Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
twitter

MetaCyc Compound: S-adenosyl-L-methionine

Abbrev Name: SAM

Synonyms: AdoMet, SAM, 2-S-adenosyl-L-methionine, S-adenosyl-methionine, adenosylmethionine, S-adenosylmethionine

Superclasses: an acid all carboxy acids a carboxylate an amino acid an alpha amino acid a non-standard alpha amino acid
an amino acid or its derivative an amino acid an alpha amino acid a non-standard alpha amino acid

Summary:
S-adenosyl-L-methionine (AdoMet) is a sulfonium compound in which each of the carbons attached to the sulfur is activated toward nucleophilic attack.

Chemical Formula: C15H23N6O5S

Molecular Weight: 399.44 Daltons

Monoisotopic Molecular Weight: 399.14506357 Daltons

<i>S</i>-adenosyl-L-methionine compound structure

SMILES: C[S+](CC3(C(O)C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))CCC(C([O-])=O)[N+]

InChI: InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/p+1/t7-,8+,10+,11+,14+,27?/m0/s1

InChIKey: InChIKey=MEFKEPWMEQBLKI-AIRLBKTGSA-O

Unification Links: CAS:29908-03-0 , ChEBI:59789 , HMDB:HMDB01185 , IAF1260:33530 , KEGG:C00019 , MetaboLights:MTBLC59789 , PubChem:24762165

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 124.03472 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

(S)-reticuline biosynthesis I :
(S)-coclaurine + S-adenosyl-L-methionine → (S)-N-methylcoclaurine + S-adenosyl-L-homocysteine + H+
3'-hydroxy-N-methyl-(S)-coclaurine + S-adenosyl-L-methionineS-adenosyl-L-homocysteine + (S)-reticuline + H+
(S)-norcoclaurine + S-adenosyl-L-methionineS-adenosyl-L-homocysteine + (S)-coclaurine + H+

(S)-reticuline biosynthesis II :
S-norlaudanosoline + 3 S-adenosyl-L-methionine → (S)-reticuline + 3 S-adenosyl-L-homocysteine + 3 H+

1,3,5-trimethoxybenzene biosynthesis :
3,5-dimethoxyphenol + S-adenosyl-L-methionine → 1,3,5-trimethoxybenzene + S-adenosyl-L-homocysteine + H+
3,5-dihydroxyanisole + S-adenosyl-L-methionine → 3,5-dimethoxyphenol + S-adenosyl-L-homocysteine + H+
phloroglucinol + S-adenosyl-L-methionine → 3,5-dihydroxyanisole + S-adenosyl-L-homocysteine + H+

1,4-dihydroxy-6-naphthoate biosynthesis I :
dehypoxanthine futalosine + S-adenosyl-L-methionine → cyclic dehypoxanthine futalosine + L-methionine + 5'-deoxyadenosine + H+
3-[(1-carboxyvinyl)oxy]benzoate + S-adenosyl-L-methionine + H2O → 6-amino-6-deoxyfutalosine + L-methionine + hydrogen carbonate + H+

1,4-dihydroxy-6-naphthoate biosynthesis II :
dehypoxanthine futalosine + S-adenosyl-L-methionine → cyclic dehypoxanthine futalosine + L-methionine + 5'-deoxyadenosine + H+
3-[(1-carboxyvinyl)oxy]benzoate + S-adenosyl-L-methionine + H2O → 6-amino-6-deoxyfutalosine + L-methionine + hydrogen carbonate + H+

2'-deoxymugineic acid phytosiderophore biosynthesis , L-nicotianamine biosynthesis :
3 S-adenosyl-L-methionine → L-nicotianamine + 3 S-methyl-5'-thioadenosine + 3 H+

2-methylisoborneol biosynthesis :
S-adenosyl-L-methionine + geranyl diphosphate → S-adenosyl-L-homocysteine + (E)-2-methylgeranyl diphosphate + H+

