ATP + H2O ↔ taurine[cytosol] + ADP + phosphate + H+ ,
guanine[extracellular space] + ATP + H2O ↔ guanine[cytosol] + ADP + phosphate + H+ ,
heme b[cytosol] + ATP + H2O ↔ heme b[periplasmic space] + ADP + phosphate + H+ ,
Cd2+[cytosol] + ATP + H2O ↔ Cd2+[vacuolar lumen] + ADP + phosphate + H+ ,
Ag+[cytosol] + ATP + H2O ↔ Ag+[extracellular space] + ADP + phosphate + H+ ,
Ca2+[plastid stroma] + ATP + H2O ↔ Ca2+[cytosol] + ADP + phosphate + H+ ,
Ca2+[in] + ATP + H2O ↔ Ca2+[out] + ADP + phosphate + H+ ,
Ca2+[out] + ATP + H2O ↔ Ca2+[in] + ADP + phosphate + H+ ,
a quaternary amine[extracellular space] + ATP + H2O ↔ a quaternary amine[cytosol] + ADP + phosphate + H+ ,
a lipopolysaccharide[cytosol] + ATP + H2O → a lipopolysaccharide[periplasmic space] + ADP + phosphate + H+ ,
Zn2+[cytosol] + ATP + H2O → Zn2+[periplasmic space] + ADP + phosphate + H+ ,
a long-chain acyl-CoA[peroxisomal membrane] + ATP + H2O ↔ a long-chain acyl-CoA[peroxisomal membrane] + ADP + phosphate + H+ ,
lipid A-core[cytosol] + ATP + H2O → lipid A-core[periplasmic space] + ADP + phosphate + H+ ,
Cu2+[out] + ATP + H2O ↔ Cu2+[in] + ADP + phosphate + H+ ,
an aminoalkylphosphonate[periplasmic space] + ATP + H2O → an aminoalkylphosphonate[cytosol] + ADP + phosphate + H+ ,
Cu+[cytosol] + ATP + H2O ↔ Cu+[extracellular space] + ADP + phosphate + H+ ,
ATP + phosphate[periplasmic space] + H2O ↔ ADP + phosphate[cytosol] + phosphate[cytosol] + H+ ,
Cu2+[cytosol] + ATP + H2O → Cu2+[extracellular space] + ADP + phosphate + H+ ,
an Fe(III)-siderophore[extracellular space] + ATP + H2O → an Fe(III)-siderophore[cytosol] + ADP + phosphate + H+ ,
tungstate[periplasmic space] + ATP + H2O → tungstate[cytosol] + ADP + phosphate + H+ ,
Na+[cytosol] + ATP + H2O ↔ Na+[extracellular space] + ADP + phosphate + H+ ,
ATP + H+[cytosol] + H2O → ADP + phosphate + H+[extracellular space] ,
ATP[cytosol] + ADP[chloroplast stroma] + phosphate[chloroplast stroma] → ATP[chloroplast stroma] + ADP[cytosol] + phosphate[cytosol] ,
2 K+[extracellular space] + 3 Na+[cytosol] + ATP + H2O → 2 K+[cytosol] + 3 Na+[extracellular space] + ADP + phosphate + H+ ,
maltose[extracellular space] + ATP + H2O → maltose[cytosol] + ADP + phosphate + H+ ,
maltotetraose[periplasmic space] + ATP + H2O → ADP + maltotetraose[cytosol] + phosphate + H+ ,
ATP + arsenate[cytosol] + H2O → ADP + arsenate[periplasmic space] + phosphate + H+ ,
ATP + a dipeptide[periplasmic space] + H2O → ADP + a dipeptide[cytosol] + phosphate + H+ ,
ATP + β-D-ribopyranose[periplasmic space] + H2O → ADP + β-D-ribopyranose[cytosol] + phosphate + H+ ,
ATP + a ferric hydroxamate complex[periplasmic space] + H2O → ADP + a ferric hydroxamate complex[cytosol] + phosphate ,
α-D-galactofuranose[periplasmic space] + ATP + H2O → α-D-galactofuranose[cytosol] + ADP + phosphate + H+ ,
taurine[periplasmic space] + ATP + H2O → taurine[cytosol] + ADP + phosphate + H+ ,
ATP + putrescine[periplasmic space] + H2O → ADP + putrescine[cytosol] + phosphate + H+ ,
ATP + L-methionine[periplasmic space] + H2O → ADP + L-methionine[cytosol] + phosphate + H+ ,
ATP + cob(I)alamin[periplasmic space] + H2O → ADP + cob(I)alamin[cytosol] + phosphate + H+ ,
ATP + L-ornithine[periplasmic space] + H2O → ADP + L-ornithine[cytosol] + phosphate + H+ ,
ATP + molybdate[periplasmic space] + H2O → ADP + molybdate[cytosol] + phosphate + H+ ,
a glycerophosphodiester[periplasmic space] + ATP + H2O → a glycerophosphodiester[cytosol] + ADP + phosphate + H+ ,
ATP + L-aspartate[periplasmic space] + H2O → L-aspartate[cytosol] + ADP + phosphate + H+ ,
glutathione[cytosol] + ATP + H2O → glutathione[periplasmic space] + ADP + phosphate + H+ ,
ATP + sn-glycerol 3-phosphate[periplasmic space] + H2O → ADP + sn-glycerol 3-phosphate[cytosol] + phosphate + H+ ,
ATP + L-isoleucine[periplasmic space] + H2O → ADP + L-isoleucine[cytosol] + phosphate + H+ ,
N-acetyl-DL-methionine[periplasmic space] + ATP + H2O → N-acetyl-DL-methionine[cytosol] + ADP + phosphate + H+ ,
heme b[cytosol] + ATP + H2O → heme b[periplasmic space] + ADP + phosphate + H+ ,
