
MetaCyc Compound: 3,4-dihydroxyphenylglycolaldehyde

Synonyms: 3,4-dihydroxymandelaldehyde, benzeneacetaldehyde, alpha,3,4-trihydroxy-, DOPEGAL, 3,4-dihydroxymandelic aldehyde, DHPGALD, DHMAL

Superclasses: an alcohol a diol a benzenediol a catechol
an aromatic compound a benzenediol a catechol

Chemical Formula: C8H8O4

Molecular Weight: 168.15 Daltons

Monoisotopic Molecular Weight: 168.0422587452 Daltons

3,4-dihydroxyphenylglycolaldehyde compound structure

SMILES: C(=O)C(O)C1(C=CC(O)=C(O)C=1)

InChI: InChI=1S/C8H8O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-4,8,10-12H/t8-/m0/s1


Unification Links: ChEBI:27852 , ChemSpider:133725 , HMDB:HMDB06242 , KEGG:C05577 , MetaboLights:MTBLC27852 , PubChem:151725

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -32.011036 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

noradrenaline and adrenaline degradation :
3,4-dihydroxyphenylglycol + NAD+3,4-dihydroxyphenylglycolaldehyde + NADH + H+
3,4-dihydroxyphenylglycolaldehyde + NAD+ + H2O → 3,4-dihydroxymandelate + NADH + 2 H+

Not in pathways:
a catechol + S-adenosyl-L-methionine → a guaiacol + S-adenosyl-L-homocysteine + H+

Not in pathways:
4 a benzenediol + oxygen → 4 a benzosemiquinone + 2 H2O

Reactions known to produce the compound:

noradrenaline and adrenaline degradation :
(R)-adrenaline + H2O + oxygen → 3,4-dihydroxyphenylglycolaldehyde + methylamine + hydrogen peroxide
(R)-noradrenaline + H2O + oxygen → 3,4-dihydroxyphenylglycolaldehyde + ammonium + hydrogen peroxide

β-D-glucuronide and D-glucuronate degradation :
a β-D-glucuronoside + H2O → D-glucopyranuronate + an alcohol

glycerophosphodiester degradation :
a glycerophosphodiester + H2O → an alcohol + sn-glycerol 3-phosphate + H+

phosphate acquisition , phosphate utilization in cell wall regeneration :
a phosphate monoester + H2O → an alcohol + phosphate

Not in pathways:
an organic hydroperoxide + NADH + H+an alcohol + NAD+ + H2O
an α-D-glucuronoside + H2O → D-glucopyranuronate + an alcohol
an α amino acid ester + H2O → an alcohol + an α amino acid + H+
a phosphate monoester + H2O → an alcohol + phosphate
RH + a reduced [NADPH-hemoprotein reductase] + oxygen → ROH + an oxidized [NADPH-hemoprotein reductase] + H2O
an oligosaccharide with β-L-arabinopyranose at the non-reducing end + H2O → β-L-arabinopyranose + an alcohol
an N-acetyl-β-D-hexosaminide + H2O → an N-acetyl-β-D-hexosamine + an alcohol
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an acetic ester + H2O → an alcohol + acetate + H+
a reduced thioredoxin + an organic hydroperoxide → an oxidized thioredoxin + an alcohol + H2O
a 6-O-(β-D-xylopyranosyl)-β-D-glucopyranoside + H2O → β-primeverose + an alcohol
an organic molecule + H2O + 2 oxygen → an alcohol + 2 superoxide + 2 H+
an N5-acyl-L-ornithine-ester + H2O → an N5-acyl-L-ornithine + an alcohol
α-L-fucoside + H2O → L-fucopyranose + an alcohol
a 2-deoxy-α-D-glucoside + H2O → 2-deoxy-D-glucose + an alcohol
a 6-phospho-β-D-galactoside + H2O → α-D-galactose 6-phosphate + an alcohol

In Reactions of unknown directionality:

Not in pathways:
an alcohol + 3'-phosphoadenylyl-sulfate = adenosine 3',5'-bisphosphate + an organosulfate + H+
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
an alcohol + NADP+ = an aldehyde + NADPH + H+
trans-cinnamoyl-β-D-glucoside + an alcohol = β-D-glucose + alkyl cinnamate
an alcohol + acetyl-CoA = an acetic ester + coenzyme A
2 protein cysteines + an organic hydroperoxide = a protein disulfide + an alcohol + H2O
an organic molecule + an organic hydroperoxide = 2 an alcohol
an organic molecule + hydrogen peroxide = an alcohol + H2O

Enzymes activated by 3,4-dihydroxyphenylglycolaldehyde, sorted by the type of activation, are:

Activator (Mechanism unknown) of: phosphoenolpyruvate carboxylase [Izui83]


Izui83: Izui K, Matsuda Y, Kameshita I, Katsuki H, Woods AE (1983). "Phosphoenolpyruvate carboxylase of Escherichia coli. Inhibition by various analogs and homologs of phosphoenolpyruvate." J Biochem (Tokyo) 1983;94(6);1789-95. PMID: 6368527

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Mon Mar 30, 2015, BIOCYC14B.