Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store

MetaCyc Compound: anserine

Synonyms: β-alanyl-Nπ-methyl-L-histidine

Superclasses: a polypeptidea peptidean oligopeptidea dipeptide
a small moleculean oligopeptidea dipeptide

Chemical Formula: C10H16N4O3

Molecular Weight: 240.26 Daltons

Monoisotopic Molecular Weight: 241.1300654328 Daltons

anserine compound structure


InChI: InChI=1S/C10H16N4O3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1


Unification Links: CAS:584-85-0, ChEBI:58445, HMDB:HMDB00194, KEGG:C01262, MetaboLights:MTBLC18323, PubChem:6992114

Standard Gibbs Free Energy of Formation (ΔfG in kcal/mol): 90.20794Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

Not in pathways:
anserine + H2O → Nπ-methyl-L-histidine + β-alanine

Not in pathways:
a dipeptide + H2O → a standard α amino acid + a standard α amino acid
a dipeptide + H2O → a standard α amino acid + a standard α amino acid
a dipeptide + H2O → a standard α amino acid + a standard α amino acid
a dipeptide + H2O → 2 a standard α amino acid
a dipeptide + H2O → 2 amino acids
an oligopeptide[periplasm] + H2O[periplasm] → a peptide[periplasm] + a dipeptide[periplasm]
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a peptide + a dipeptide
an oligopeptide + H2O → a dipeptide + a peptide

Not in pathways:
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a peptide + a dipeptide
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide + H2O → a dipeptide + a peptide
an oligopeptide[periplasm] + H2O[periplasm] → a peptide[periplasm] + a dipeptide[periplasm]
an oligopeptide + H2O → a peptide + a standard α amino acid
an oligopeptide + H2O → a peptide + a peptide
an oligopeptide + H2O → a peptide + a peptide
an oligopeptide + H2O → a peptide + a peptide

Reactions known to produce the compound:

Not in pathways:
carnosine + S-adenosyl-L-methionine → S-adenosyl-L-homocysteine + anserine + H+

hemoglobin degradation :
a small peptide + n H2O → n+1 a dipeptide

Not in pathways:
a peptide + n H2O → n+1 a dipeptide
a tetrapeptide + H2O → a dipeptide + a dipeptide
a polypeptide + H2O → a dipeptide + a peptide
a protein + H2O → a dipeptide + a peptide
a tripeptide + H2O → a dipeptide + a standard α amino acid

In Transport reactions:
ATP + a dipeptide[periplasm] + H2O → ADP + a dipeptide[cytosol] + phosphate + H+,
a dipeptide[periplasm] + H+[periplasm]a dipeptide[cytosol] + H+[cytosol],
an oligopeptide[extracellular space] + ATP + H2O ↔ an oligopeptide[cytosol] + ADP + phosphate + H+


Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by Pathway Tools version 19.5 (software by SRI International) on Fri Feb 12, 2016, biocyc14.