Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015

MetaCyc Compound: UDP

Synonyms: uridine-diphosphate, uridine-5'-diphosphate

Superclasses: a nucleic acid component a nucleotide a nucleoside diphosphate a ribonucleoside diphosphate a pyrimidine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a pyrimidine nucleotide a pyrimidine ribonucleotide a pyrimidine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a pyrimidine ribonucleotide a pyrimidine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a ribonucleoside diphosphate a pyrimidine ribonucleoside 5'-diphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a diazine a pyrimidine a pyrimidine nucleotide a pyrimidine ribonucleotide a pyrimidine ribonucleoside 5'-diphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a diazine a pyrimidine

Chemical Formula: C9H11N2O12P2

Molecular Weight: 401.14 Daltons

Monoisotopic Molecular Weight: 404.002196945 Daltons

SMILES: C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))

InChI: InChI=1S/C9H14N2O12P2/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18)/p-3/t4-,6-,7-,8-/m1/s1


Unification Links: CAS:58-98-0 , ChEBI:58223 , ChemSpider:16739715 , HMDB:HMDB00295 , IAF1260:33518 , KEGG:C00015 , KNApSAcK:C00007313 , MetaboLights:MTBLC58223 , PubChem:20056717

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -504.6063 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

pyrimidine deoxyribonucleotides de novo biosynthesis I , pyrimidine deoxyribonucleotides de novo biosynthesis III :
dUDP + an oxidized thioredoxin + H2O ← UDP + a reduced thioredoxin

superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli) :
dUDP + an oxidized thioredoxin + H2O ← UDP + a reduced thioredoxin
dUDP + an oxidized NrdH glutaredoxin-like protein + H2O ← UDP + a reduced NrdH glutaredoxin-like protein

UTP and CTP de novo biosynthesis :

UTP and CTP dephosphorylation I :
UDP + H2O → UMP + phosphate + H+

Not in pathways:
a pyrimidine ribonucleotide + H2O → D-ribose 5-phosphate + a pyrimidine base

a 2'-deoxyribonucleoside 5'-diphosphate + an oxidized thioredoxin + H2O ← a ribonucleoside diphosphate + a reduced thioredoxin

ribonucleotiden + ribonucleotiden + ATP → ribonucleotidem+n + AMP + diphosphate

a nucleoside diphosphate + ATP → a nucleoside triphosphate + ADP

a nucleotide + H2O → a nucleoside + phosphate

Reactions known to produce the compound:

(+)-secoisolariciresinol diglucoside biosynthesis :
(+)-secoisolariciresinol + UDP-α-D-glucose → (+)-secoisolariciresinol monoglucoside + UDP + H+
(+)-secoisolariciresinol monoglucoside + UDP-α-D-glucose → (+)-secoisolariciresinol diglucoside + UDP + H+

2,4,6-trinitrotoluene degradation :
UDP-α-D-glucose + 4-hydroxylamino-2,6-dinitrotoluene → 4-hydroxylamino-2,6-dinitrotoluene-O-glucoside + UDP + H+
UDP-α-D-glucose + 2-hydroxylamino-4,6-dinitrotoluene → 2-hydroxylamino-4,6-dinitrotoluene-C3-glucoside + UDP + H+
UDP-α-D-glucose + 2-amino-4,6-dinitrotoluene → 2-amino-4,6-dinitrotoluene glucoside + UDP + 2 H+
UDP-α-D-glucose + 2-hydroxylamino-4,6-dinitrotoluene → 2-hydroxylamino-4,6-dinitrotoluene-O-glucoside + UDP + H+
UDP-α-D-glucose + 4-amino-2,6-dinitrotoluene → 4-amino-2,6-dinitrotoluene glucoside + UDP + 2 H+
UDP-α-D-glucose + 4-hydroxylamino-2,6-dinitrotoluene → 4-hydroxylamino-2,6-dinitrotoluene 3C-glucoside + UDP + H2O

3,4-dihydroxymandelonitrile β-D-glucose biosynthesis :
(R)-3,4-dihydroxymandelonitrile + UDP-α-D-glucose → 3,4-dihydroxymandelonitrile β-D-glucoside + UDP + H+