ATP + ferric dicitrate[periplasmic space] + H2O → ADP + ferric dicitrate[cytosol] + phosphate + H+ ,
L-lysine[periplasmic space] + ATP + H2O → L-lysine[cytosol] + ADP + phosphate + H+ ,
ATP + L-glutamine[periplasmic space] + H2O → ADP + L-glutamine[cytosol] + phosphate + H+ ,
β-D-galactofuranose[periplasmic space] + ATP + H2O → β-D-galactofuranose[cytosol] + ADP + phosphate + H+ ,
ATP + thiosulfate[periplasmic space] + H2O → ADP + thiosulfate[cytosol] + phosphate + H+ ,
ATP + L-proline[periplasmic space] + H2O → ADP + L-proline[cytosol] + phosphate + H+ ,
selenate[periplasmic space] + ATP + H2O → selenate[cytosol] + ADP + phosphate + H+ ,
ATP + an aliphatic sulfonate[periplasmic space] + H2O → an aliphatic sulfonate[cytosol] + ADP + phosphate + H+ ,
ATP + an alkylphosphonate[periplasmic space] + H2O → ADP + an alkylphosphonate[cytosol] + phosphate + H+ ,
ATP + L-alanyl-γ-D-glutamyl-meso-diaminopimelate[periplasmic space] + H2O → L-alanyl-γ-D-glutamyl-meso-diaminopimelate[cytosol] + ADP + phosphate + H+ ,
ATP + L-arginine[periplasmic space] + H2O → ADP + L-arginine[cytosol] + phosphate + H+ ,
ATP + L-arabinose[periplasmic space] + H2O → ADP + L-arabinose[cytosol] + phosphate + H+ ,
ATP + L-leucine[periplasmic space] + H2O → ADP + L-leucine[cytosol] + phosphate + H+ ,
maltose[periplasmic space] + ATP + H2O → maltose[cytosol] + ADP + phosphate + H+ ,
L-methionine S-oxide[periplasmic space] + ATP + H2O → L-methionine S-oxide[cytosol] + ADP + phosphate + H+ ,
ATP + D-methionine[periplasmic space] + H2O → ADP + D-methionine[cytosol] + phosphate + H+ ,
a quaternary amine[periplasmic space] + ATP + H2O → a quaternary amine[cytosol] + ADP + phosphate + H+ ,
ATP + thiamin[periplasmic space] + H2O → ADP + thiamin[cytosol] + phosphate + H+ ,
ATP + L-glutamate[periplasmic space] + H2O → ADP + L-glutamate[cytosol] + phosphate + H+ ,
maltotriose[periplasmic space] + ATP + H2O → ADP + maltotriose[cytosol] + phosphate + H+ ,
Mg2+[periplasmic space] + ATP + H2O → Mg2+[cytosol] + ADP + phosphate + H+ ,
sulfate[periplasmic space] + ATP + H2O → sulfate[cytosol] + ADP + phosphate + H+ ,
ATP + phosphate[periplasmic space] + H2O → ADP + 2 phosphate[cytosol] + H+ ,
ATP + ferric enterobactin complex[periplasmic space] + H2O → ADP + ferric enterobactin complex[cytosol] + phosphate + H+ ,
selenite[periplasmic space] + ATP + H2O → selenite[cytosol] + ADP + phosphate + H+ ,
K+[periplasmic space] + ATP + H2O → K+[cytosol] + ADP + phosphate + H+ ,
Zn2+[periplasmic space] + ATP + H2O → Zn2+[cytosol] + ADP + phosphate + H+ ,
ATP + spermidine[periplasmic space] + H2O → ADP + spermidine[cytosol] + phosphate + H+ ,
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran[periplasmic space] + ATP + H2O → (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran[cytosol] + ADP + phosphate + H+ ,
L-cysteine[cytosol] + ATP + H2O → L-cysteine[periplasmic space] + ADP + phosphate + H+ ,
D-allose[periplasmic space] + ATP + H2O → D-allose[cytosol] + ADP + phosphate + H+ ,
Ni2+[periplasmic space] + ATP + H2O → Ni2+[cytosol] + ADP + phosphate + H+ ,
ATP + L-valine[periplasmic space] + H2O → ADP + L-valine[cytosol] + phosphate + H+ ,
ATP + β-D-galactose[periplasmic space] + H2O → ADP + β-D-galactose[cytosol] + phosphate + H+ ,
methyl-β-D-galactoside[periplasmic space] + ATP + H2O → methyl-β-D-galactoside[cytosol] + ADP + phosphate + H+ ,
Cu+[cytosol] + ATP + H2O → Cu+[periplasmic space] + ADP + phosphate + H+ ,
glutathione[periplasmic space] + ATP + H2O → glutathione[cytosol] + ADP + phosphate + H+ ,
ATP + D-xylose[periplasmic space] + H2O → ADP + D-xylose[cytosol] + phosphate + H+ ,
ATP + L-histidine[periplasmic space] + H2O → ADP + L-histidine[cytosol] + phosphate + H+ ,
ATP + 4 H+[in] + H2O ↔ ADP + phosphate + 5 H+[out] ,
a phospholipid[in] + ATP + H2O → a phospholipid[out] + ADP + phosphate + H+ ,
Mg2+[extracellular space] + ATP + H2O → Mg2+[cytosol] + ADP + phosphate + H+ ,
Na+[in] + ATP + H2O ↔ Na+[out] + ADP + phosphate + H+

