Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down
12/28 - 12/31
for maintenance.
twitter

MetaCyc Compound: UDP

Synonyms: uridine-diphosphate, uridine-5'-diphosphate

Superclasses: a nucleic acid component a nucleotide a nucleoside diphosphate a ribonucleoside diphosphate a pyrimidine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a pyrimidine nucleotide a pyrimidine ribonucleotide a pyrimidine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a pyrimidine ribonucleotide a pyrimidine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a ribonucleoside diphosphate a pyrimidine ribonucleoside 5'-diphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a diazine a pyrimidine a pyrimidine nucleotide a pyrimidine ribonucleotide a pyrimidine ribonucleoside 5'-diphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a diazine a pyrimidine

Chemical Formula: C9H11N2O12P2

Molecular Weight: 401.14 Daltons

Monoisotopic Molecular Weight: 404.002196945 Daltons

SMILES: C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))

InChI: InChI=1S/C9H14N2O12P2/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18)/p-3/t4-,6-,7-,8-/m1/s1

InChIKey: InChIKey=XCCTYIAWTASOJW-XVFCMESISA-K

Unification Links: CAS:58-98-0 , ChEBI:58223 , ChemSpider:16739715 , HMDB:HMDB00295 , IAF1260:33518 , KEGG:C00015 , KNApSAcK:C00007313 , MetaboLights:MTBLC58223 , PubChem:20056717

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -504.6063 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

pyrimidine deoxyribonucleotides de novo biosynthesis I , pyrimidine deoxyribonucleotides de novo biosynthesis III :
dUDP + an oxidized thioredoxin + H2O ← UDP + a reduced thioredoxin

superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli) :
dUDP + an oxidized thioredoxin + H2O ← UDP + a reduced thioredoxin
dUDP + an oxidized NrdH glutaredoxin-like protein + H2O ← UDP + a reduced NrdH glutaredoxin-like protein

UTP and CTP de novo biosynthesis :
UDP + ATP → UTP + ADP

UTP and CTP dephosphorylation I :
UDP + H2O → UMP + phosphate + H+

Not in pathways:
a pyrimidine ribonucleotide + H2O → D-ribose 5-phosphate + a pyrimidine base


a 2'-deoxyribonucleoside 5'-diphosphate + an oxidized thioredoxin + H2O ← a ribonucleoside diphosphate + a reduced thioredoxin


ribonucleotiden + ribonucleotiden + ATP → ribonucleotidem+n + AMP + diphosphate


a nucleoside diphosphate + ATP → a nucleoside triphosphate + ADP


a nucleotide + H2O → a nucleoside + phosphate

Reactions known to produce the compound:

(+)-secoisolariciresinol diglucoside biosynthesis :
(+)-secoisolariciresinol + UDP-α-D-glucose → (+)-secoisolariciresinol monoglucoside + UDP + H+
(+)-secoisolariciresinol monoglucoside + UDP-α-D-glucose → (+)-secoisolariciresinol diglucoside + UDP + H+

2,4,6-trinitrotoluene degradation :
UDP-α-D-glucose + 4-hydroxylamino-2,6-dinitrotoluene → 4-hydroxylamino-2,6-dinitrotoluene-O-glucoside + UDP + H+
UDP-α-D-glucose + 2-hydroxylamino-4,6-dinitrotoluene → 2-hydroxylamino-4,6-dinitrotoluene-C3-glucoside + UDP + H+
UDP-α-D-glucose + 2-amino-4,6-dinitrotoluene → 2-amino-4,6-dinitrotoluene glucoside + UDP + 2 H+
UDP-α-D-glucose + 2-hydroxylamino-4,6-dinitrotoluene → 2-hydroxylamino-4,6-dinitrotoluene-O-glucoside + UDP + H+
UDP-α-D-glucose + 4-amino-2,6-dinitrotoluene → 4-amino-2,6-dinitrotoluene glucoside + UDP + 2 H+
UDP-α-D-glucose + 4-hydroxylamino-2,6-dinitrotoluene → 4-hydroxylamino-2,6-dinitrotoluene 3C-glucoside + UDP + H2O

3,4-dihydroxymandelonitrile β-D-glucose biosynthesis :
(R)-3,4-dihydroxymandelonitrile + UDP-α-D-glucose → 3,4-dihydroxymandelonitrile β-D-glucoside + UDP + H+

6'-deoxychalcone metabolism :
UDP-α-D-glucose + butein → butein 4'-β-D-glucoside + UDP + H+
UDP-α-D-glucose + isoliquiritigenin → isoliquiritigenin 4'-glucoside + UDP + H+

A series fagopyritols biosynthesis :
UDP-α-D-galactose + 1D-chiro-inositol → fagopyritol A1 + UDP + H+

abscisic acid glucose ester biosynthesis :
UDP-α-D-glucose + 2-cis-abscisate → β-D-glucopyranosyl abscisate + UDP

acetan biosynthesis :
UDP-α-D-glucuronate + α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol → UDP + β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + H+
α-D-glucosyl-(1,2)-β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP-α-D-glucose → β-D-glucosyl-(1,6)-α-D-glucosyl-(1,2)-β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP + H+
β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP-α-D-glucose → α-D-glucosyl-(1,2)-β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP + H+
α-D-glucopyranosyl-diphosphoundecaprenol + UDP-α-D-glucose → β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP + H+

acylated cyanidin galactoside biosynthesis :
cyanidin + UDP-α-D-galactose → cyanidin-3-O-β-D-galactoside + UDP
UDP-α-D-xylose + cyanidin-3-O-β-D-galactoside → UDP + cyanidin 3-O-(β-D-xylosyl-(1→2)-β-D-galactoside) + H+
cyanidin 3-O-(β-D-xylosyl-(1→2)-β-D-galactoside) + UDP-α-D-glucose → cyanidin 3-O-(6-O-β-D-glucosyl-2-O-β-D-xylosyl-β-D-galactoside) + UDP + H+

afrormosin conjugates interconversion :
UDP-α-D-glucose + afrormosin → afrormosin-7-O-glucoside + UDP + H+

ajmaline and sarpagine biosynthesis :
UDP-α-D-glucose + vomilenine → raucaffricine + UDP + H+

amaranthin biosynthesis :
cyclo-dopa 5-O-glucoside + UDP-α-D-glucuronate → cyclo-dopa glucuronylglucoside + UDP + H+