3,5-dimethoxytoluene biosynthesis :
orcinol + S-adenosyl-L-methionine → 3-methoxy-5-hydroxytoluene + S-adenosyl-L-homocysteine + H+
3-methoxy-5-hydroxytoluene + S-adenosyl-L-methionine → 3,5-dimethoxytoluene + S-adenosyl-L-homocysteine + H+

3-methylarginine biosynthesis :
5-guanidino-2-oxo-pentanoate + S-adenosyl-L-methionine → 5-guanidino-3-methyl-2-oxo-pentanoate + S-adenosyl-L-homocysteine + H+

4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis :
5-amino-1-(5-phospho-β-D-ribosyl)imidazole + S-adenosyl-L-methionine → 4-amino-2-methyl-5-phosphomethylpyrimidine + 5'-deoxyadenosine + L-methionine + formate + carbon monoxide + 3 H+

5-(carboxymethoxy)uridine biosynthesis :
prephenate + S-adenosyl-L-methionine → 2-oxo-3-phenylpropanoate + carboxy-S-adenosyl-L-methionine + H2O

6-gingerol biosynthesis :
1-(3,4-dihydroxyphenyl)-5-hydroxy-3-decanone + S-adenosyl-L-methionine → 6-gingerol + S-adenosyl-L-homocysteine + H+

6-methoxymellein biosynthesis :
6-hydroxymellein + S-adenosyl-L-methionineS-adenosyl-L-homocysteine + 6-methoxymellein + H+

7-(3-amino-3-carboxypropyl)-wyosine biosynthesis :
N1-methylguanine37 in tRNAPhe + pyruvate + S-adenosyl-L-methionine → 4-demethylwyosine37 in tRNAPhe + L-methionine + 5'-deoxyadenosine + CO2 + H2O
S-adenosyl-L-methionine + 7-[(3S)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in tRNAPheS-adenosyl-L-homocysteine + 7-[(3S)-(3-amino-3-carboxypropyl)]-wyosine37 in tRNAPhe + H+
S-adenosyl-L-methionine + 4-demethylwyosine37 in tRNAPheS-methyl-5'-thioadenosine + 7-[(3S)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in tRNAPhe + H+
guanine37 in tRNAPhe + S-adenosyl-L-methionineN1-methylguanine37 in tRNAPhe + S-adenosyl-L-homocysteine + H+

7-dehydroporiferasterol biosynthesis :
S-adenosyl-L-methionine + cycloartenol → S-adenosyl-L-homocysteine + 24-methylenecycloartanol + H+

Reactions known to produce the compound:

2'-deoxymugineic acid phytosiderophore biosynthesis , ethylene biosynthesis I (plants) , L-methionine degradation I (to L-homocysteine) , S-adenosyl-L-methionine biosynthesis , S-adenosyl-L-methionine cycle II :
ATP + L-methionine + H2O → S-adenosyl-L-methionine + phosphate + diphosphate

Not in pathways:
2 a [methionine synthase]-methylcob(I)alamin + 2 S-adenosyl-L-homocysteine + NADP+ → 2 a [methionine synthase]-cob(II)alamin + 2 S-adenosyl-L-methionine + NADPH + H+

Not in pathways:
amino acids(n) + H2O → amino acids(n-1) + an α amino acid
an α amino acid ester + H2O → an alcohol + an α amino acid + H+
a protein + H2O → a protein + an α amino acid

3,3'-thiodipropanoate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropanoate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

Not in pathways:
a 1-acyl 2-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → a 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an acylcholine + H2O → choline + a carboxylate + H+
a β-monogalactosyldiacylglycerol + 2 H2O → 2 a carboxylate + 3-β-D-galactosyl-sn-glycerol + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an S-acylglutathione + H2O → a carboxylate + glutathione
an N-acyl-L-aspartate + H2O → L-aspartate + a carboxylate