6'-deoxychalcone metabolism :
UDP-α-D-glucose + butein → butein 4'-β-D-glucoside + UDP + H+
UDP-α-D-glucose + isoliquiritigenin → isoliquiritigenin 4'-glucoside + UDP + H+

A series fagopyritols biosynthesis :
UDP-α-D-galactose + 1D-chiro-inositol → fagopyritol A1 + UDP + H+

abscisic acid glucose ester biosynthesis :
UDP-α-D-glucose + 2-cis-abscisate → β-D-glucopyranosyl abscisate + UDP

acetan biosynthesis :
UDP-α-D-glucuronate + α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol → UDP + β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + H+
α-D-glucosyl-(1,2)-β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP-α-D-glucose → β-D-glucosyl-(1,6)-α-D-glucosyl-(1,2)-β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP + H+
β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP-α-D-glucose → α-D-glucosyl-(1,2)-β-D-glucuronate-(1,2)-α-D-mannosyl-(1,3)-β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP + H+
α-D-glucopyranosyl-diphosphoundecaprenol + UDP-α-D-glucose → β-D-glucosyl-(1,4)-α-D-glucosyl-diphosphoundecaprenol + UDP + H+

acylated cyanidin galactoside biosynthesis :
cyanidin + UDP-α-D-galactose → cyanidin-3-O-β-D-galactoside + UDP
UDP-α-D-xylose + cyanidin-3-O-β-D-galactoside → UDP + cyanidin 3-O-(β-D-xylosyl-(1→2)-β-D-galactoside) + H+
cyanidin 3-O-(β-D-xylosyl-(1→2)-β-D-galactoside) + UDP-α-D-glucose → cyanidin 3-O-(6-O-β-D-glucosyl-2-O-β-D-xylosyl-β-D-galactoside) + UDP + H+

afrormosin conjugates interconversion :
UDP-α-D-glucose + afrormosin → afrormosin-7-O-glucoside + UDP + H+

ajmaline and sarpagine biosynthesis :
UDP-α-D-glucose + vomilenine → raucaffricine + UDP + H+

amaranthin biosynthesis :
cyclo-dopa 5-O-glucoside + UDP-α-D-glucuronate → cyclo-dopa glucuronylglucoside + UDP + H+

anthocyanidin modification (Arabidopsis) :
cyanidin + UDP-α-D-glucose → cyanidin-3-O-β-D-glucoside + UDP
cyanidin-3-O-β-D-glucoside + UDP-α-D-xylose → cyanidin 3-O-[2"-O-(xylosyl) glucoside + UDP
cyanidin 3-O-p-coumaroylglucoside + UDP-α-D-xylose → cyanidin 3-O-[2"-O-xylosyl) 6"-O-(p-coumaroyl) glucoside + UDP + H+
cyanidin 3-O-[2"-O-xylosyl) 6"-O-(p-coumaroyl) glucoside + UDP-α-D-glucose → cyanidin 3-O-[2"-O-(xylosyl)-6"-O-(p-coumaroyl) glucoside] 5-O-glucoside + UDP + H+

anthocyanidin sophoroside metabolism :
UDP-α-D-glucose + cyanidin-3-O-β-D-glucoside → cyanidin 3-O-sophoroside + UDP + H+
UDP-α-D-glucose + delphinidin-3-O-β-D-glucoside → delphinidin 3-O-sophoroside + UDP + H+
UDP-α-D-glucose + pelargonidin-3-O-β-D-glucoside → pelargonidin 3-O-sophoroside + UDP + H+

anthocyanin biosynthesis (cyanidin 3-O-glucoside) :
cyanidin + UDP-α-D-glucose → cyanidin-3-O-β-D-glucoside + UDP

anthocyanin biosynthesis (delphinidin 3-O-glucoside) :
UDP-α-D-glucose + delphinidin → UDP + delphinidin-3-O-β-D-glucoside

anthocyanin biosynthesis (pelargonidin 3-O-glucoside) :
UDP-α-D-glucose + pelargonidin → UDP + pelargonidin-3-O-β-D-glucoside