anthocyanidin modification (Arabidopsis) :
cyanidin + UDP-α-D-glucose → cyanidin-3-O-β-D-glucoside + UDP
cyanidin-3-O-β-D-glucoside + UDP-α-D-xylose → cyanidin 3-O-[2"-O-(xylosyl) glucoside + UDP
cyanidin 3-O-p-coumaroylglucoside + UDP-α-D-xylose → cyanidin 3-O-[2"-O-xylosyl) 6"-O-(p-coumaroyl) glucoside + UDP + H+
cyanidin 3-O-[2"-O-xylosyl) 6"-O-(p-coumaroyl) glucoside + UDP-α-D-glucose → cyanidin 3-O-[2"-O-(xylosyl)-6"-O-(p-coumaroyl) glucoside] 5-O-glucoside + UDP + H+

anthocyanidin sophoroside metabolism :
UDP-α-D-glucose + cyanidin-3-O-β-D-glucoside → cyanidin 3-O-sophoroside + UDP + H+
UDP-α-D-glucose + delphinidin-3-O-β-D-glucoside → delphinidin 3-O-sophoroside + UDP + H+
UDP-α-D-glucose + pelargonidin-3-O-β-D-glucoside → pelargonidin 3-O-sophoroside + UDP + H+

anthocyanin biosynthesis (cyanidin 3-O-glucoside) :
cyanidin + UDP-α-D-glucose → cyanidin-3-O-β-D-glucoside + UDP

anthocyanin biosynthesis (delphinidin 3-O-glucoside) :
UDP-α-D-glucose + delphinidin → UDP + delphinidin-3-O-β-D-glucoside

anthocyanin biosynthesis (pelargonidin 3-O-glucoside) :
UDP-α-D-glucose + pelargonidin → UDP + pelargonidin-3-O-β-D-glucoside

apigenin glycosides biosynthesis :
apigenin 7-O-β-D-glucoside + UDP-D-apiose → apigenin 7-O-[β-D-apiosyl-(1→2)-β-D-glucoside] + UDP + H+
apigenin 7-O-β-D-glucoside + UDP-L-rhamnose → apigenin 7-O-neohesperidoside + UDP + H+
UDP-α-D-glucose + apigenin → UDP + apigenin 7-O-β-D-glucoside
apigenin 7-O-β-D-glucoside + UDP-α-D-glucose → apigenin-7-O-gentiobioside + UDP + H+

apigeninidin 5-O-glucoside biosynthesis :
apigeninidin + UDP-α-D-glucose → apigeninidin 5-O-glucoside + UDP + H+

aurone biosynthesis :
UDP-α-D-glucose + 2',4,4',6'-tetrahydroxychalcone → UDP + 2',4,4',6'-tetrahydroxychalcone 4'-O-β-D-glucoside + H+
UDP-α-D-glucose + 2',3,4,4',6'-pentahydroxychalcone → 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + sulfuretin → sulfuretin 6-glucoside + UDP + H+
UDP-α-D-glucose + butein → butein 4'-β-D-glucoside + UDP + H+

avenacin A-1 biosynthesis :
monodeglucosyl des-acyl avenacin A + UDP-α-D-glucose → des-acyl avenacin A + UDP + H+

B series fagopyritols biosynthesis :
UDP-α-D-galactose + 1D-chiro-inositol → fagopyritol B1 + UDP + H+

bacillithiol biosynthesis :
UDP-N-acetyl-α-D-glucosamine + (S)-malate → malyl-N-acetyl-D-glucosamine + UDP + H+

baicalein metabolism :
UDP-α-D-glucuronate + baicalein → UDP + baicalin + H+
baicalein + UDP-α-D-glucose → baicalein 7-O-β-D-glucoside + UDP + H+

benzoyl-β-D-glucopyranose biosynthesis :
benzoate + UDP-α-D-glucose → benzoyl-β-D-glucopyranose + UDP

β-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosamine biosynthesis :
UDP-α-D-galactose + N-acetyl-α-D-galactosaminyl-diphospho-ditrans,octacis-undecaprenol → β-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+

betacyanin biosynthesis :
UDP-α-D-glucose + leucodopachrome → cyclo-dopa 5-O-glucoside + UDP + H+
UDP-α-D-glucose + betanidin → gomphrenin I + UDP + H+
UDP-α-D-glucose + betanidin → betanin + UDP + H+

biochanin A conjugates interconversion :
UDP-α-D-glucose + biochanin-A → biochanin A-7-O-glucoside + UDP

brassinosteroids inactivation :
castasterone + UDP-α-D-glucose → castasterone-23-O-glucoside + UDP + H+
brassinolide + UDP-α-D-glucose → brassinolide-23-O-glucoside + UDP + H+

C-glycosylflavone biosynthesis I :
naringenin dibenzoylmethane tautomer + UDP-α-D-glucose → 6C-glucosyl-2-hydroxynaringenin + UDP + H+
naringenin dibenzoylmethane tautomer + UDP-α-D-glucose → 8C-glucosyl-2-hydroxynaringenin + UDP + 2 H+

C-glycosylflavone biosynthesis II :
eriodictyol dibenzoylmethane tautomer + UDP-α-D-glucose → 6C-β-D-glucosyl-2-hydroxyeriodictyol + UDP + H+
eriodictyol dibenzoylmethane tautomer + UDP-α-D-glucose → 8C-β-D-glucosyl-2-hydroxyeriodictyol + UDP + H+

C-glycosylflavone biosynthesis III :
2,5,7-trihydroxyflavanone dibenzoylmethane tautomer + UDP-α-D-glucose → 6C-glucosyl-2,5,7-trihydroxyflavanone + UDP + H+
2,5,7-trihydroxyflavanone dibenzoylmethane tautomer + UDP-α-D-glucose → 8C-glucosyl-2,5,7-trihydroxyflavanone + UDP + 2 H+

cardenolide glucosides biosynthesis :
digitoxigenin + UDP-fucose → digitoxigenin 3-O-β-D-quinovoside + UDP + H+
digitoxigenin + UDP-fucose → digiproside + UDP + H+
UDP-α-D-glucose + digiproside → glucodigifucoside + UDP + H+
UDP-α-D-glucose + digitoxigenin → 3-O-β-D-glucoside digitoxigenin + UDP + H+

chalcone 2'-O-glucoside biosynthesis :
UDP-α-D-glucose + 2',4,4',6'-tetrahydroxychalcone → chalcone 2'-O-glucoside + UDP + H+

chitin biosynthesis :
UDP-N-acetyl-α-D-glucosamine + [1,4-(N-acetyl-β-D-glucosaminyl)]nUDP + [1,4-(N-acetyl-β-D-glucosaminyl)]n+1

chondroitin and dermatan biosynthesis :
UDP-N-acetyl-D-galactosamine + D-glucuronyl-1,3-β-D-galactosylproteoglycan → N-acetyl-D-galactosaminyl-1,4-β-D-glucuronyl-1,3-β-D-galactosyl-[proteoglycan] + UDP + H+
N-acetyl-β-D-galactosaminide-[chondroitin/dermatan] + UDP-α-D-glucuronate → β-D-glucuronosyl-[chondroitin/dermatan] + UDP
UDP-N-acetyl-α-D-galactosamine + β-D-glucuronosyl-[chondroitin/dermatan] → N-acetyl-β-D-galactosaminide-[chondroitin/dermatan] + UDP + H+

chondroitin sulfate biosynthesis (late stages) :
UDP-N-acetyl-α-D-galactosamine + β-D-glucuronosyl-[chondroitin/dermatan] → N-acetyl-β-D-galactosaminide-[chondroitin/dermatan] + UDP + H+

cichoriin interconversion :
esculetin + UDP-α-D-glucose → cichoriin + UDP + H+

cinnamate esters biosynthesis :
UDP-α-D-glucose + trans-cinnamate → UDP + trans-cinnamoyl-β-D-glucoside

