Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
twitter

MetaCyc Compound: α-D-rhamnose

Superclasses: all carbohydrates a carbohydrate a glycan a sugar a modified sugar a 6-deoxypyranose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide a hexose a 6-deoxypyranose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide a hexose a D-hexose a D-aldohexose a D-aldopyranose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide a hexose a D-hexose D-rhamnose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide a hexose an aldohexose a D-aldohexose a D-aldopyranose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide a hexose rhamnose D-rhamnose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide an aldose a D-aldose a D-aldohexose a D-aldopyranose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide an aldose an aldohexose a D-aldohexose a D-aldopyranose D-rhamnopyranose
all carbohydrates a carbohydrate a glycan a sugar a monosaccharide an aldose an aldopyranose a D-aldopyranose D-rhamnopyranose
an aldehyde or ketone an aldehyde an aldose a D-aldose a D-aldohexose a D-aldopyranose D-rhamnopyranose
an aldehyde or ketone an aldehyde an aldose an aldohexose a D-aldohexose a D-aldopyranose D-rhamnopyranose
an aldehyde or ketone an aldehyde an aldose an aldopyranose a D-aldopyranose D-rhamnopyranose

Chemical Formula: C6H12O5

Molecular Weight: 164.16 Daltons

Monoisotopic Molecular Weight: 164.0684734957 Daltons

SMILES: CC1(C(C(C(C(O1)O)O)O)O)

InChI: InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6+/m1/s1

InChIKey: InChIKey=SHZGCJCMOBCMKK-PQMKYFCFSA-N

Unification Links: ChEBI:63152 , KEGG:C01684 , PubChem:439548

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -58.79656 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+

Not in pathways:
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+

Reactions known to produce the compound:

Not in pathways:
a sugar alcohol + oxygen → an aldose + hydrogen peroxide


a protopanaxatriol-type ginsenoside with two glycosyl residues at position 6 + 2 H2O → a protopanaxatriol-type ginsenoside with no glycosidic modification at position 6 + a monosaccharide + D-glucopyranose
a protopanaxadiol-type ginsenoside with two glycosyl residues at position 20 + H2O → a protopanaxadiol-type ginsenoside with a single glucosyl residue at position 20 + a monosaccharide


a thioglucoside + H2O → a sugar + a thiol
a sugar phosphate + H2O → a sugar + phosphate
glycosyl-N-acylsphingosine + H2O → a ceramide + a sugar


an N-acetyl-β-D-galactosalaminyl-[glycan] + H2O → a glycan + N-acetyl-β-D-galactosamine

ceramide degradation :
a sphingoid 1-phosphate → phosphoryl-ethanolamine + an aldehyde

two-component alkanesulfonate monooxygenase :
an alkanesulfonate + FMNH2 + oxygen → an aldehyde + sulfite + FMN + H2O + 2 H+


a primary amine[periplasmic space] + H2O[periplasmic space] + oxygen[periplasmic space]an aldehyde[periplasmic space] + ammonium[periplasmic space] + hydrogen peroxide[periplasmic space]
an aliphatic amine + H2O + oxygen → an aldehyde + ammonium + hydrogen peroxide
a monoamine + H2O + oxygen → an aldehyde + a primary amine + hydrogen peroxide
a primary alcohol + oxygen → hydrogen peroxide + an aldehyde


a nitroalkane + oxygen + H2O → an aldehyde or ketone + nitrite + hydrogen peroxide + H+

Reactions known to both consume and produce the compound:

Not in pathways:
a primary alcohol + NAD+an aldehyde + NADH + H+

In Reactions of unknown directionality:

Not in pathways:
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
a D-hexose + ATP = D-hexose 6-phosphate + ADP + H+
phosphoramidate + a D-hexose = an α-hexose 1-phosphate + ammonium


an aldopyranose + NAD+ = a D-aldonolactone + NADH + H+
an aldopyranose + an oxidized electron acceptor = a 2,3-didehydropyranose + a reduced electron acceptor
an aldopyranose + an oxidized electron acceptor = a 2-dehydropyranose + a reduced electron acceptor
an aldopyranose + an oxidized electron acceptor = a 3-dehydropyranose + a reduced electron acceptor
an aldopyranose + NAD(P)+ = a D-aldonolactone + NAD(P)H + H+


an α-D-aldosyl-β-D-fructoside + a D-aldose = an α-D-aldosyl-β-D-fructoside + a D-aldose


an aldose[periplasmic space] + an oxidized electron acceptor[periplasmic space] + H2O[periplasmic space] = an aldonate[periplasmic space] + a reduced electron acceptor[periplasmic space] + H+[periplasmic space]
a sugar alcohol + NAD(P)+ = an aldose + NAD(P)H + H+


a protopanaxatriol-type ginsenoside with two glycosyl residues at position 6 + H2O = a protopanaxatriol-type ginsenoside with a single glucosyl at position 6 + a monosaccharide


an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + an oxidized electron acceptor + H2O = a carboxylate + a reduced electron acceptor + H+
an aldehyde + pyrroloquinoline quinone + H2O = a carboxylate + pyrroloquinoline quinol + H+
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
an aliphatic amine + an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + a reduced cytochrome c550
an alkylamine + 2 an oxidized cytochrome c550 + H2O = an aldehyde + ammonium + 2 a reduced cytochrome c550
a 2-oxo carboxylate + H+ = an aldehyde + CO2
an alcohol + NADP+ = an aldehyde + NADPH + H+
a primary alcohol + an oxidized electron acceptor = an aldehyde + a reduced electron acceptor
a primary alcohol + 2 an oxidized cytochrome cL = an aldehyde + 2 a reduced cytochrome cL
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
a primary alcohol + an oxidized azurin = an aldehyde + a reduced azurin
a 1-O-(alk-1-enyl)glycero-3-phosphocholine + H2O = sn-glycero-3-phosphocholine + an aldehyde
a 1-alkenylglycerophosphoethanolamine + H2O = sn-glycero-3-phosphoethanolamine + an aldehyde
a primary alcohol + 2 an oxidized cytochrome c550 = an aldehyde + 2 a reduced cytochrome c550

In Transport reactions:
a monosaccharide[extracellular space] + ATP + H2O ↔ a monosaccharide[cytosol] + ADP + phosphate ,
a [PTS enzyme I]-Nπ-phospho-L-histidine + a sugar[out] → a [PTS enzyme I]-L-histidine + a sugar phosphate[in]

Credits:
Created 02-Nov-2011 by Caspi R , SRI International


References

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Sat Dec 20, 2014, BIOCYC14A.