Enzymes activated by ADP, sorted by the type of activation, are:

Activator (Allosteric) of: 6-phosphofructokinase [Blangy68] , AMP 5'-nucleotidase [Hunsucker01] , NAD+-dependent glyceraldehyde-3-phosphate dehydrogenase [Brunner98]

Activator (Mechanism unknown) of: succinyl-CoA synthetase [Birney96] , isocitrate dehydrogenase phosphatase [Nimmo84a] , 2-(2'-methylthio)ethylmalate synthase [Textor04] , acyl-CoA hydrolase (medium chain) [Alexson88] , acyl-CoA hydrolase (short chain) [Alexson88]

Enzymes inhibited by ADP, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: glycogen synthase [Furukawa93a, Comment 1] , 1-phosphofructokinase [Buschmeier85] , glycerol kinase [Helmward89, Comment 2] , GTP cyclohydrolase [Yim76] , malate:quinone oxidoreductase [Narindrasorasak79] , phosphoribosylformylglycinamide cyclo-ligase [Schrimsher86, Comment 3] , dethiobiotin synthetase [Krell70, Comment 4] , γ-glutamyl kinase [Smith84a] , tRNA(i6A37) synthase [Leung97] , polyphosphate kinase [Comment 5] , nucleoside diphosphate kinase [Roisin78, Comment 6] , isopentenyl phosphate kinase [Chen10c] , phosphoribosylpyrophosphate amidotransferase [Satyanarayana71] , glucokinase [Stahn75] , CTP triphosphatase [McCarty86] , FAD-AMP lyase (cyclizing) [Cabezas01] , 5-formaminoimidazole-4-carboxamide-1-β-D-ribofuranosyl 5'-monophosphate synthetase [Ownby05] , D-xylulokinase [Dills94] , NAD+-dependent glyceraldehyde-3-phosphate dehydrogenase [Crow79] , ATP:D-mannose 6-phosphotransferase [Renz93] , phosphoribosylpyrophosphate amidotransferase [Satyanarayana71, Comment 7] , trehalose phosphorylase [Wannet98] , ATP synthase [Nanba87, Comment 8] , dimethylallyl-diphosphate:AMP dimethylallyltransferase [Takei01] , nitrogenase [Comment 9] , δ1-pyrroline-5-carboxylate synthetase [Zhang95] , ATP-citrate lyase [Kanao02a] , sorbitol-6-phosphate dehydrogenase [kanayamaY93] , 6-phosphofructokinase [Garland80a] , fructose-1,6-bisphosphate aldolase [Lal05]

Inhibitor (Uncompetitive) of: 6-phosphofructokinase [Garland80a]

Inhibitor (Noncompetitive) of: glycerol kinase [Thorner73] , phosphate acetyltransferase [Suzuki69, Comment 10] , adenylate cyclase [Yang83a] , streptomycin 6-kinase [Sugiyama83] , glucokinase [Porter82] , galactokinase [Dey83] , glutathione synthetase [Jez04a]