Reactions known to both consume and produce the compound:

biotin biosynthesis from 8-amino-7-oxononanoate I :
S-adenosyl-L-methionine + 8-amino-7-oxononanoate ↔ S-adenosyl-4-methylthio-2-oxobutanoate + 7,8-diaminopelargonate

salinosporamide A biosynthesis :
S-adenosyl-L-methionine + chloride ↔ 5'-deoxy-5'-chloroadenosine + L-methionine

Not in pathways:
an inactive ribonucleoside triphosphate reductase + S-adenosyl-L-methionine ↔ an active ribonucleoside triphosphate reductase + 5'-deoxyadenosine + L-methionine

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
choline trimethylamine-lyase + S-adenosyl-L-methionine = choline trimethylamine-lyase monomer, active + 5'-deoxyadenosine + L-methionine
N6-dimethylallyladenosine37 in tRNA + a sulfurated [sulfur carrier] + S-adenosyl-L-methionine + an reduced unknown electron acceptor = 2-thio-N6-dimethylallyladenosine37 in tRNA + an unsulfurated [sulfur carrier] + 5'-deoxyadenosine + L-methionine + an oxidized unknown electron acceptor + H+
a uridine47 in tRNAPhe + S-adenosyl-L-methionine = a 3-[(3S)-3-amino-3-carboxypropyl]-uridine47 in tRNAPhe + S-methyl-5'-thioadenosine + H+
cytosyl-β-D-glucuronate + 2 S-adenosyl-L-methionine + 2 a reduced flavodoxin = cytosyl-α-L-arabinopyranose + CO2 + 2 5'-deoxyadenosine + 2 L-methionine + 2 an oxidized flavodoxin + H+
4-coumaryl-CoA + S-adenosyl-L-methionine = S-methyl-5'-thioadenosine + N-4-coumaryl-L-homoserine lactone + coenzyme A + H+
isovaleryl-CoA + S-adenosyl-L-methionine = S-methyl-5'-thioadenosine + N-isovaleryl-L-homoserine lactone + coenzyme A + H+
S-adenosyl-L-methionine = L-homoserine lactone + S-methyl-5'-thioadenosine
a (3R)-3-hydroxybutanoyl-[acp] + S-adenosyl-L-methionine = a holo-[acyl-carrier protein] + S-methyl-5'-thioadenosine + HAI-1 + H+
an octanoyl-[acp] + S-adenosyl-L-methionine = a holo-[acyl-carrier protein] + S-methyl-5'-thioadenosine + VAI-1-2 + H+
a butyryl-[acp] + S-adenosyl-L-methionine = a holo-[acyl-carrier protein] + S-methyl-5'-thioadenosine + PAI-1-2 + H+
a 3-oxo-dodecanoyl-[acp] + S-adenosyl-L-methionine = a holo-[acyl-carrier protein] + S-methyl-5'-thioadenosine + PAI-1 + H+
a 3-oxo-hexanoyl-[acp] + S-adenosyl-L-methionine = a holo-[acyl-carrier protein] + S-methyl-5'-thioadenosine + VAI-1 + H+
a 3-oxo-octanoyl-[acp] + S-adenosyl-L-methionine = a holo-[acyl-carrier protein] + S-methyl-5'-thioadenosine + AAI-1 + H+
nocardicin E + S-adenosyl-L-methionine = isonocardicin A + S-methyl-5'-thioadenosine + H+
a [formate C acetyltransferase]-glycine + S-adenosyl-L-methionine + a reduced flavodoxin = a [formate C acetyltransferase]-glycin -2-yl radical + 5'-deoxyadenosine + L-methionine + a flavodoxin semiquinone
N6-dimethylallyladenine + S-adenosyl-L-methionine = discadenine + S-methyl-5'-thioadenosine + H+
S-adenosyl-L-methionine + H2O = L-homoserine + S-methyl-5'-thioadenosine + H+

Not in pathways:
a 5-L-glutamyl-[peptide] + an amino acid = a 5-L-glutamyl-amino acid + a peptide