CMP-legionaminate biosynthesis II :
UDP-N,N'-diacetylbacillosamine + H2O → 2,4-diacetamido-2,4,6-trideoxy-α-D-mannopyranose + UDP + H+

CMP-N-acetyl-7-O-acetylneuraminate biosynthesis :
4-O-acetyl-UDP-N-acetylglucosamine + H2O → 4-O-acetyl-N-acetylmannosamine + UDP + H+

CMP-N-acetylneuraminate biosynthesis I (eukaryotes) , CMP-N-acetylneuraminate biosynthesis II (bacteria) :
UDP-N-acetyl-α-D-glucosamine + H2O → N-acetyl-α-D-mannosamine + UDP + H+

CMP-pseudaminate biosynthesis :
UDP-2,4-diacetamido-2,4,6-trideoxy-β-L-altropyranose + H2O → 2,4-diacetamido-2,4,6-trideoxy-β-L-altropyranose + UDP + H+

coniferin metabolism :
UDP-α-D-glucose + coniferyl alcohol → coniferin + UDP + H+

coumarin biosynthesis (via 2-coumarate) :
UDP-α-D-glucose + 2-coumarate → trans-β-D-glucosyl-2-hydroxycinnamate + UDP + H+

crocetin biosynthesis :
UDP-α-D-glucose + (3S)-3-hydroxycyclocitral → picrocrocin + UDP + H+

crocetin esters biosynthesis :
UDP-α-D-glucose + β-D-gentiobiosyl crocetin → β-D-gentiobiosyl β-D-glucosyl crocetin + UDP
UDP-α-D-glucose + β-D-glucosyl crocetin → bis(β-D-glucosyl) crocetin + UDP
UDP-α-D-glucose + crocetin → β-D-glucosyl crocetin + UDP
UDP-α-D-glucose + β-D-glucosyl crocetin → β-D-gentiobiosyl crocetin + UDP + H+
UDP-α-D-glucose + bis(β-D-glucosyl) crocetin → β-D-gentiobiosyl β-D-glucosyl crocetin + UDP + H+
UDP-α-D-glucose + β-D-gentiobiosyl β-D-glucosyl crocetin → crocin + UDP + H+

curcumin glucoside biosynthesis :
curcumin 4'-O-β-D-gentiotrioside + UDP-α-D-glucose → curcumin 4'-O-β-D-gentiotetraside + UDP + H+
curcumin 4'-O-β-D-gentiobioside + UDP-α-D-glucose → curcumin 4'-O-β-D-gentiotrioside + UDP + H+
UDP-α-D-glucose + curcumin → curcumin monoglucoside + UDP + H+
UDP-α-D-glucose + curcumin 4'-O-β-D-gentiobiosyl 4''-O-β-D-glucoside → curcumin 4',4''-O-β-D-digentiobioside + UDP + H+
UDP-α-D-glucose + curcumin 4'-O-β-D-gentiobioside → curcumin 4'-O-β-D-gentiobiosyl 4''-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + curcumin diglucoside → curcumin 4'-O-β-D-gentiobiosyl 4''-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + curcumin monoglucoside → curcumin 4'-O-β-D-gentiobioside + UDP + H+
UDP-α-D-glucose + curcumin monoglucoside → curcumin diglucoside + UDP + H+

cytokinin-O-glucosides biosynthesis :
UDP-α-D-glucose + cis-zeatin → cis-zeatin-O-glucoside + UDP + H+
UDP-α-D-glucose + dihydrozeatin-9-N-glucoside → dihydrozeatin-9-N-glucoside-O-glucoside + UDP + H+
UDP-α-D-glucose + dihydrozeatin → dihydrozeatin-O-glucoside + UDP + H+
UDP-α-D-glucose + trans-zeatin → trans-zeatin-O-glucoside + UDP + H+

cytokinins 7-N-glucoside biosynthesis :
UDP-α-D-glucose + cis-zeatin → cis-zeatin-7-N-glucoside + UDP + H+
UDP-α-D-glucose + trans-zeatin-O-glucoside → trans-zeatin-O-glucoside-7-N-glucoside + UDP + H+
UDP-α-D-glucose + kinetin → kinetin-7-N-glucoside + UDP + H+
UDP-α-D-glucose + benzyladenine → benzyladenine-7-N-glucoside + UDP + H+
UDP-α-D-glucose + N6-dimethylallyladenine → isopentenyladenine-7-N-glucoside + UDP + H+
UDP-α-D-glucose + dihydrozeatin → dihydrozeatin-7-N-glucose + UDP + H+
UDP-α-D-glucose + trans-zeatin → trans-zeatin-7-N-glucoside + UDP + H+

Reactions known to both consume and produce the compound:

dhurrin biosynthesis :
UDP-α-D-glucose + (S)-4-hydroxymandelonitrile ↔ UDP + dhurrin + H+

kaempferol diglycoside biosynthesis (pollen-specific) :
UDP-α-D-galactose + kaempferol ↔ UDP + kaempferol 3-O-β-D-galactoside + H+

N-glucosylnicotinate metabolism :
UDP-α-D-glucose + nicotinate + H+ ↔ N-glucosylnicotinate + UDP

peptidoglycan biosynthesis I (meso-diaminopimelate containing) :
undecaprenyldiphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + UDP-N-acetyl-α-D-glucosamine ↔ ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + UDP + H+

quercetin diglycoside biosynthesis (pollen-specific) :
quercetin + UDP-α-D-galactose ↔ quercetin 3-galactoside + UDP + H+

sucrose degradation II (sucrose synthase) :
UDP-α-D-glucose + β-D-fructofuranose ↔ sucrose + UDP + H+

trehalose biosynthesis VI :
an NDP-α-D-glucose + D-glucopyranose ↔ α,α-trehalose + a nucleoside diphosphate + H+

Not in pathways:
(ribonucleotides)(n) + phosphate ↔ (ribonucleotides)(n-1) + a nucleoside diphosphate