Inhibitor (Allosteric) of: glycogen phosphorylase [Arrese95]

Inhibitor (Mechanism unknown) of: anhydro-N-acetylmuramic acid kinase [Uehara05] , NAD+ synthetase, NH3-dependent [Spencer67, Comment 11] , glutaminase B [Prusiner76a] , thiamin monophosphate kinase [Nishino72, Comment 12] , thiamine phosphate synthase [Kayama73, Kawasaki79] , amidophosphoribosyl transferase [Messenger79] , phosphoribosylformylglycinamide cyclo-ligase [Schrimsher86, Comment 13] , phosphoenolpyruvate synthetase [Chulavatnatol73] , fructose 1,6-bisphosphatase [Donahue00] , ADP-L-glycero-D-mannoheptose-6-epimerase [Ding94] , mannose isomerase [Itoh08b] , deoxyribonucleoside 5'-monophosphate phosphatase [Proudfoot04] , N-acetyl-D-glucosamine kinase [Uehara04] , ADP-sugar pyrophosphatase [MorenoBruna01] , isocitrate dehydrogenase kinase [Nimmo84] , pyruvate kinase [Holwerda73] , glycerol 3-phosphate dehydrogenase [Albertyn92] , choline kinase [Kim98b] , D-galacturonate dehydrogenase [Wagner76] , pyruvate carboxylase [Mukhopadhyay98a] , phosphoenolpyruvate carboxylase [Patel04] , ornithine carbamoyltransferase, catabolic [Ruepp95] , adenylosuccinate synthetase [Ryzhova98] , NAD pyrophosphatase [Kahn86] , phosphotransbutyrylase [Comment 14] , L-lactate dehydrogenase [Gordon76] , glucuronokinase [Gillard78] , MTR kinase [Guranowski83a] , shikimate kinase [Huang75] , L-lactate dehydrogenase [Davies72] , S-adenosylmethionine synthetase [Schroder97a] , D-xylulose kinase [vanKuyk01] , 6-phosphofructokinase [Turner03] , 6-phosphofructokinase [Turner03]

Inhibitor (Other types) of: guanosine kinase [Kawasaki00, Comment 15] , succinate semialdehyde dehydrogenase [Busch99] , fructokinase [MartinezBarajas96]


References

Ahn90: Ahn K, Kornberg A (1990). "Polyphosphate kinase from Escherichia coli. Purification and demonstration of a phosphoenzyme intermediate." J Biol Chem 1990;265(20);11734-9. PMID: 2164013

Albertyn92: Albertyn J, van Tonder A, Prior BA (1992). "Purification and characterization of glycerol-3-phosphate dehydrogenase of Saccharomyces cerevisiae." FEBS Lett 308(2);130-2. PMID: 1499720

Alexson88: Alexson SE, Nedergaard J (1988). "A novel type of short- and medium-chain acyl-CoA hydrolases in brown adipose tissue mitochondria." J Biol Chem 263(27);13564-71. PMID: 2901416

Arrese95: Arrese EL, Rojas-Rivas BI, Wells MA (1995). "Purification and properties of glycogen phosphorylase from the fat body of larval Manduca sexta." Insect Biochem Mol Biol 25(2);209-16. PMID: 7711751

Birney96: Birney M, Um HD, Klein C (1996). "Novel mechanisms of Escherichia coli succinyl-coenzyme A synthetase regulation." J Bacteriol 178(10);2883-9. PMID: 8631677

Blangy68: Blangy D, Buc H, Monod J (1968). "Kinetics of the allosteric interactions of phosphofructokinase from Escherichia coli." J Mol Biol 31(1);13-35. PMID: 4229913

Brunner98: Brunner NA, Brinkmann H, Siebers B, Hensel R (1998). "NAD+-dependent glyceraldehyde-3-phosphate dehydrogenase from Thermoproteus tenax. The first identified archaeal member of the aldehyde dehydrogenase superfamily is a glycolytic enzyme with unusual regulatory properties." J Biol Chem 273(11);6149-56. PMID: 9497334

Busch99: Busch KB, Fromm H (1999). "Plant succinic semialdehyde dehydrogenase. Cloning, purification, localization in mitochondria, and regulation by adenine nucleotides." Plant Physiol 121(2);589-97. PMID: 10517851

Buschmeier85: Buschmeier B, Hengstenberg W, Deutscher J (1985). "Purification and properties of 1-phosphofructokinase from Escherichia coli." FEMS Microbiol Lett 1985;29(3):231-235.

