Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
twitter

MetaCyc Compound: α-D-rhamnose

Superclasses: all carbohydratesa carbohydratea glycana sugara modified sugara 6-deoxypyranoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidea hexosea 6-deoxypyranoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidea hexosea D-hexosea D-aldohexosea D-aldopyranoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidea hexosea D-hexoseD-rhamnoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidea hexosean aldohexosea D-aldohexosea D-aldopyranoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidea hexoserhamnoseD-rhamnoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidean aldosea D-aldosea D-aldohexosea D-aldopyranoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidean aldosean aldohexosea D-aldohexosea D-aldopyranoseD-rhamnopyranose
all carbohydratesa carbohydratea glycana sugara monosaccharidean aldosean aldopyranosea D-aldopyranoseD-rhamnopyranose
an aldehyde or ketonean aldehydean aldosea D-aldosea D-aldohexosea D-aldopyranoseD-rhamnopyranose
an aldehyde or ketonean aldehydean aldosean aldohexosea D-aldohexosea D-aldopyranoseD-rhamnopyranose
an aldehyde or ketonean aldehydean aldosean aldopyranosea D-aldopyranoseD-rhamnopyranose

Chemical Formula: C6H12O5

Molecular Weight: 164.16 Daltons

Monoisotopic Molecular Weight: 164.0684734957 Daltons

α-D-rhamnose compound structure

SMILES: CC1(C(C(C(C(O1)O)O)O)O)

InChI: InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6+/m1/s1

InChIKey: InChIKey=SHZGCJCMOBCMKK-PQMKYFCFSA-N

Unification Links: ChEBI:63152, KEGG:C01684, PubChem:439548

Standard Gibbs Free Energy of Formation (ΔfG in kcal/mol): -58.79656Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+

Not in pathways:
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+

Reactions known to produce the compound:

Not in pathways:
a sugar alcohol + oxygen → an aldose + hydrogen peroxide

Not in pathways:
a protopanaxatriol-type ginsenoside with two glycosyl residues at position 6 + 2 H2O → a protopanaxatriol-type ginsenoside with no glycosidic modification at position 6 + a monosaccharide + D-glucopyranose
a protopanaxadiol-type ginsenoside with two glycosyl residues at position 20 + H2O → a protopanaxadiol-type ginsenoside with a single glucosyl residue at position 20 + a monosaccharide

Not in pathways:
a thioglucoside + H2O → a sugar + a thiol
a sugar phosphate + H2O → a sugar + phosphate
glycosyl-N-acylsphingosine + H2O → a ceramide + a sugar

ceramide degradation :
a sphingoid 1-phosphate → O-phosphoethanolamine + an aldehyde

two-component alkanesulfonate monooxygenase :
an alkylsulfonate + FMNH2 + oxygen → an aldehyde + sulfite + FMN + H2O + 2 H+

Not in pathways:
a primary amine[periplasm] + H2O[periplasm] + oxygen[periplasm]an aldehyde[periplasm] + ammonium[periplasm] + hydrogen peroxide[periplasm]
an aliphatic amine + H2O + oxygen → an aldehyde + ammonium + hydrogen peroxide
a monoamine + H2O + oxygen → an aldehyde + a primary amine + hydrogen peroxide
a primary alcohol + oxygen → hydrogen peroxide + an aldehyde

Not in pathways:
a nitroalkane + oxygen + H2O → an aldehyde or ketone + nitrite + hydrogen peroxide + H+

Reactions known to both consume and produce the compound:

Not in pathways:
a primary alcohol + NAD+an aldehyde + NADH + H+

In Reactions of unknown directionality:

Not in pathways:
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
a D-hexose + ATP = D-hexose 6-phosphate + ADP + H+
phosphoramidate + a D-hexose = an α-hexose 1-phosphate + ammonium

Not in pathways:
an α-D-aldosyl-β-D-fructoside + a D-aldose = an α-D-aldosyl-β-D-fructoside + a D-aldose

Not in pathways:
an aldopyranose + NAD+ = a D-aldonolactone + NADH + H+
an aldopyranose + an oxidized unknown electron acceptor = a 2,3-didehydropyranose + an reduced unknown electron acceptor
an aldopyranose + an oxidized unknown electron acceptor = a 2-dehydropyranose + an reduced unknown electron acceptor
an aldopyranose + an oxidized unknown electron acceptor = a 3-dehydropyranose + an reduced unknown electron acceptor
an aldopyranose + NAD(P)+ = a D-aldonolactone + NAD(P)H + H+

Not in pathways:
an aldose[periplasm] + an oxidized unknown electron acceptor[periplasm] + H2O[periplasm] = an aldonate[periplasm] + an reduced unknown electron acceptor[periplasm] + H+[periplasm]
a sugar alcohol + NAD(P)+ = an aldose + NAD(P)H + H+

Not in pathways:
a protopanaxatriol-type ginsenoside with two glycosyl residues at position 6 + H2O = a protopanaxatriol-type ginsenoside with a single glucosyl at position 6 + a monosaccharide

Not in pathways:
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an aldehyde + 2 an oxidized ferredoxin [iron-sulfur] cluster + H2O = a carboxylate + 2 a reduced ferredoxin [iron-sulfur] cluster + 3 H+
an aldehyde + an oxidized unknown electron acceptor + H2O = a carboxylate + an reduced unknown electron acceptor + H+
an aldehyde[periplasm] + FAD[periplasm] + H2O[periplasm] = a carboxylate[periplasm] + FADH2[periplasm]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a primary alcohol + 2 an oxidized cytochrome cL = an aldehyde + 2 a reduced cytochrome cL + 2 H+
an aliphatic amine + an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + a reduced cytochrome c550
an alkylamine + 2 an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + 2 a reduced cytochrome c550
a 2-oxo carboxylate + H+ = an aldehyde + CO2
an alcohol + NADP+ = an aldehyde + NADPH + H+
a primary alcohol + an oxidized unknown electron acceptor = an aldehyde + an reduced unknown electron acceptor
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
a primary alcohol + an oxidized azurin = an aldehyde + a reduced azurin

In Transport reactions:
a monosaccharide[extracellular space] + ATP + H2O ↔ a monosaccharide[cytosol] + ADP + phosphate,
a [PTS enzyme I]-Nπ-phospho-L-histidine + a sugar[out] → a [PTS enzyme I]-L-histidine + a sugar phosphate[in]

Credits:
Created 02-Nov-2011 by Caspi R, SRI International


References

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by Pathway Tools version 19.5 (software by SRI International) on Fri Apr 29, 2016, biocyc13.