In Reactions of unknown directionality:

callose biosynthesis :
UDP-α-D-glucose + 1,3-β-D-glucan(n) = 1,3-β-D-glucan(n+1) + UDP

cellulose biosynthesis :
UDP-α-D-glucose + cellulose(n) = cellulose(n+1) + UDP

Not in pathways:
trans-zeatin + UDP-α-D-xylose = O-β-D-xylosylzeatin + UDP + H+
a dolichyl phosphate + UDP-N-acetyl-α-D-glucosamine = dolichyl N-acetyl-α-D-glucosaminyl phosphate + UDP
a β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP-N-acetyl-α-D-glucosamine = an N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosylceramide + UDP + H+
UDP-α-D-galactose + (1,6-β-D-galactosyl)n = (1,6-β-D-galactosyl)n+1 + UDP
UDP-α-D-galactose + β-D-galactosyl-1,4-N-acetyl-β-D-glucosamine = α-D-galactosyl-(1,3)-β-D-galactosyl-(1,4)-N-acetyl-D-glucosamine + UDP + H+
a dolichyl phosphate + UDP-α-D-xylose = dolichyl D-xylosyl phosphate + UDP
poly(ribitol phosphate) + UDP-N-acetyl-α-D-glucosamine = (N-acetyl-α-D-glucosaminyl)-poly(ribitol phosphate) + UDP + H+
estradiol-17-α-3-D-glucuronoside + UDP-N-acetyl-α-D-glucosamine = 17-α-(N-acetyl-α-D-glucosaminyl)estradiol 3-D-glucuronoside + UDP + H+
β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP-N-acetyl-α-D-glucosamine = N-acetyl-D-glucosaminyl-1,6-β-D-galactosyl-1,4-N-acetyl-β-D-glucosaminyl-1,3-β-D-galactosyl-1,4 β-D-glucosylceramide + UDP + H+
β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP-N-acetyl-α-D-glucosamine = N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-N-acetyl-β-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosyceramide + UDP + H+
α-D-mannosyl-(1→3)-α-D-mannosyl-(1→2)-α-D-mannosyl-(1→2)-D-mannose + UDP-N-acetyl-α-D-glucosamine = α-D-mannosyl-(1→3)-[(N-acetyl-α-D-glucosaminyl)-(1→2)]-α-D-mannosyl-(1→2)-α-D-mannosyl-(1→2)-D-mannose + UDP + H+
cyanidin-3-O-β-D-glucoside + UDP-L-rhamnose = UDP + cyanidin 3-O-rhamnosylglucoside + H+
octyl α-D-glucopyranoside + UDP-α-D-galactofuranose = octyl β-1,6-D-galactofuranosyl-α-D-glucopyranoside + UDP + H+
UDP-α-D-galactose + sucrose = UDP + loliose + H+
UDP-α-D-xylose + Glc-β-EGF-like domain = UDP + Xyl-α(1-3)-Glc-β-EGF-like domain
UDP-N-acetyl-D-galactosamine + β-D-glucuronosyl-(1->3)-β-D-galactosyl-(1->3)-β-D-galactosyl-(1->4)-β-D-xylosyl-[core protein] = α-N-acetyl-D-galactosaminyl-(1->4)-β-D-glucuronosyl-(1->3)-β-D-galactosyl-(1->3)-β-D-galactosyl-(1->4)-β-D-xylosyl-[core protein] + UDP + H+
N-acetyl-α-D-glucosaminide-[hyaluronan] + UDP-α-D-glucuronate = β-D-glucuronosyl-[hyaluronan] + UDP
UDP-N-acetyl-α-D-glucosamine + β-D-glucuronosyl-[hyaluronan] = N-acetyl-α-D-glucosaminide-[hyaluronan] + UDP
cyanidin-3-O-β-D-glucoside + UDP-α-D-glucuronate = cyanidin 3-O-β-(2-O-β-D-glucuronosyl)-β-D-glucoside + UDP + H+
UDP-N-acetyl-α-D-glucosamine + a fucosyl-protein = UDP + O-β-D-GlcNAc-fucosyl-protein
an N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosylceramide + UDP-α-D-galactose = β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP + H+
(N-acetyl-β-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R + UDP-N-acetyl-α-D-glucosamine = N-acetyl-β-D-glucosaminyl-1,4-(N-acetyl-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R + UDP + H+
N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-1,4-N-acetyl-β-D-glucosaminyl-R + UDP-N-acetyl-α-D-glucosamine = N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-(N-acetyl-β-D-glucosaminyl-1,4)-β-D-mannosyl-1,4-N-acetyl-β-D-glucosaminyl-R + UDP + H+
α-D-mannosyl-1,6-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3)-β-D-mannosyl-[glycoprotein] + UDP-N-acetyl-α-D-glucosamine = N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,6-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3)-β-D-mannosyl-[glycoprotein] + UDP + H+
UDP-N-acetyl-α-D-glucosamine + a [protein]-L-threonine = UDP + an N-acetyl-α-D-glucosaminyl-L-threonine-[glycoprotein] + H+
UDP-N-acetyl-α-D-glucosamine + a [protein]-L-serine = UDP + an N-acetyl-α-D-glucosaminyl-L-serine-[glycoprotein] + H+
UDP-N-acetyl-D-galactosamine + a glycoprotein-α-L-fucosyl-(1,2)-D-galactose = glycoprotein N-acetyl-α-D-galactosaminyl-(1,3)-[α-L-fucosyl-(1,2)]-D-galactose + UDP + H+
UDP-N-acetyl-α-D-glucosamine + a [protein]-trans-4-hydroxy-L-proline = a protein-O-(N-acetyl-D-glucosaminyl)-trans-4-hydroxy-L-proline + UDP + H+
UDP-α-D-galactose + an XXXG xylogulcan = an XLXG xylogulcan + UDP
UDP-α-D-galactose + an XLXG xylogulcan = an XLLG xylogulcan + UDP + H+
an L-1-phosphatidyl-inositol + UDP-N-acetyl-α-D-glucosamine = a 6-(N-acetyl-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol + UDP + H+
UDP-α-D-galactose + an N-glycan = a galactose-β-1,3-N-glycan + UDP
UDP-α-D-galactose + β-D-glucose = α-lactose + UDP + H+
UDP-α-D-galactose + N-acetyl-β-D-glucosamine = β-D-galactosyl-1,4-N-acetyl-β-D-glucosamine + UDP + H+
UDP-N-acetyl-α-D-glucosamine = poly-β-1,6-N-acetyl-D-glucosamine + UDP
a flavonol 3-O-glycoside + UDP-α-D-xylose = a flavonol 3-[β-D-xylosyl-(1->2)-β-D-glycoside] + UDP + H+
UDP-N-acetyl-α-D-glucosamine + O-mannopyranosyl-alpha-1,3-[O-mannopyranosyl-alpha-1,3-(O-mannopyranosyl-alpha-1,6)-O-mannopyranosyl-alpha-1,6]-O-mannopyranosyl-beta-1,4-N-acetyl-D-glucosamine = UDP + O-mannopyranosyl-alpha-1,3-O-mannopyranosyl-alpha-1,3-(O-mannopyranosyl-alpha-1,6)-[N-acetylglucosamine-beta-1,4-O-mannopyranosyl-alpha-1,6]-O-mannopyranosyl-beta-1,4-N-acetyl-D-glucosamine + H+
a lipopolysaccharide + UDP-N-acetyl-α-D-glucosamine = a N-acetyl-α-D-glucosaminyl-lipopolysaccharide + UDP
mycophenolate + UDP-α-D-glucuronate = mycophenolic acid O-acyl-glucuronide + UDP
mycophenolate + UDP-α-D-glucuronate = mycophenolic acid phenolic glucuronide + UDP + H+