Cabezas01: Cabezas A, Pinto RM, Fraiz F, Canales J, Gonzalez-Santiago S, Cameselle JC (2001). "Purification, characterization, and substrate and inhibitor structure-activity studies of rat liver FAD-AMP lyase (cyclizing): preference for FAD and specificity for splitting ribonucleoside diphosphate-X into ribonucleotide and a five-atom cyclic phosphodiester of X, either a monocyclic compound or a cis-bicyclic phosphodiester-pyranose fusion." Biochemistry 40(45);13710-22. PMID: 11695920

Chen10c: Chen M, Poulter CD (2010). "Characterization of thermophilic archaeal isopentenyl phosphate kinases." Biochemistry 49(1);207-17. PMID: 19928876

Chulavatnatol73: Chulavatnatol M, Atkinson DE (1973). "Phosphoenolpyruvate synthetase from Escherichia coli. Effects of adenylate energy charge and modifier concentrations." J Biol Chem 248(8);2712-5. PMID: 4572511

Crow79: Crow VL, Wittenberger CL (1979). "Separation and properties of NAD+- and NADP+-dependent glyceraldehyde-3-phosphate dehydrogenases from Streptococcus mutans." J Biol Chem 254(4);1134-42. PMID: 33184

Davies72: Davies DD, Davies S (1972). "Purification and properties of L(+)-lactate dehydrogenase from potato tubers." Biochem J 129(4);831-9. PMID: 4144124

Dey83: Dey PM (1983). "Galactokinase of Vicia faba seeds." Eur J Biochem 136(1);155-9. PMID: 6617655

Dills94: Dills WL, Parsons PD, Westgate CL, Komplin NJ (1994). "Assay, purification, and properties of bovine liver D-xylulokinase." Protein Expr Purif 5(3);259-65. PMID: 7950369

Ding94: Ding L, Seto BL, Ahmed SA, Coleman WG (1994). "Purification and properties of the Escherichia coli K-12 NAD-dependent nucleotide diphosphosugar epimerase, ADP-L-glycero-D-mannoheptose 6-epimerase." J Biol Chem 269(39);24384-90. PMID: 7929099

Donahue00: Donahue JL, Bownas JL, Niehaus WG, Larson TJ (2000). "Purification and characterization of glpX-encoded fructose 1, 6-bisphosphatase, a new enzyme of the glycerol 3-phosphate regulon of Escherichia coli." J Bacteriol 2000;182(19);5624-7. PMID: 10986273

Furukawa93a: Furukawa K, Tagaya M, Tanizawa K, Fukui T (1993). "Role of the conserved Lys-X-Gly-Gly sequence at the ADP-glucose-binding site in Escherichia coli glycogen synthase." J Biol Chem 268(32);23837-42. PMID: 8226921

Garland80a: Garland WJ, Dennis DT (1980). "Plastid and cytosolic phosphofructokinases from the developing endosperm of Ricinus communis. II. Comparison of the kinetic and regulatory properties of the isoenzymes." Arch Biochem Biophys 204(1);310-7. PMID: 6448584

Gillard78: Gillard D.F., Dickinson D.B. (1978). "Inhibition of glucuronokinase by substrate analogs." Plant Physiol. 62 : 706-709.

Gordon76: Gordon GL, Doelle HW (1976). "Purification, properties and immunological relationship of L (+)-lactate dehydrogenase from Lactobacillus casei." Eur J Biochem 67(2);543-55. PMID: 823016

Guranowski83a: Guranowski A. "Plant 5-methylthioribose kinase." Plant Physiol. (1983) 71 : 932-935.

Haeusler92: Haeusler PA, Dieter L, Rittle KJ, Shepler LS, Paszkowski AL, Moe OA (1992). "Catalytic properties of Escherichia coli polyphosphate kinase: an enzyme for ATP regeneration." Biotechnol Appl Biochem 1992;15(2);125-33. PMID: 1316760

Helmward89: Helmward Z "Handbook of Enzyme Inhibitors. 2nd, revised and enlarged edition." Weinheim, Federal Republic of Germany ; New York, NY, USA , 1989.

Holwerda73: Holwerda DA, de Zwaan A (1973). "Kinetic and molecular characteristics of allosteric pyruvate kinase from muscle tissue of the sea mussel Mytilus edulis L." Biochim Biophys Acta 309(2);296-306. PMID: 4354457

Huang75: Huang L, Montoya AL, Nester EW (1975). "Purification and characterization of shikimate kinase enzyme activity in Bacillus subtilis." J Biol Chem 1975;250(19);7675-81. PMID: 170268

Hunsucker01: Hunsucker SA, Spychala J, Mitchell BS (2001). "Human cytosolic 5'-nucleotidase I: characterization and role in nucleoside analog resistance." J Biol Chem 276(13);10498-504. PMID: 11133996

