Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
twitter

MetaCyc Compound: homocarnosine

Synonyms: γ-aminobutyrylhistidine

Superclasses: a polypeptide a peptide an oligopeptide a dipeptide
a small molecule an oligopeptide a dipeptide

Chemical Formula: C10H16N4O3

Molecular Weight: 240.26 Daltons

Monoisotopic Molecular Weight: 240.12224040069998 Daltons

homocarnosine compound structure

SMILES: C([N+])CCC(=O)NC(CC1(=CNC=N1))C(=O)[O-]

InChI: InChI=1S/C10H16N4O3/c11-3-1-2-9(15)14-8(10(16)17)4-7-5-12-6-13-7/h5-6,8H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)/t8-/m0/s1

InChIKey: InChIKey=CCLQKVKJOGVQLU-QMMMGPOBSA-N

Unification Links: HMDB:HMDB00745 , PubChem:90657684

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 79.55794 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

Not in pathways:
a dipeptide + H2O → a standard α amino acid + a standard α amino acid
a dipeptide + H2O → a standard α amino acid + a standard α amino acid
a dipeptide + H2O → a standard α amino acid + a standard α amino acid
a dipeptide + H2O → 2 a standard α amino acid
a dipeptide + H2O → 2 amino acids
an oligopeptide[periplasmic space] + H2O[periplasmic space] → a peptide[periplasmic space] + a dipeptide[periplasmic space]
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a peptide + a dipeptide
an oligopeptide + H2O → a dipeptide + a peptide

Not in pathways:
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a peptide + a dipeptide
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide[periplasmic space] + H2O[periplasmic space] → a peptide[periplasmic space] + a dipeptide[periplasmic space]
an oligopeptide + H2O → a peptide + a standard α amino acid
an oligopeptide + H2O → a peptide + a peptide
an oligopeptide + H2O → a peptide + a peptide
an oligopeptide + H2O → a peptide + a peptide

Reactions known to produce the compound:

homocarnosine biosynthesis :
4-aminobutanoate + L-histidine + ATP → homocarnosine + ADP + phosphate + H+

hemoglobin degradation :
a small peptide + n H2O → n+1 a dipeptide

Not in pathways:
a peptide + n H2O → n+1 a dipeptide
a tetrapeptide + H2O → a dipeptide + a dipeptide
a polypeptide + H2O → a dipeptide + a peptide
a protein + H2O → a dipeptide + a peptide
a tripeptide + H2O → a dipeptide + a standard α amino acid

In Transport reactions:
ATP + a dipeptide[periplasmic space] + H2O → ADP + a dipeptide[cytosol] + phosphate + H+ ,
a dipeptide[periplasmic space] + H+[periplasmic space]a dipeptide[cytosol] + H+[cytosol] ,
an oligopeptide[extracellular space] + ATP + H2O ↔ an oligopeptide[cytosol] + ADP + phosphate + H+

Credits:
Created 12-Feb-2010 by Caspi R , SRI International


References

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Wed Sep 2, 2015, biocyc12.