2 UDP-α-D-galactofuranose + α-L-rhamnopyranosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-trans,octacis-decaprenol = 2 UDP + β-D-galactofuranosyl-(1→5)-β-D-galactofuranosyl-(1→4)-α-L-rhamnopyranosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-trans,octacis-decaprenol + 2 H+
UDP-α-D-galactose + sphingosine = psychosine + UDP + H+
UDP-α-D-galactose + a glycoprotein-α-L-fucosyl-(1,2)-D-galactose = UDP + a galactosyl-(1->3)-[α-L-fucosyl(1->2)]-D-galactosyl-R + H+
UDP-α-D-galactose + a 2-(2-hydroxyacyl)sphingosine = a 1-(β-D-galactosyl)-2-(2-hydroxyacyl)sphingosine + UDP + H+
UDP-α-D-galactose + a [procollagen]-5-hydroxy-L-lysine = a procollagen 5-(galactosyloxy)-L-lysine + UDP + H+
UDP-α-D-galactose + gangloside GM2 = ganglioside GM1a + UDP + H+
UDP-α-D-galactose + a glycosaminoglycan = a D-galactosylglycosaminoglycan + UDP + H+
an N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosylceramide + UDP-α-D-galactose = UDP + 1,3-β-D-galactosyl-N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-D-glucosylceramide + H+
UDP-α-D-galactose + sn-glycerol 3-phosphate = α-D-galactosyl-(1,1')-sn-glycerol 3-phosphate + UDP + H+
UDP-α-D-galactose + sn-glycerol 3-phosphate = 2-(α-D-galactosyl)-sn-glycerol 3-phosphate + UDP + H+
UDP-α-D-galactose + sucrose = 6F-α-D-galactosylsucrose + UDP + H+
UDP-α-D-galactose + β-D-galactosyl-1,4-β-D-glucosyl-R = β-D-galactosyl-1,3-β-D-galactosyl-1,4-β-D-glucosyl-R + UDP + H+
UDP-α-D-galactose + a β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide = an α-D-galactosyl-(1->4)-β-D-galactosyl-(1->4)-β-D-glucosylceramide + UDP + H+
a flavonol-3-O-D-glucoside + UDP-L-rhamnose = a flavonol 3-O-[β-L-rhamnosyl-(1->6)-β-D-glucoside] + UDP + H+
UDP-α-D-galactose + a lipopolysaccharide = a D-galactosyl-lipopolysaccharide + UDP + H+
a non-glucuronosylated glucuronoside acceptor + UDP-α-D-glucuronate = a glucuronosylated glucuronoside acceptor + UDP
UDP-L-rhamnose + a flavanone-7-O-β-D-glucoside = UDP + a flavanone 7-O-(β-L-rhamnosyl-(1,2)-β-D-glucoside + H+
UDP-N-acetyl-α-D-galactosamine + an α-D-galactosyl-(1->4)-β-D-galactosyl-(1->4)-β-D-glucosylceramide = an N-acetyl-β-D-galactosaminyl-(1,3)-α-D-galactosyl-(1,4)-β-D-galactosyl-(1,4)-β-D-glucosylceramide + UDP + H+
UDP-N-acetyl-α-D-galactosamine + an N-acetyl-β-D-galactosaminyl-(1,3)-α-D-galactosyl-(1,4)-β-D-galactosyl-(1,4)-β-D-glucosylceramide = galNAc-α1->3galNAc-β1->3gal-α1->4lacCer + UDP + H+
UDP-N-acetyl-α-D-galactosamine + a 1-O-[O-(N-acetyl-α-neuraminyl)-2,3-β-D-galactosyl-1,4-β-D-glucosyl]ceramide = gangloside GM2 + UDP + H+
UDP-N-acetyl-α-D-galactosamine + an α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide = an N-acetyl-β-D-galactosaminyl-(1→4)-[α-N-acetylneuraminyl-(2→3)]-β-D-galactosyl-(1→4)-?-D-glucosyl-(1↔1)-ceramide + UDP + H+
UDP-α-D-glucuronate + scutellarein = UDP + scutellarin + H+
2'-deoxyguanosine + UTP = dGMP + UDP + H+
2'-deoxyadenosine + UTP = dAMP + UDP + H+
2'-deoxycytidine + UTP = dCMP + UDP + H+
soyasapogenol A + UDP-α-D-glucuronate = soyasapogenol A 3-O-β-glucuronate + UDP + H+
soyasapogenol E + UDP-α-D-glucuronate = soyasapogenol E 3-O-β-glucuronate + UDP + H+
UDP-α-D-galactose + a D-glucosyl-N-acylsphingosine = a β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP + H+
an N-acetyl-β-D-glucosaminyl-(1-3)-β-D-galactosyl-(1-4)-β-D-glucosyl-(1↔1)-ceramide + UDP-α-D-galactose = a β-D-galactosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1-3)-β-D-galactosyl-1,4-β-D-glucosyl-(1↔1)-ceramide + UDP + H+
UDP-α-D-xylose + an anthocyanidin-3-O-β-D-glucoside = UDP + an anthocyanidin 3-O-β-D-sambubioside + H+
UDP-α-D-galactose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-galactosyl-(1→4)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-glucose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-glucosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-galactose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-galactosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-xylose + kaempferol = UDP + kaempferol 3-O-β-D-xyloside + H+
UDP-α-D-glucose + vancomycin aglycone = UDP + desvancoaminyl vancomycin + H+
O2-(α-D-mannosyl)-L-threonyl-[protein] + UDP-N-acetyl-α-D-glucosamine = O2-[N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosy]-L-threonyl-[protein] + UDP + H+
O2-[N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosy]-L-threonyl-[protein] + UDP-N-acetyl-α-D-galactosamine = O2-[N-acetyl-β-D-galactosaminyl-(1→3)-N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosyl]-L-threonyl-[protein] + UDP + H+
UDP-β-L-arabinofuranose + a [protein]-trans-4-hydroxy-L-proline = a protein-O-(β-L-arabinofuranose)-trans-4-hydroxy-L-proline + UDP + H+
tylosin + UDP-α-D-glucose = 2'-[O-(β-D-glucopyranosyl)]-tylosin + UDP + H+
UDP-α-D-xylose + N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine = UDP + N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}asparagine + H+
UDP-N-acetyl-α-D-galactosamine + an N-acetyl-β-D-glucosaminyl-R = N-acetyl-β-D-galactosaminyl-(1->4)-N-acetyl-β-D-glucosaminyl-[glycoprotein] + UDP + H+
UDP-α-D-galactose + an N-acylsphingosine = a D-galactosyl-N-acylsphingosine + UDP + H+
a [protein]-L-asparagine + UDP-N-acetyl-α-D-glucosamine = a [protein]-N4-(N-acetyl-β-D-glucosaminyl)-L-asparagine + UDP + H+
UDP-α-D-glucose + an N-acylsphingosine + H+ = a D-glucosyl-N-acylsphinganine + UDP
UDP-α-D-glucose + a procollagen 5-(galactosyloxy)-L-lysine = 1,2-D-glucosyl-5-D-(galactosyloxy)-L-lysine-[procollagen] + UDP + H+
UDP-α-D-glucose + an arylamine = N-D-glucosylarylamine + UDP + H+
an anthocyanidin + UDP-α-D-glucose = an anthocyanidin-3-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + β-glucosyl-hydroxymethylcytosine in DNA = UDP + β-D-glucosyl-β-D-glucosyl-hydroxymethylcytosine in DNA + H+