Itoh08b: Itoh T, Mikami B, Hashimoto W, Murata K (2008). "Crystal structure of YihS in complex with D-mannose: structural annotation of Escherichia coli and Salmonella enterica yihS-encoded proteins to an aldose-ketose isomerase." J Mol Biol 377(5);1443-59. PMID: 18328504

Jez04a: Jez JM, Cahoon RE (2004). "Kinetic mechanism of glutathione synthetase from Arabidopsis thaliana." J Biol Chem 279(41);42726-31. PMID: 15302873

Kahn86: Kahn DW, Anderson BM (1986). "Characterization of Haemophilus influenzae nucleotide pyrophosphatase. An enzyme of critical importance for growth of the organism." J Biol Chem 261(13);6016-25. PMID: 3009442

Kanao02a: Kanao T, Fukui T, Atomi H, Imanaka T (2002). "Kinetic and biochemical analyses on the reaction mechanism of a bacterial ATP-citrate lyase." Eur J Biochem 269(14);3409-16. PMID: 12135479

kanayamaY93: kanayama Y., Yamaki S. (1993). "Purification and properties of NADP-dependent sorbitol-6-phosphate dehydrogenase from apple seedlings." Plant Cell Physiol. 34(6):819-823.

Kawasaki00: Kawasaki H, Shimaoka M, Usuda Y, Utagawa T (2000). "End-product regulation and kinetic mechanism of guanosine-inosine kinase from Escherichia coli." Biosci Biotechnol Biochem 2000;64(5);972-9. PMID: 10879466

Kawasaki79: Kawasaki T (1979). "Thiamine phosphate pyrophosphorylase." Methods Enzymol 1979;62;69-73. PMID: 374983

Kayama73: Kayama Y, Kawasaki T (1973). "Purification and properties of thiaminephosphate pyrophosphorylase of Escherichia coli." Arch Biochem Biophys 1973;158(1);242-8. PMID: 4580841

Kim98b: Kim KH, Voelker DR, Flocco MT, Carman GM (1998). "Expression, purification, and characterization of choline kinase, product of the CKI gene from Saccharomyces cerevisiae." J Biol Chem 273(12);6844-52. PMID: 9506987

Krell70: Krell K, Eisenberg MA (1970). "The purification and properties of dethiobiotin synthetase." J Biol Chem 1970;245(24);6558-66. PMID: 4921568

Lal05: Lal A, Plaxton WC, Kayastha AM (2005). "Purification and characterization of an allosteric fructose-1,6-bisphosphate aldolase from germinating mung beans (Vigna radiata)." Phytochemistry 66(9);968-74. PMID: 15896364

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Leung97: Leung HC, Chen Y, Winkler ME (1997). "Regulation of substrate recognition by the MiaA tRNA prenyltransferase modification enzyme of Escherichia coli K-12." J Biol Chem 272(20);13073-83. PMID: 9148919

MartinezBarajas96: Martinez-Barajas E., Randall D.D. "Purification and characterization of fructokinase from developing tomato (Lycopersicon esculentum Mill.) fruits." Planta (1996) 199:451-458.

McCarty86: McCarty DR, Selman BR (1986). "Properties of a Partially Purified Nucleoside Triphosphatase (NTPase) from the Chloroplast Envelope of Pea." Plant Physiol 80(4);908-12. PMID: 16664740

Messenger79: Messenger LJ, Zalkin H (1979). "Glutamine phosphoribosylpyrophosphate amidotransferase from Escherichia coli. Purification and properties." J Biol Chem 1979;254(9);3382-92. PMID: 372191

MorenoBruna01: Moreno-Bruna B, Baroja-Fernandez E, Munoz FJ, Bastarrica-Berasategui A, Zandueta-Criado A, Rodriguez-Lopez M, Lasa I, Akazawa T, Pozueta-Romero J (2001). "Adenosine diphosphate sugar pyrophosphatase prevents glycogen biosynthesis in Escherichia coli." Proc Natl Acad Sci U S A 98(14);8128-32. PMID: 11416161

Mukhopadhyay98a: Mukhopadhyay B, Stoddard SF, Wolfe RS (1998). "Purification, regulation, and molecular and biochemical characterization of pyruvate carboxylase from Methanobacterium thermoautotrophicum strain deltaH." J Biol Chem 273(9);5155-66. PMID: 9478969

Mukohata87: Mukohata Y, Yoshida M (1987). "The H+-translocating ATP synthase in Halobacterium halobium differs from F0F1-ATPase/synthase." J Biochem (Tokyo) 1987;102(4);797-802. PMID: 2893789

Nanba87: Nanba T, Mukohata Y (1987). "A membrane-bound ATPase from Halobacterium halobium: purification and characterization." J Biochem (Tokyo) 1987;102(3);591-8. PMID: 2962994

