Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
twitter

MetaCyc Compound: (R)-noradrenaline

Synonyms: (R)-norepinephrine, (-)-noradrenaline, (-)-norepinephrine, (-)-arterenol, (R)-(-)-norepinephrine, (R)-4-(2-amino-1-hydroxyethyl)-1,2-benzenediol, (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethanaminium

Superclasses: an alcohola diola benzenediola catechol
an aromatic compounda benzenediola catechol

Chemical Formula: C8H12NO3

Molecular Weight: 170.19 Daltons

Monoisotopic Molecular Weight: 170.08171825670001 Daltons

(R)-noradrenaline compound structure

SMILES: C1(C=C(O)C(=CC=1C(C[N+])O)O)

InChI: InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/p+1/t8-/m0/s1

InChIKey: InChIKey=SFLSHLFXELFNJZ-QMMMGPOBSA-O

Unification Links: ChEBI:72587, ChemSpider:3037559, DrugBank:DB00368, HMDB:HMDB00216, KEGG:C00547, PubChem:6921840

Standard Gibbs Free Energy of Formation (ΔfG in kcal/mol): 34.531376Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

catecholamine biosynthesis :
S-adenosyl-L-methionine + (R)-noradrenalineS-adenosyl-L-homocysteine + (R)-adrenaline + H+

noradrenaline and adrenaline degradation :
(R)-noradrenaline + H2O + oxygen → 3,4-dihydroxyphenylglycolaldehyde + ammonium + hydrogen peroxide
(R)-noradrenaline + S-adenosyl-L-methionine → normetanephrine + S-adenosyl-L-homocysteine + H+
S-adenosyl-L-methionine + (R)-noradrenalineS-adenosyl-L-homocysteine + (R)-adrenaline + H+

Not in pathways:
a catechol + S-adenosyl-L-methionine → a guaiacol + S-adenosyl-L-homocysteine + H+

Not in pathways:
4 a benzenediol + oxygen → 4 a benzosemiquinone + 2 H2O

Reactions known to produce the compound:

catecholamine biosynthesis :
dopamine + L-ascorbate + H+ + oxygen → L-dehydro-ascorbate + (R)-noradrenaline + H2O

β-D-glucuronide and D-glucuronate degradation :
a β-D-glucuronoside + H2O → D-glucopyranuronate + an alcohol

glycerophosphodiester degradation :
a glycerophosphodiester + H2O → an alcohol + sn-glycerol 3-phosphate + H+

phosphate acquisition :
a phosphate monoester + H2O → an alcohol + phosphate

Not in pathways:
an organic hydroperoxide + NADH + H+an alcohol + NAD+ + H2O
a 6-phospho-β-D-galactoside + H2O → D-galactopyranose 6-phosphate + an alcohol
an α-D-glucuronoside + H2O → D-glucopyranuronate + an alcohol
an α amino acid ester + H2O → an alcohol + an α amino acid + H+
a phosphate monoester + H2O → an alcohol + phosphate
RH + a reduced [NADPH-hemoprotein reductase] + oxygen → ROH + an oxidized [NADPH-hemoprotein reductase] + H2O
an oligosaccharide with β-L-arabinopyranose at the non-reducing end + H2O → β-L-arabinopyranose + an alcohol
an N-acetyl-β-D-hexosaminide + H2O → an N-acetyl-β-D-hexosamine + an alcohol
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an acetic ester + H2O → an alcohol + acetate + H+
a reduced thioredoxin + an organic hydroperoxide → an oxidized thioredoxin + an alcohol + H2O
a 6-O-(β-D-xylopyranosyl)-β-D-glucopyranoside + H2O → primeverose + an alcohol
an organic molecule + H2O + 2 oxygen → an alcohol + 2 superoxide + 2 H+
an N5-acyl-L-ornithine-ester + H2O → an N5-acyl-L-ornithine + an alcohol
α-L-fucoside + H2O → L-fucopyranose + an alcohol
a 2-deoxy-α-D-glucoside + H2O → 2-deoxy-D-glucose + an alcohol

In Reactions of unknown directionality:

Not in pathways:
an alcohol + 3'-phosphoadenylyl-sulfate = adenosine 3',5'-bisphosphate + an organosulfate + H+
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
an alcohol + NADP+ = an aldehyde + NADPH + H+
an alcohol + acetyl-CoA = an acetic ester + coenzyme A
trans-cinnamoyl-β-D-glucoside + an alcohol = alkyl cinnamate + D-glucopyranose
2 protein cysteines + an organic hydroperoxide = a protein disulfide + an alcohol + H2O
an organic molecule + an organic hydroperoxide = 2 an alcohol
an organic molecule + hydrogen peroxide = an alcohol + H2O

Enzymes inhibited by (R)-noradrenaline, sorted by the type of inhibition, are:

Inhibitor (Mechanism unknown) of: γ-glutamylhistamine synthetase [Stein82]

This compound has been characterized as an alternative substrate of the following enzymes: catechol O-methyltransferase

Credits:
Revised 11-Dec-2012 by Caspi R, SRI International


References

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Stein82: Stein C, Weinreich D (1982). "An in vitro characterization of gamma-glutamylhistamine synthetase: a novel enzyme catalyzing histamine metabolism in the central nervous system of the marine mollusk, Aplysia californica." J Neurochem 38(1);204-14. PMID: 6125565


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by Pathway Tools version 19.5 (software by SRI International) on Sat Apr 30, 2016, biocyc14.