apigenin glycosides biosynthesis :
apigenin 7-O-β-D-glucoside + UDP-D-apiose → apigenin 7-O-[β-D-apiosyl-(1→2)-β-D-glucoside] + UDP + H+
apigenin 7-O-β-D-glucoside + UDP-L-rhamnose → apigenin 7-O-neohesperidoside + UDP + H+
UDP-α-D-glucose + apigenin → UDP + apigenin 7-O-β-D-glucoside
apigenin 7-O-β-D-glucoside + UDP-α-D-glucose → apigenin-7-O-gentiobioside + UDP + H+

apigeninidin 5-O-glucoside biosynthesis :
apigeninidin + UDP-α-D-glucose → apigeninidin 5-O-glucoside + UDP + H+

aurone biosynthesis :
UDP-α-D-glucose + 2',4,4',6'-tetrahydroxychalcone → UDP + 2',4,4',6'-tetrahydroxychalcone 4'-O-β-D-glucoside + H+
UDP-α-D-glucose + 2',3,4,4',6'-pentahydroxychalcone → 2',3,4,4',6'-pentahydroxychalcone 4'-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + sulfuretin → sulfuretin 6-glucoside + UDP + H+
UDP-α-D-glucose + butein → butein 4'-β-D-glucoside + UDP + H+

avenacin A-1 biosynthesis :
monodeglucosyl des-acyl avenacin A + UDP-α-D-glucose → des-acyl avenacin A + UDP + H+

B series fagopyritols biosynthesis :
UDP-α-D-galactose + 1D-chiro-inositol → fagopyritol B1 + UDP + H+

bacillithiol biosynthesis :
UDP-N-acetyl-α-D-glucosamine + (S)-malate → malyl-N-acetyl-D-glucosamine + UDP + H+

baicalein metabolism :
UDP-α-D-glucuronate + baicalein → UDP + baicalin + H+
baicalein + UDP-α-D-glucose → baicalein 7-O-β-D-glucoside + UDP + H+

benzoyl-β-D-glucopyranose biosynthesis :
benzoate + UDP-α-D-glucose → benzoyl-β-D-glucopyranose + UDP

β-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosamine biosynthesis :
UDP-α-D-galactose + N-acetyl-α-D-galactosaminyl-diphospho-ditrans,octacis-undecaprenol → β-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+

betacyanin biosynthesis :
UDP-α-D-glucose + leucodopachrome → cyclo-dopa 5-O-glucoside + UDP + H+
UDP-α-D-glucose + betanidin → gomphrenin I + UDP + H+
UDP-α-D-glucose + betanidin → betanin + UDP + H+

biochanin A conjugates interconversion :
UDP-α-D-glucose + biochanin-A → biochanin A-7-O-glucoside + UDP

brassinosteroids inactivation :
castasterone + UDP-α-D-glucose → castasterone-23-O-glucoside + UDP + H+
brassinolide + UDP-α-D-glucose → brassinolide-23-O-glucoside + UDP + H+

C-glycosylflavone biosynthesis I :
naringenin dibenzoylmethane tautomer + UDP-α-D-glucose → 6C-glucosyl-2-hydroxynaringenin + UDP + H+
naringenin dibenzoylmethane tautomer + UDP-α-D-glucose → 8C-glucosyl-2-hydroxynaringenin + UDP + 2 H+

C-glycosylflavone biosynthesis II :
eriodictyol dibenzoylmethane tautomer + UDP-α-D-glucose → 6C-β-D-glucosyl-2-hydroxyeriodictyol + UDP + H+
eriodictyol dibenzoylmethane tautomer + UDP-α-D-glucose → 8C-β-D-glucosyl-2-hydroxyeriodictyol + UDP + H+