Narindrasorasak79: Narindrasorasak S, Goldie AH, Sanwal BD (1979). "Characteristics and regulation of a phospholipid-activated malate oxidase from Escherichia coli." J Biol Chem 1979;254(5);1540-5. PMID: 368072

Nimmo84: Nimmo GA, Nimmo HG (1984). "The regulatory properties of isocitrate dehydrogenase kinase and isocitrate dehydrogenase phosphatase from Escherichia coli ML308 and the roles of these activities in the control of isocitrate dehydrogenase." Eur J Biochem 1984;141(2);409-14. PMID: 6329757

Nimmo84a: Nimmo GA, Borthwick AC, Holms WH, Nimmo HG (1984). "Partial purification and properties of isocitrate dehydrogenase kinase/phosphatase from Escherichia coli ML308." Eur J Biochem 141(2);401-8. PMID: 6329756

Nishino72: Nishino H (1972). "Biogenesis of cocarboxylase in Escherichia coli. Partial purification and some properties of thiamine monophosphate kinase." J Biochem (Tokyo) 1972;72(5);1093-100. PMID: 4567662

Ownby05: Ownby K, Xu H, White RH (2005). "A Methanocaldococcus jannaschii archaeal signature gene encodes for a 5-formaminoimidazole-4-carboxamide-1-beta-D-ribofuranosyl 5'-monophosphate synthetase. A new enzyme in purine biosynthesis." J Biol Chem 280(12);10881-7. PMID: 15623504

Patel04: Patel HM, Kraszewski JL, Mukhopadhyay B (2004). "The phosphoenolpyruvate carboxylase from Methanothermobacter thermautotrophicus has a novel structure." J Bacteriol 186(15);5129-37. PMID: 15262949

Porter82: Porter EV, Chassy BM, Holmlund CE (1982). "Purification and kinetic characterization of a specific glucokinase from Streptococcus mutans OMZ70 cells." Biochim Biophys Acta 709(2);178-86. PMID: 7150605

Proudfoot04: Proudfoot M, Kuznetsova E, Brown G, Rao NN, Kitagawa M, Mori H, Savchenko A, Yakunin AF (2004). "General enzymatic screens identify three new nucleotidases in Escherichia coli. Biochemical characterization of SurE, YfbR, and YjjG." J Biol Chem 279(52);54687-94. PMID: 15489502

Prusiner76a: Prusiner S, Stadtman ER (1976). "Regulation of glutaminase B in Escherichia coli. III. Control by nucleotides and divalent cations." J Biol Chem 1976;251(11);3463-9. PMID: 776970

Renz93: Renz A., Stitt M. "Substrate specificity and product inhibition of different forms of fructokinases and hexokinases in developing potato tubers." Planta (1993) 190 : 166-175.

Roisin78: Roisin MP, Kepes A (1978). "Nucleosidediphosphate kinase of Escherichia coli, a periplasmic enzyme." Biochim Biophys Acta 1978;526(2);418-28. PMID: 214126

Ruepp95: Ruepp A, Muller HN, Lottspeich F, Soppa J (1995). "Catabolic ornithine transcarbamylase of Halobacterium halobium (salinarium): purification, characterization, sequence determination, and evolution." J Bacteriol 1995;177(5);1129-36. PMID: 7868583

Ryzhova98: Ryzhova TA, Andreichuk YV, Domkin VD (1998). "Adenylosuccinate synthetase of the yeast Saccharomyces cerevisiae: purification and properties." Biochemistry (Mosc) 1998;63(6);650-6. PMID: 9668204

Satyanarayana71: Satyanarayana T, Kaplan JG (1971). "Regulation of the purine pathway in bakers yeast: activity and feedback inhibition of phosphoribosyl-pyrophosphate amidotransferase." Arch Biochem Biophys 1971;142(1);40-7. PMID: 4322810

Schrimsher86: Schrimsher JL, Schendel FJ, Stubbe J, Smith JM (1986). "Purification and characterization of aminoimidazole ribonucleotide synthetase from Escherichia coli." Biochemistry 1986;25(15);4366-71. PMID: 3530323

Schroder97a: Schroder G, Eichel J, Breinig S, Schroder J (1997). "Three differentially expressed S-adenosylmethionine synthetases from Catharanthus roseus: molecular and functional characterization." Plant Mol Biol 33(2);211-22. PMID: 9037140

Smith84a: Smith CJ, Deutch AH, Rushlow KE (1984). "Purification and characteristics of a gamma-glutamyl kinase involved in Escherichia coli proline biosynthesis." J Bacteriol 1984;157(2);545-51. PMID: 6319365