Not in pathways:
eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a 2-acyl 1-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a triacyl-sn-glycerol + H2O = a 1,2-diacyl-sn-glycerol + a carboxylate + H+
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
a nitrile + 2 H2O = a carboxylate + ammonium

Enzymes activated by S-adenosyl-L-methionine, sorted by the type of activation, are:

Activator (Mechanism unknown) of: methionine adenosyltransferase [Comment 1]

Enzymes inhibited by S-adenosyl-L-methionine, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: methionine adenosyltransferase [Markham80]

Inhibitor (Noncompetitive) of: homoserine O-acetyltransferase [Shiio81]

Inhibitor (Allosteric) of: homoserine O-succinyltransferase [Comment 2]

Inhibitor (Mechanism unknown) of: S-methyl-L-methionine decarboxylase [Kocsis00] , methionine adenosyltransferase [Comment 3] , O-acetylhomoserine sulfhydrylase [Belfaiza98] , homoserine O-acetyltransferase [Yamagata87] , methionine adenosyltransferase [Cabrero87] , S-adenosylmethionine synthetase [Schroder97]

This compound has been characterized as a cofactor or prosthetic group of the following enzymes: HMP-P synthase , lysine 2,3-aminomutase , 15-demethoxy-ε-rhodomycinone 10-hydroxylase , 15-demethoxyaclacinomycin T decarboxylase , 15-demethoxyaclacinomycin A decarboxylase , (2R,3R)-3-methylornithine synthase , nicotine N-methyltransferase , 2-hydroxyethylphosphonate methylase , lysine 2,3-aminomutase

This compound has been characterized as an alternative substrate of the following enzymes: homocysteine S-methyltransferase


References

Belfaiza98: Belfaiza J, Martel A, Margarita D, Saint Girons I (1998). "Direct sulfhydrylation for methionine biosynthesis in Leptospira meyeri." J Bacteriol 180(2);250-5. PMID: 9440513

Cabrero87: Cabrero C, Puerta J, Alemany S (1987). "Purification and comparison of two forms of S-adenosyl-L-methionine synthetase from rat liver." Eur J Biochem 170(1-2);299-304. PMID: 3121322

Chou72: Chou TC, Talalay P (1972). "The mechanism of S-adenosyl-L-methionine synthesis by purified preparations of bakers' yeast." Biochemistry 1972;11(6);1065-73. PMID: 4552214

Kocsis00: Kocsis MG, Hanson AD (2000). "Biochemical evidence for two novel enzymes in the biosynthesis of 3-dimethylsulfoniopropionate in Spartina alterniflora." Plant Physiol 123(3);1153-61. PMID: 10889264

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Lee66: Lee LW, Ravel JM, Shive W (1966). "Multimetabolite control of a biosynthetic pathway by sequential metabolites." J Biol Chem 1966;241(22);5479-80. PMID: 5333667

Markham80: Markham GD, Hafner EW, Tabor CW, Tabor H (1980). "S-Adenosylmethionine synthetase from Escherichia coli." J Biol Chem 1980;255(19);9082-92. PMID: 6251075

Schroder97: Schroder G, Eichel J, Breinig S, Schroder J (1997). "Three differentially expressed S-adenosylmethionine synthetases from Catharanthus roseus: molecular and functional characterization." Plant Mol Biol 33(2);211-22. PMID: 9037140

Shiio81: Shiio I, Ozaki H (1981). "Feedback inhibition by methionine and S-adenosylmethionine, and desensitization of homoserine O-acetyltransferase in Brevibacterium flavum." J Biochem (Tokyo) 89(5);1493-500. PMID: 7275950

Yamagata87: Yamagata S (1987). "Partial purification and some properties of homoserine O-acetyltransferase of a methionine auxotroph of Saccharomyces cerevisiae." J Bacteriol 1987;169(8);3458-63. PMID: 3301801


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Sun Aug 30, 2015, biocyc13.