
MetaCyc Compound: dicranin

Synonyms: (9Z,12Z,15Z)-octadecatrien-6-ynoic acid, all-cis-9,12,15-octadecatrien-6-ynoic acid, (9Z,12Z,15Z)-octadecatrien-6-ynoate, all-cis-9,12,15-octadecatrien-6-ynoate

Superclasses: an acid all carboxy acids a carboxylate a fatty acid a long-chain fatty acid
an acid all carboxy acids a carboxylate a fatty acid an unsaturated fatty acid a polyunsaturated fatty acid

Dicranin is an unusual fatty acid containing a Δ6-triple bond. It is found in many moss species including Ceratodon purpureus and Dicranum scoparium.

Chemical Formula: C18H25O2

Molecular Weight: 273.39 Daltons

Monoisotopic Molecular Weight: 274.1932800788 Daltons

dicranin compound structure


InChI: InChI=1S/C18H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11,14-17H2,1H3,(H,19,20)/p-1/b4-3-,7-6-,10-9-


Unification Links: PubChem:49859565

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 342.676 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

alkane biosynthesis I :
a long-chain fatty acid + a holo-[acyl-carrier protein] + ATP → a long-chain acyl-[acp] + AMP + diphosphate

alkane biosynthesis II , fatty acid activation , long chain fatty acid ester synthesis for microdiesel production , phosphatidylcholine acyl editing , wax esters biosynthesis II :
a long-chain fatty acid + ATP + coenzyme A → a long-chain acyl-CoA + AMP + diphosphate

terminal olefins biosynthesis I :
a long-chain fatty acid + hydrogen peroxide + H+ → a terminal olefin + CO2 + 2 H2O

alkane oxidation :
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

rhizobactin 1021 biosynthesis :
rhizobactin 1021 core + a fatty acid → rhizobactin 1021

sophorolipid biosynthesis :
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O
a fatty acid + NADPH + oxygen + H+ → an (ω-1)-hydroxy fatty acid + NADP+ + H2O

sporopollenin precursor biosynthesis :
a fatty acid + NADPH + oxygen + H+ → an in-chain hydroxy fatty acid + NADP+ + H2O
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

Not in pathways:
ATP + a holo-[acyl-carrier protein] + a fatty acid → AMP + a 2,3,4-saturated fatty acyl-[acp] + diphosphate
a fatty acid + S-adenosyl-L-methionine → S-adenosyl-L-homocysteine + a fatty acid-methyl ester

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

phosphatidylcholine acyl editing :
a phosphatidylcholine + H2O → a 1-acyl 2-lyso-phosphatidylcholine + a long-chain fatty acid + H+
a phosphatidylcholine + H2O → a 2-acyl 1-lyso-phosphatidylcholine + a long-chain fatty acid + H+

phospholipases :
a phosphatidylcholine + H2O → a 1-acyl 2-lyso-phosphatidylcholine + a long-chain fatty acid + H+
a phosphatidylcholine + H2O → a 2-acyl 1-lyso-phosphatidylcholine + a long-chain fatty acid + H+

retinol biosynthesis :
an all-trans-retinyl ester + H2O → all-trans-retinol + a long-chain fatty acid + H+
a dietary all-trans-retinyl ester + H2O → all-trans-retinol + a long-chain fatty acid + H+

Not in pathways:
a wax ester + H2O → a long-chain alcohol + a long-chain fatty acid + H+
a long-chain-fatty-acyl ethyl ester + H2O → a long-chain fatty acid + ethanol + H+

acyl-ACP thioesterase pathway :
an acyl-[acyl-carrier protein] + H2O → a fatty acid + a holo-[acyl-carrier protein] + H+

alkane oxidation , fatty acid α-oxidation I :
a fatty aldehyde + NAD+ + H2O → a fatty acid + NADH + 2 H+

ceramide degradation :
a ceramide + H2O → a sphingoid base + a fatty acid

sphingolipid biosynthesis (mammals) , sphingomyelin metabolism :
an N-acyl-sphingosylphosphorylcholine + H2O → a fatty acid + sphingosylphosphorylcholine