C-glycosylflavone biosynthesis III :
2,5,7-trihydroxyflavanone dibenzoylmethane tautomer + UDP-α-D-glucose → 6C-glucosyl-2,5,7-trihydroxyflavanone + UDP + H+
2,5,7-trihydroxyflavanone dibenzoylmethane tautomer + UDP-α-D-glucose → 8C-glucosyl-2,5,7-trihydroxyflavanone + UDP + 2 H+

cardenolide glucosides biosynthesis :
digitoxigenin + UDP-fucose → digitoxigenin 3-O-β-D-quinovoside + UDP + H+
digitoxigenin + UDP-fucose → digiproside + UDP + H+
UDP-α-D-glucose + digiproside → glucodigifucoside + UDP + H+
UDP-α-D-glucose + digitoxigenin → 3-O-β-D-glucoside digitoxigenin + UDP + H+

chalcone 2'-O-glucoside biosynthesis :
UDP-α-D-glucose + 2',4,4',6'-tetrahydroxychalcone → chalcone 2'-O-glucoside + UDP + H+

chitin biosynthesis :
UDP-N-acetyl-α-D-glucosamine + [1,4-(N-acetyl-β-D-glucosaminyl)]nUDP + [1,4-(N-acetyl-β-D-glucosaminyl)]n+1

chondroitin and dermatan biosynthesis :
UDP-N-acetyl-D-galactosamine + D-glucuronyl-1,3-β-D-galactosylproteoglycan → N-acetyl-D-galactosaminyl-1,4-β-D-glucuronyl-1,3-β-D-galactosyl-[proteoglycan] + UDP + H+
N-acetyl-β-D-galactosaminide-[chondroitin/dermatan] + UDP-α-D-glucuronate → β-D-glucuronosyl-[chondroitin/dermatan] + UDP
UDP-N-acetyl-α-D-galactosamine + β-D-glucuronosyl-[chondroitin/dermatan] → N-acetyl-β-D-galactosaminide-[chondroitin/dermatan] + UDP + H+

chondroitin sulfate biosynthesis (late stages) :
UDP-N-acetyl-α-D-galactosamine + β-D-glucuronosyl-[chondroitin/dermatan] → N-acetyl-β-D-galactosaminide-[chondroitin/dermatan] + UDP + H+

cichoriin interconversion :
esculetin + UDP-α-D-glucose → cichoriin + UDP + H+

cinnamate esters biosynthesis :
UDP-α-D-glucose + trans-cinnamate → UDP + trans-cinnamoyl-β-D-glucoside

CMP-legionaminate biosynthesis II :
UDP-N,N'-diacetylbacillosamine + H2O → 2,4-diacetamido-2,4,6-trideoxy-α-D-mannopyranose + UDP + H+

CMP-N-acetyl-7-O-acetylneuraminate biosynthesis :
4-O-acetyl-UDP-N-acetylglucosamine + H2O → 4-O-acetyl-N-acetylmannosamine + UDP + H+

CMP-N-acetylneuraminate biosynthesis I (eukaryotes) , CMP-N-acetylneuraminate biosynthesis II (bacteria) :
UDP-N-acetyl-α-D-glucosamine + H2O → N-acetyl-α-D-mannosamine + UDP + H+

CMP-pseudaminate biosynthesis :
UDP-2,4-diacetamido-2,4,6-trideoxy-β-L-altropyranose + H2O → 2,4-diacetamido-2,4,6-trideoxy-β-L-altropyranose + UDP + H+

coniferin metabolism :
UDP-α-D-glucose + coniferyl alcohol → coniferin + UDP + H+

coumarin biosynthesis (via 2-coumarate) :
UDP-α-D-glucose + 2-coumarate → trans-β-D-glucosyl-2-hydroxycinnamate + UDP + H+

crocetin biosynthesis :
UDP-α-D-glucose + (3S)-3-hydroxycyclocitral → picrocrocin + UDP + H+

crocetin esters biosynthesis :
UDP-α-D-glucose + β-D-gentiobiosyl crocetin → β-D-gentiobiosyl β-D-glucosyl crocetin + UDP
UDP-α-D-glucose + β-D-glucosyl crocetin → bis(β-D-glucosyl) crocetin + UDP
UDP-α-D-glucose + crocetin → β-D-glucosyl crocetin + UDP
UDP-α-D-glucose + β-D-glucosyl crocetin → β-D-gentiobiosyl crocetin + UDP + H+
UDP-α-D-glucose + bis(β-D-glucosyl) crocetin → β-D-gentiobiosyl β-D-glucosyl crocetin + UDP + H+
UDP-α-D-glucose + β-D-gentiobiosyl β-D-glucosyl crocetin → crocin + UDP + H+