Spencer67: Spencer RL, Preiss J (1967). "Biosynthesis of diphosphopyridine nucleotide. The purification and the properties of diphospyridine nucleotide synthetase from Escherichia coli b." J Biol Chem 1967;242(3);385-92. PMID: 4290215

Stahn75: Stahn R, Rose S, Sanborn S, West G, Herschman H (1975). "Effects of nerve growth factor administration of N-ethyl-N-nitrosourea carcinogenesis." Brain Res 96(2);287-98. PMID: 1175013

Sugiyama83: Sugiyama M, Sakamoto M, Mochizuki H, Nimi O, Nomi R (1983). "Purification and characterization of streptomycin 6-kinase, an enzyme implicated in self-protection of a streptomycin-producing micro-organism." J Gen Microbiol 129(6);1683-7. PMID: 6313852

Suzuki69: Suzuki T (1969). "Phosphotransacetylase of Escherichia coli B, activation by pyruvate and inhibition by NADH and certain nucleotides." Biochim Biophys Acta 1969;191(3);559-69. PMID: 4312205

Takei01: Takei K, Sakakibara H, Sugiyama T (2001). "Identification of genes encoding adenylate isopentenyltransferase, a cytokinin biosynthesis enzyme, in Arabidopsis thaliana." J Biol Chem 276(28);26405-10. PMID: 11313355

Textor04: Textor S, Bartram S, Kroymann J, Falk KL, Hick A, Pickett JA, Gershenzon J (2004). "Biosynthesis of methionine-derived glucosinolates in Arabidopsis thaliana: recombinant expression and characterization of methylthioalkylmalate synthase, the condensing enzyme of the chain-elongation cycle." Planta 218(6);1026-35. PMID: 14740211

Thorner73: Thorner JW, Paulus H (1973). "Catalytic and allosteric properties of glycerol kinase from Escherichia coli." J Biol Chem 1973;248(11);3922-32. PMID: 4575199

Turner03: Turner WL, Plaxton WC (2003). "Purification and characterization of pyrophosphate- and ATP-dependent phosphofructokinases from banana fruit." Planta 217(1);113-21. PMID: 12721855

Uehara04: Uehara T, Park JT (2004). "The N-acetyl-D-glucosamine kinase of Escherichia coli and its role in murein recycling." J Bacteriol 186(21);7273-9. PMID: 15489439

Uehara05: Uehara T, Suefuji K, Valbuena N, Meehan B, Donegan M, Park JT (2005). "Recycling of the anhydro-N-acetylmuramic acid derived from cell wall murein involves a two-step conversion to N-acetylglucosamine-phosphate." J Bacteriol 187(11);3643-9. PMID: 15901686

vanKuyk01: vanKuyk PA, de Groot MJ, Ruijter GJ, de Vries RP, Visser J (2001). "The Aspergillus niger D-xylulose kinase gene is co-expressed with genes encoding arabinan degrading enzymes, and is essential for growth on D-xylose and L-arabinose." Eur J Biochem 268(20);5414-23. PMID: 11606204

Wagner76: Wagner G, Hollmann S (1976). "Uronic acid dehydrogenase from Pseudomonas syringae. Purification and properties." Eur J Biochem 61(2);589-96. PMID: 2471

Wannet98: Wannet WJ, Op den Camp HJ, Wisselink HW, van der Drift C, Van Griensven LJ, Vogels GD (1998). "Purification and characterization of trehalose phosphorylase from the commercial mushroom Agaricus bisporus." Biochim Biophys Acta 1425(1);177-88. PMID: 9813313

Wiesenborn89a: Wiesenborn DP, Rudolph FB, Papoutsakis ET (1989). "Phosphotransbutyrylase from Clostridium acetobutylicum ATCC 824 and its role in acidogenesis." Appl Environ Microbiol 1989;55(2);317-22. PMID: 2719475

Yang83a: Yang JK, Epstein W (1983). "Purification and characterization of adenylate cyclase from Escherichia coli K12." J Biol Chem 1983;258(6);3750-8. PMID: 6300054

Yim76: Yim JJ, Brown GM (1976). "Characteristics of guanosine triphosphate cyclohydrolase I purified from Escherichia coli." J Biol Chem 1976;251(16);5087-94. PMID: 821948

Zhang95: Zhang CS, Lu Q, Verma DP (1995). "Removal of feedback inhibition of delta 1-pyrroline-5-carboxylate synthetase, a bifunctional enzyme catalyzing the first two steps of proline biosynthesis in plants." J Biol Chem 270(35);20491-6. PMID: 7657626

Zumft75: Zumft WG, Mortenson LE (1975). "The nitrogen-fixing complex of bacteria." Biochim Biophys Acta 1975;416(1);1-52. PMID: 164247


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Sun Nov 23, 2014, BIOCYC14A.