Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
twitter

MetaCyc Compound: 4-hydroxyphenylpyruvate

Synonyms: p-hydroxyphenylpyruvic acid, 3-(4-hydroxyphenyl)pyruvate, hydroxyphenylpyruvate, p-hydroxyphenylpyruvate

Superclasses: an acid all carboxy acids a carboxylate a 2-oxo acid an aromatic oxo-acid
an acid all carboxy acids a carboxylate an aromatic oxo-acid

Chemical Formula: C9H7O4

Molecular Weight: 179.15 Daltons

Monoisotopic Molecular Weight: 180.0422587452 Daltons

SMILES: C1(=C(CC(C([O-])=O)=O)C=CC(=C1)O)

InChI: InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13)/p-1

InChIKey: InChIKey=KKADPXVIOXHVKN-UHFFFAOYSA-M

Unification Links: CAS:156-39-8 , ChEBI:36242 , ChemSpider:5341947 , HMDB:HMDB00707 , IAF1260:37006 , KEGG:C01179 , MetaboLights:MTBLC36242 , PubChem:6971070

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -43.714226 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

(S)-reticuline biosynthesis I , tyrosine degradation III :
4-hydroxyphenylpyruvate + H+ → CO2 + (4-hydroxyphenyl)acetaldehyde

3-dimethylallyl-4-hydroxybenzoate biosynthesis :
dimethylallyl diphosphate + 4-hydroxyphenylpyruvate → 3-dimethylallyl-4-hydroxyphenylpyruvate + diphosphate

4-hydroxybenzoate biosynthesis I (eukaryotes) :
3-(4-hydroxyphenyl)lactate + NAD+4-hydroxyphenylpyruvate + NADH + H+

atromentin biosynthesis :
2 4-hydroxyphenylpyruvate + 2 ATP → atromentin + 2 AMP + 2 diphosphate

factor 420 biosynthesis :
5-amino-6-(D-ribitylamino)uracil + 4-hydroxyphenylpyruvate + 2 S-adenosyl-L-methionine + H2O → 7,8-didemethyl-8-hydroxy-5-deazariboflavin + 2 5'-deoxyadenosine + 2 L-methionine + oxalate + ammonium + 3 H+

phenylalanine biosynthesis (cytosolic, plants) , plastoquinol-9 biosynthesis I , tyrosine degradation I , vitamin E biosynthesis (tocopherols) :
4-hydroxyphenylpyruvate + oxygen → CO2 + homogentisate

rosmarinic acid biosynthesis I :
4-hydroxyphenylpyruvate + NAD(P)H + H+ → (R)-3-(4-hydroxyphenyl)lactate + NAD(P)+

tyrosine degradation II , tyrosine degradation IV (to 4-methylphenol) :
4-hydroxyphenylpyruvate + 2 H+ + oxygen → 4-hydroxyphenylacetate + CO2 + H2O

Not in pathways:
4-hydroxyphenylpyruvate + oxygen → CO2 + 4-hydroxymandelate

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate


an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

3-dimethylallyl-4-hydroxybenzoate biosynthesis , tyrosine biosynthesis I :
prephenate + NAD+4-hydroxyphenylpyruvate + CO2 + NADH

prodigiosin biosynthesis :
(S)-3-acetyloctanal + an L-amino acid → 2-methyl-3-n-amyl-dihydropyrrole + a 2-oxo acid + H2O

3,3'-thiodipropionate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropionate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

Not in pathways:
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+
a 1-lysophosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an acylcholine + H2O → choline + a carboxylate + H+
a 1,2-diacyl-3-β-D-galactosyl-sn-glycerol + 2 H2O → 2 a carboxylate + 3-β-D-galactosyl-sn-glycerol + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an S-acylglutathione + H2O → a carboxylate + glutathione
an N-acyl-L-aspartate + H2O → L-aspartate + a carboxylate

Reactions known to both consume and produce the compound:

(S)-reticuline biosynthesis I , 4-hydroxybenzoate biosynthesis I (eukaryotes) , 4-hydroxyphenylpyruvate biosynthesis , atromentin biosynthesis , rosmarinic acid biosynthesis I , tyrosine biosynthesis I , tyrosine degradation I , tyrosine degradation II , tyrosine degradation IV (to 4-methylphenol) :
L-tyrosine + 2-oxoglutarate ↔ 4-hydroxyphenylpyruvate + L-glutamate

phenylalanine biosynthesis (cytosolic, plants) :
2-oxo-3-phenylpropanoate + L-tyrosine ↔ L-phenylalanine + 4-hydroxyphenylpyruvate

tyrosine degradation III :
L-tyrosine + pyruvate ↔ 4-hydroxyphenylpyruvate + L-alanine
L-tyrosine + 2-oxoglutarate ↔ 4-hydroxyphenylpyruvate + L-glutamate

Not in pathways:
glyoxylate + an aromatic amino acid ↔ glycine + an aromatic oxo-acid
an aromatic amino acid + 2-oxoglutarate ↔ an aromatic oxo-acid + L-glutamate

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
prephenate + NADP+ = 4-hydroxyphenylpyruvate + CO2 + NADPH
L-tyrosine + H2O + oxygen = 4-hydroxyphenylpyruvate + ammonium + hydrogen peroxide


an (R)-2-hydroxyacid + an electron-transfer-related quinone = a 2-oxo acid + an electron-transfer-related quinol


eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
an aldehyde + pyrroloquinoline quinone + H2O = a carboxylate + pyrroloquinoline quinol + H+
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an oxidized electron acceptor + H2O = a carboxylate + a reduced electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an N-acyl-D-glutamate + H2O = a carboxylate + D-glutamate
an anilide + H2O = aniline + a carboxylate + H+
a 5'-acylphosphoadenosine + H2O = a carboxylate + AMP + 2 H+
a 3-acylpyruvate + H2O = a carboxylate + pyruvate + H+
an N6acyl-L-lysine + H2O = a carboxylate + L-lysine
an N-acyl-D-aspartate + H2O = a carboxylate + D-aspartate

Enzymes inhibited by 4-hydroxyphenylpyruvate, sorted by the type of inhibition, are:

Inhibitor (Mechanism unknown) of: 4-coumaroyl-CoA:R(+)-3,4-dihydroxyphenyllactate 2'-O-coumaroyl-transferase [Petersen91]


References

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Petersen91: Petersen M (1991). "Characterization of rosmarinic acid synthase from cell cultures of Coleus blumei." Phytochemistry, 30(9), 2877-2881.


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Wed Nov 26, 2014, BIOCYC13B.