paromamine + UDP-α-D-glucose = 3''-deamino-3''-hydroxykanamycin C + UDP + H+
UDP-α-D-glucose + an anthocyanidin-3-O-β-D-glucoside = UDP + an anthocyanidin 3,5-di-O-β-D-glucoside + H+
UDP-α-D-glucose + an anthocyanidin-3-O-β-D-glucoside = UDP + an anthocyanidin 3-O-sophoroside + H+
UDP-α-D-glucose + an anthocyanidin 3-O-(4-coumaroyl-α-L-rhamnosyl-(1→6)-β-D-glucoside = an anthocyanidin 3-O-(4-coumaroyl-α-L-rhamnosyl-(1→6)-β-D-glucoside) 5-O-glucoside + UDP + H+
UDP-α-D-glucose + an anthocyanidin 3-O-β-D-sambubioside = an anthocyanidin 5-O-β-D-glucoside 3-O-β-D-sambubioside + UDP
zeaxanthin + 2 UDP-α-D-glucose = zeaxanthin bis(β-D-glucoside) + 2 UDP + 2 H+
2 UDP-α-D-glucose + delphinidin 3-O-(6''-O-malonyl)-β-glucoside = ternatin C5 + 2 UDP + 2 H+
UDP-α-D-glucose + an anthocyanidin = an anthocyanidin-3-O-β-D-glucoside + UDP
UDP-α-D-glucose + kaempferol-3-glucoside-7-rhamnoside = kaempferol-3-O-gentiobioside-7-O-rhamnoside + UDP + H+
UDP-α-D-glucose + cyanidin-3-O-rutinoside = UDP + cyanidin-3-O-rutinoside-5-O-β-D-glucoside + H+
UDP-α-D-glucose + an N6-alkylaminopurine = an N6-alkylaminopurine-7-β-D-glucoside + UDP + H+
an isoflavone + UDP-α-D-glucose = an isoflavone-7-O-β-D-glucoside + UDP
UDP-α-D-glucose + 13-hydroxydocosanoate = 13-β-D-glucosyloxydocosanoate + UDP + H+
UDP-α-D-glucose + a flavonol = UDP + a flavonol-3-O-β-D-glucoside + H+
UDP-α-D-glucose + a lipopolysaccharide = a D-glucosyl-lipopolysaccharide + UDP
UDP-α-D-glucose + a flavonol-3-O-β-D-glucoside = UDP + a flavonol 3-O β-D-glucosyl-(1->2)-β-D-glucoside + H+
a flavonol + UDP-α-D-glucose = a flavonol-7-O-β-D-glucosides + UDP + H+
UDP-α-D-glucose + a flavanone = a flavanone-7-O-β-D-glucoside + UDP
UDP-α-D-glucose + a flavonol 3-O β-D-glucosyl-(1->2)-β-D-glucoside = UDP + a flavonol 3-O-(β-D-glucosyl-(1->2)-β-D-glucosyl (1->2)-β-D-glucoside) + H+
UDP-α-D-glucose + 5-hydroxymethylcytosine in DNA = UDP + β-glucosyl-hydroxymethylcytosine in DNA + H+
UDP-α-D-glucose + 5-hydroxymethylcytosine in DNA = UDP + α-glucosyl-hydroxymethylcytosine in DNA + H+
UDP-α-D-glucose + a phenol = UDP + an aryl β-D-glucoside + H+
UDP-α-D-glucose + DIMBOA = DIMBOA-β-D-glucoside + UDP
UDP-α-D-glucose + a 1,2-diacyl-sn-glycerol = a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol + UDP + H+
UDP-α-D-glucose + (1,3-α-D-glucosyl)(n) = (1,3-α-D-glucosyl)(n+1) + UDP
UDP-α-D-glucose + solasodine = UDP + solasodine 3-O-β-D-glucopyranoside + H+
UDP-α-D-glucose + brassicasterol = UDP + 3-O-β-D-glucosyl-brassicasterol + H+
UDP-α-D-glucose + stigmasterol = UDP + stigmasterol 3-O-β-D-glucoside + H+
UDP-α-D-glucose + cholesterol = UDP + cholesteryl-β-D-glucoside + H+
UDP-α-D-glucose + sitosterol = UDP + 3-O-β-D-glucosyl-β-sitosterol + H+
UDP-α-D-glucose + a sterol = UDP + an O-glucosylsterol + H+
indole-3-butyrate + UDP-α-D-glucose = indole-3-butyryl-glucose + UDP
UDP-α-D-glucose + limonin + H2O = UDP + glucosyl-limonin + 2 H+
UDP-α-D-glucose + 6-hydroxyflavone = 6-O-β-D-glucosyl-6-hydroxyflavone + UDP + H+
UDP-α-D-glucose + 7-hydroxyflavone = 7-O-β-D-glucosyl-7-hydroxyflavone + UDP + H+
tetrahydrobiopterin + UDP-α-D-glucose = tetrahydrobiopterin-glucoside + UDP + H+
UDP-α-D-glucose + 4-aminobenzoate = p-aminobenzoate-β-D-glucopyranosyl ester + UDP
UDP-α-D-glucose + a hydroxyanthraquinone = UDP + a glucosyloxyanthraquinone
UDP-α-D-glucose + cis-p-coumarate = UDP + 4'-O-β-D-glucosyl-cis-p-coumarate + H+
UDP-α-D-glucose + benzene-1,4-diol = hydroquinone-O-β-D-glucopyranoside + UDP + H+
UDP-α-D-glucose + (20S,22S,25S)-22,25-epoxyfurost-5-ene-3-β,26-diol = (20S,22S,25S)-22,25-epoxyfurost-5-ene-3-β,26-diol 3-o-β-D-glucoside + UDP + H+
UDP-α-D-glucose + methylazoxymethanol = UDP + cycasin + H+
UDP-α-D-glucose + 13-β-D-glucosyloxydocosanoate = 13-[O(2')-β-D-glucopyranosyl-β-D-glucopyranosyloxy]docosanoate + UDP + H+
UDP-α-D-glucose + 4-coumarate = 4-O-β-D-glucosyl-4-hydroxycinnamate + UDP + H+
UDP-α-D-glucose + (-)-menthol = (-)-menthyl O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + poly(ribitol phosphate) = β-D-glucosylpoly (ribotol phosphate) + UDP + H+
UDP-α-D-glucose + (25S)-5-β-spirostan-3-β-ol = (25S)-5β-spirostan-3β-ol 3-O-β-D- glucoside + UDP + H+
UDP-α-D-glucose + 4-hydroxybenzoate = 4-(β-D-glucosyloxy)benzoate + UDP + H+
UDP-α-D-glucose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-glucosyl-(1→4)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-glucose + pyridoxine = 5'-O-β-D-glucosylpyridoxine + UDP + H+
UDP-α-D-glucose + alizarin = 1-hydroxy-2-(β-D-glucosyloxy)-9,10- anthraquinone + UDP + H+
UDP-α-D-glucose + a lipopolysaccharide = UDP + an α-D-glucosyl-lipopolysaccharide
UDP-α-D-glucose + gibberellin A3 + H+ = gibberellin 2-O-β-D-glucoside + UDP
UDP-α-D-glucose + 7-deoxyloganetin = UDP + 7-deoxyloganin + H+
loganetin + UDP-α-D-glucose = loganin + UDP + H+
UDP-α-D-glucose + an isoprenoid monophosphate = a polyprenylphosphate-glucose + UDP
cyanidin-3-O-β-D-glucoside + UDP-L-rhamnose = cyanidin-3-O-rutinoside + UDP + H+
UDP-α-D-glucose + a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol = a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl-(1->6)-β-D-glucopyranosyl)-sn-glycerol + UDP + H+
UDP-α-D-glucose + a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol = a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol + UDP + H+
UDP-α-D-glucose + a 1,2-diacyl-3-O-(α-D-glucopyranosyl)-sn-glycerol = a 1,2-diacyl-3-O-(α-D-glucopyranosyl(1->2)-O-α-D-glucopyranosyl)-sn-glycerol + UDP + H+
n UDP-α-D-glucose + poly (glycerol phosphate) = o-(α-D-glucosyl)-polyglycerol phosphate + n UDP + n H+
β-L-arabinose 1-phosphate + UDP + H+ = UDP-β-L-arabinopyranose + phosphate