sphingosine and sphingosine-1-phosphate metabolism :
a (4E)-sphing-4-enine ceramide + H2O → sphingosine + a fatty acid

the visual cycle I (vertebrates) :
an all-trans-retinyl ester + H2O → 11-cis-retinol + a fatty acid + H+

triacylglycerol degradation :
a 1,2-diglyceride + H2O → a 2-monoglyceride + a fatty acid + H+
a 1-monoglyceride + H2O → a fatty acid + glycerol + H+
a triglyceride + H2O → a 1,2-diglyceride + a fatty acid + H+

Not in pathways:
a 3-(acyloxy)acyl group of bacterial toxin + H2O → a 3-hydroxyacyl group of bacterial toxin + a fatty acid + H+
a steryl-ester + H2O → a fatty acid + a sterol + H+
an L-1-phosphatidylethanolamine[periplasmic space] + H2O[periplasmic space] → a 2-acyl-1-lyso-phosphatidylethanolamine[periplasmic space] + a fatty acid[periplasmic space] + H+[periplasmic space]
a 2-monoglyceride + H2O → glycerol + a fatty acid + H+
an L-1-phosphatidylethanolamine[periplasmic space] + H2O[periplasmic space]a fatty acid[periplasmic space] + a 1-acyl 2-lyso-phosphatidylethanolamine[periplasmic space] + H+[periplasmic space]
a 1,3-diglyceride + H2O → a monoglyceride + a fatty acid
an all-trans-retinyl ester + H2O → 13-cis-retinol + a fatty acid
an 11-cis-retinyl ester + H2O → 11-cis-retinol + a fatty acid

Reactions known to both consume and produce the compound:

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
an acylglycerone phosphate + a long-chain alcohol = a 1-alkyl-glycerone 3-phosphate + a long-chain fatty acid + H+
a long-chain alcohol + 2 NAD+ + H2O = a long-chain fatty acid + 2 NADH + 3 H+
a long-chain aldehyde + NAD+ + H2O = a long-chain fatty acid + NADH + 2 H+
an N-long-chain-fatty-acyl-L-glutamate + H2O = L-glutamate + a long-chain fatty acid
an N-(long-chain-acyl)ethanolamine + H2O = a long-chain fatty acid + ethanolamine
acetyl-CoA + n malonyl-CoA + 2n NADPH + 2n H+ = a long-chain fatty acid + n CO2 + (n+1) coenzyme A + 2n NADP+

Not in pathways:
a fatty acid + hydrogen peroxide = a 3- or 2-hydroxy fatty acid + H2O
a D-glucosyl-N-acylsphingosine + H2O = a fatty acid + O-glucosyl-sphingosine
a 1,2-diacyl-sn-glycerol + H2O = a 1-monoglyceride + a fatty acid + H+
a glycosphingolipid + H2O = a lyso-glycosphingolipid + a fatty acid

Not in pathways:
eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a 2-acyl 1-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a triacyl-sn-glycerol + H2O = a 1,2-diacyl-sn-glycerol + a carboxylate + H+
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an unknown oxidized electron acceptor + H2O = a carboxylate + an unknown reduced electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+

In Transport reactions:
a long-chain fatty acid[periplasmic space]a long-chain fatty acid[cytosol] ,
a long-chain fatty acid[extracellular space]a long-chain fatty acid[periplasmic space]

Enzymes activated by dicranin, sorted by the type of activation, are:

Activator (Allosteric) of: pyruvate oxidase [Kiuchi84]

Created 17-Sep-2010 by Zhang P , TAIR
Revised 19-Dec-2014 by Caspi R , SRI International


Kiuchi84: Kiuchi K, Hager LP (1984). "Reconstitution of the lipid-depleted pyruvate oxidase system of Escherichia coli: the palmitic acid effect." Arch Biochem Biophys 233(2);776-84. PMID: 6385860

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Tue May 26, 2015, biocyc14.