Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
twitter

MetaCyc Compound: cis-aconitate

Synonyms: (Z)-prop-1-ene-1,2,3-tricarboxylate, cis-aconitic acid

Superclasses: an acid all carboxy acids a carboxylate a tricarboxylate

Summary:
cis-aconitate is named after the plant Aconitum napellus, from which it was first isolated in 1828 [Peschier28]. The plants of the genus Aconitum (family of the Ranunculaceae) are famous for the many alkaloids they contain [Pictet04].

Chemical Formula: C6H3O6

Molecular Weight: 171.09 Daltons

Monoisotopic Molecular Weight: 174.0164379252 Daltons

SMILES: C(C(=O)[O-])=C(C([O-])=O)CC(=O)[O-]

InChI: InChI=1S/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b3-1-

InChIKey: InChIKey=GTZCVFVGUGFEME-IWQZZHSRSA-K

Unification Links: CAS:585-84-2 , ChEBI:16383 , ChemSpider:4573582 , HMDB:HMDB00072 , IAF1260:34920 , KEGG:C00417 , KNApSAcK:C00001177 , MetaboLights:MTBLC16383 , PubChem:5459816

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -191.19519 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

itaconate biosynthesis :
cis-aconitate + H+ → CO2 + itaconate

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

3,3'-thiodipropionate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropionate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

Not in pathways:
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+
a 1-lysophosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an acylcholine + H2O → choline + a carboxylate + H+
a 1,2-diacyl-3-β-D-galactosyl-sn-glycerol + 2 H2O → 2 a carboxylate + 3-β-D-galactosyl-sn-glycerol + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an S-acylglutathione + H2O → a carboxylate + glutathione
an N-acyl-L-aspartate + H2O → L-aspartate + a carboxylate

Reactions known to both consume and produce the compound:

ethylene biosynthesis V (engineered) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

glutamine biosynthesis III :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

glyoxylate cycle :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

itaconate biosynthesis :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]

methylaspartate cycle :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

mixed acid fermentation :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

reductive TCA cycle I :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

reductive TCA cycle II :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle I (prokaryotic) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle II (plants and fungi) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle III (animals) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle IV (2-oxoglutarate decarboxylase) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle VI (obligate autotrophs) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle VII (acetate-producers) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

TCA cycle VIII (helicobacter) :
citrate[mitochondrial lumen]cis-aconitate[mitochondrial lumen] + H2O[mitochondrial lumen]
cis-aconitate + H2O ↔ D-threo-isocitrate

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
trans-aconitate = cis-aconitate


eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
an aldehyde + pyrroloquinoline quinone + H2O = a carboxylate + pyrroloquinoline quinol + H+
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an oxidized electron acceptor + H2O = a carboxylate + a reduced electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an N-acyl-D-glutamate + H2O = a carboxylate + D-glutamate
an anilide + H2O = aniline + a carboxylate + H+
a 5'-acylphosphoadenosine + H2O = a carboxylate + AMP + 2 H+
a 3-acylpyruvate + H2O = a carboxylate + pyruvate + H+
an N6acyl-L-lysine + H2O = a carboxylate + L-lysine
an N-acyl-D-aspartate + H2O = a carboxylate + D-aspartate

Enzymes inhibited by cis-aconitate, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: prephenate dehydratase [Baldwin83]

Inhibitor (Mechanism unknown) of: isocitrate lyase


References

Baldwin83: Baldwin GS, Davidson BE (1983). "Kinetic studies on the mechanism of chorismate mutase/prephenate dehydratase from Escherichia coli K12." Biochim Biophys Acta 1983;742(2);374-83. PMID: 6337635

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Peschier28: Peschier (1828). Trommsdorf's Journal der Pharmacie, 5,I, 93; 8, I, 266.

Pictet04: Pictet, A. (1904). "The Vegetable Alkaloids: With Particular Reference to Their Chemical constitution." Translated by H.C. Biddler, Published by J. Wiley & Sons London 1913.


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Sun Nov 23, 2014, BIOCYC13B.