Enzymes activated by UDP, sorted by the type of activation, are:

Activator (Allosteric) of: pyruvate kinase [Singh98]

Enzymes inhibited by UDP, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: UDP-N-acetylglucosamine: dolichyl diphosphate N-acetylglucosamine, N-acetylglucosamine transferase [Sharma82] , β-1,2-xylosyltransferase [Bencur05] , UDP-glucose:glycogenin 4-α-D-glucosyltransferase [Plesner74] , UDP-D-glucose:delphinidin-3,5-diglucoside -O-β-D-glucosyltransferase [FukuchiMizutani03] , UDP-D-glucose:delphinidin 3-O-glucosyl-5-O-caffeoylglucoside -O-β-D-glucosyltransferase [FukuchiMizutani03]

Inhibitor (Uncompetitive) of: luteolin-7-O-diglucuronide 4'-O-glucuronosyltransferase [Schulz88a] , luteolin-7-O-glucuronide 2''-O-glucuronosyltransferase [Schulz88a] , luteolin 7-O-glucuronosyltransferase [Schulz88a]

Inhibitor (Noncompetitive) of: UDPG:coniferyl alcohol glucosyltransferase [Schmid82]

Inhibitor (Allosteric) of: flavonol 3-O-glycoside glucosyltransferase [Jourdan82] , quercetin 3-O-diglucoside 2"-glucosyltransferase [Jourdan82] , flavonol 3-O-glucosyltransferase [Jourdan82] , flavonol 3-O-glucoside glucosyltransferase [Jourdan82] , quercetin 3-O-glucoside 2"-glucosyltransferase [Jourdan82] , quercetin 3-O-glucosyltransferase [Jourdan82] , kaempferol 3-O-glucosyltransferase [Owens] , quercetin 3-O-glucosyltransferase [Owens] , myricetin 3-O-glucosyltransferase [Owens]

Inhibitor (Mechanism unknown) of: UDP-N-acetylmuramoylalanyl-D-glutamate 2,6-diaminopimelate ligase [AboGhalia85] , UDP-glucose 4,6-dehydratase [Martinez12] , UDP-glucuronate 4-epimerase [Munoz99] , oleanolate UDP-glucuronosyltransferase [Wojciechowski75] , sucrose synthase [morellM85] , UDP-glucuronate decarboxylase [Pattathil05] , UDP-glucose:indole-3-acetate b-D-glucosyltransferase [Leznicki88a] , UDP-D-glucose/UDP-D-galactose 4-epimerase [Barber06a] , UDP-glucose:hesperitin-7-O-β-D-glucosyltransferase [Durren99] , UDP-D-glucuronic acid 4-epimerase [Gu04] , UDP-N-acetylglucosamine-dolichyl-phosphate N-acetylglocosaminephosphotransferase [Sharma82] , UDP-D-xylose synthase [Baron72] , UDP-D-apiose synthase [Baron72, Beam77] , UDP-D-apiose synthase [Molhoj03] , UDP-D-xylose synthase [Molhoj03] , UDP-L-rhamnose: naringenin 7-O-β-D-glucoside-2''-O-β-L-rhamnosyltransferase [BarPeled91] , UDP-glucose:naringenin 7-O-β-D-glucosyltransferase [Durren99] , UDP-α-D-glucose:glycogenin α-D-glucosyltransferase [Cao93a] , UDP-α-D-glucose:glucosyl-glycogenin α-D-glucosyltransferase [Cao93a]


References

AboGhalia85: Abo-Ghalia M, Michaud C, Blanot D, van Heijenoort J (1985). "Specificity of the uridine-diphosphate-N-acetylmuramyl-L-alanyl-D-glutamate: meso-2,6-diaminopimelate synthetase from Escherichia coli." Eur J Biochem 1985;153(1);81-7. PMID: 3905407

Barber06a: Barber C, Rosti J, Rawat A, Findlay K, Roberts K, Seifert GJ (2006). "Distinct properties of the five UDP-D-glucose/UDP-D-galactose 4-epimerase isoforms of arabidopsis thaliana." J Biol Chem. PMID: 16644739

Baron72: Baron D, Wellmann E, Grisebach H (1972). "Purification and properties of an enzyme from cell suspension cultures of parsley catalyzing the synthesis of UDP-apiose and UDP-D-xylose from UDP-D-glucuronic acid." Biochim Biophys Acta 258(1);310-8. PMID: 4333589

BarPeled91: Bar-Peled M, Lewinsohn E, Fluhr R, Gressel J (1991). "UDP-rhamnose:flavanone-7-O-glucoside-2''-O-rhamnosyltransferase. Purification and characterization of an enzyme catalyzing the production of bitter compounds in citrus." J Biol Chem 266(31);20953-9. PMID: 1939145

Beam77: Beam KG, Nestler EJ, Greengard P (1977). "Increased cyclic GMP levels associated with contraction in muscle fibres of the giant barnacle." Nature 267(5611);534-6. PMID: 195221

Bencur05: Bencur P, Steinkellner H, Svoboda B, Mucha J, Strasser R, Kolarich D, Hann S, Kollensperger G, Glossl J, Altmann F, Mach L (2005). "Arabidopsis thaliana beta1,2-xylosyltransferase: an unusual glycosyltransferase with the potential to act at multiple stages of the plant N-glycosylation pathway." Biochem J 388(Pt 2);515-25. PMID: 15686448

Cao93a: Cao Y, Mahrenholz AM, DePaoli-Roach AA, Roach PJ (1993). "Characterization of rabbit skeletal muscle glycogenin. Tyrosine 194 is essential for function." J Biol Chem 268(20);14687-93. PMID: 8325847

Durren99: Durren RL, McIntosh CA (1999). "Flavanone-7-O-glucosyltransferase activity from Petunia hybrida.." Phytochemistry 52(5);793-8. PMID: 10626374

FukuchiMizutani03: Fukuchi-Mizutani M, Okuhara H, Fukui Y, Nakao M, Katsumoto Y, Yonekura-Sakakibara K, Kusumi T, Hase T, Tanaka Y (2003). "Biochemical and molecular characterization of a novel UDP-glucose:anthocyanin 3'-O-glucosyltransferase, a key enzyme for blue anthocyanin biosynthesis, from gentian." Plant Physiol 132(3);1652-63. PMID: 12857844

Gu04: Gu X, Bar-Peled M (2004). "The biosynthesis of UDP-galacturonic acid in plants. Functional cloning and characterization of Arabidopsis UDP-D-glucuronic acid 4-epimerase." Plant Physiol 136(4);4256-64. PMID: 15563616

Jourdan82: Jourdan PS, Mansell RL (1982). "Isolation and partial characterization of three glucosyl transferases involved in the biosynthesis of flavonol triglucosides in Pisum sativum L." Arch Biochem Biophys 213(2);434-43. PMID: 6462109

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Leznicki88a: Leznicki AJ, Bandurski RS (1988). "Enzymic synthesis of indole-3-acetyl-1-O-beta-d-glucose. II. Metabolic characteristics of the enzyme." Plant Physiol 88;1481-5. PMID: 11537439

Martinez12: Martinez V, Ingwers M, Smith J, Glushka J, Yang T, Bar-Peled M (2012). "Biosynthesis of UDP-4-keto-6-deoxyglucose and UDP-rhamnose in pathogenic fungi Magnaporthe grisea and Botryotinia fuckeliana." J Biol Chem 287(2);879-92. PMID: 22102281

Molhoj03: Molhoj M, Verma R, Reiter WD (2003). "The biosynthesis of the branched-chain sugar d-apiose in plants: functional cloning and characterization of a UDP-d-apiose/UDP-d-xylose synthase from Arabidopsis." Plant J 35(6);693-703. PMID: 12969423

morellM85: morell M., Copeland L. "Sucrose synthase of Soybean nodules." Plant Physiol. (1985) 78:149-154.

Munoz99: Munoz R, Lopez R, de Frutos M, Garcia E (1999). "First molecular characterization of a uridine diphosphate galacturonate 4-epimerase: an enzyme required for capsular biosynthesis in Streptococcus pneumoniae type 1." Mol Microbiol 31(2);703-13. PMID: 10027985

Owens: Owens DK, McIntosh CA "Identification, recombinant expression, and biochemical characterization of a flavonol 3-O-glucosyltransferase clone from Citrus paradisi." Phytochemistry 70(11-12);1382-91. PMID: 19733370

Pattathil05: Pattathil S, Harper AD, Bar-Peled M (2005). "Biosynthesis of UDP-xylose: characterization of membrane-bound AtUxs2." Planta 221(4);538-48. PMID: 15655675

Plesner74: Plesner L, Plesner IW, Esmann V (1974). "Kinetic mechanism of glycogen synthase D from human polymorphonuclear leukocytes." J Biol Chem 249(4);1119-25. PMID: 4205314

Schmid82: Schmid G, Grisebach H (1982). "Enzymic synthesis of lignin precursors. Purification and properties of UDP glucose: coniferyl-alcohol glucosyltransferase from cambial sap of spruce (Picea abies L.)." Eur J Biochem 123(2);363-70. PMID: 6210530

Schulz88a: Schulz, M, Weissenböck, G (1988). "Three specific UDP-glucuronate-flavone-glucuronosyl-transferases from primary leaves of Secale cereale." Phytochemistry 27:1261-1267.

Sharma82: Sharma CB, Lehle L, Tanner W (1982). "Solubilization and characterization of the initial enzymes of the dolichol pathway from yeast." Eur J Biochem 126(2);319-25. PMID: 6215245

Singh98: Singh DK, Malhotra SP, Singh R (1998). "Purification and characterizaton of plastidic pyruvate kinase from developing seeds of Brassica campestris L." Indian J Biochem Biophys 35(6);346-52. PMID: 10412228

Wojciechowski75: Wojciechowski, ZdzisImageaw A. (1975). "Biosynthesis of oleanolic acid glycosides by subcellular fractions of Calendula officinalis seedlings." Phytochemistry. 14:1749-1753.


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Mon Dec 22, 2014, biocyc14.