curcumin glucoside biosynthesis :
curcumin 4'-O-β-D-gentiotrioside + UDP-α-D-glucose → curcumin 4'-O-β-D-gentiotetraside + UDP + H+
curcumin 4'-O-β-D-gentiobioside + UDP-α-D-glucose → curcumin 4'-O-β-D-gentiotrioside + UDP + H+
UDP-α-D-glucose + curcumin → curcumin monoglucoside + UDP + H+
UDP-α-D-glucose + curcumin 4'-O-β-D-gentiobiosyl 4''-O-β-D-glucoside → curcumin 4',4''-O-β-D-digentiobioside + UDP + H+
UDP-α-D-glucose + curcumin 4'-O-β-D-gentiobioside → curcumin 4'-O-β-D-gentiobiosyl 4''-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + curcumin diglucoside → curcumin 4'-O-β-D-gentiobiosyl 4''-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + curcumin monoglucoside → curcumin 4'-O-β-D-gentiobioside + UDP + H+
UDP-α-D-glucose + curcumin monoglucoside → curcumin diglucoside + UDP + H+

cytokinin-O-glucosides biosynthesis :
UDP-α-D-glucose + cis-zeatin → cis-zeatin-O-glucoside + UDP + H+
UDP-α-D-glucose + dihydrozeatin-9-N-glucoside → dihydrozeatin-9-N-glucoside-O-glucoside + UDP + H+
UDP-α-D-glucose + dihydrozeatin → dihydrozeatin-O-glucoside + UDP + H+
UDP-α-D-glucose + trans-zeatin → trans-zeatin-O-glucoside + UDP + H+

cytokinins 7-N-glucoside biosynthesis :
UDP-α-D-glucose + cis-zeatin → cis-zeatin-7-N-glucoside + UDP + H+
UDP-α-D-glucose + trans-zeatin-O-glucoside → trans-zeatin-O-glucoside-7-N-glucoside + UDP + H+
UDP-α-D-glucose + kinetin → kinetin-7-N-glucoside + UDP + H+
UDP-α-D-glucose + benzyladenine → benzyladenine-7-N-glucoside + UDP + H+
UDP-α-D-glucose + N6-dimethylallyladenine → isopentenyladenine-7-N-glucoside + UDP + H+
UDP-α-D-glucose + dihydrozeatin → dihydrozeatin-7-N-glucose + UDP + H+
UDP-α-D-glucose + trans-zeatin → trans-zeatin-7-N-glucoside + UDP + H+

Reactions known to both consume and produce the compound:

dhurrin biosynthesis :
UDP-α-D-glucose + (S)-4-hydroxymandelonitrile ↔ UDP + dhurrin + H+

kaempferol diglycoside biosynthesis (pollen-specific) :
UDP-α-D-galactose + kaempferol ↔ UDP + kaempferol 3-O-β-D-galactoside + H+

N-glucosylnicotinate metabolism :
UDP-α-D-glucose + nicotinate + H+ ↔ N-glucosylnicotinate + UDP

peptidoglycan biosynthesis I (meso-diaminopimelate containing) :
undecaprenyldiphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + UDP-N-acetyl-α-D-glucosamine ↔ ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetylglucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + UDP + H+

quercetin diglycoside biosynthesis (pollen-specific) :
quercetin + UDP-α-D-galactose ↔ quercetin 3-galactoside + UDP + H+

sucrose degradation II (sucrose synthase) :
UDP-α-D-glucose + β-D-fructofuranose ↔ sucrose + UDP + H+

trehalose biosynthesis VI :
an NDP-α-D-glucose + D-glucopyranose ↔ α,α-trehalose + a nucleoside diphosphate + H+

Not in pathways:
(ribonucleotides)(n) + phosphate ↔ (ribonucleotides)(n-1) + a nucleoside diphosphate

In Reactions of unknown directionality:

callose biosynthesis :
UDP-α-D-glucose + 1,3-β-D-glucan(n) = 1,3-β-D-glucan(n+1) + UDP

cellulose biosynthesis :
UDP-α-D-glucose + cellulose(n) = cellulose(n+1) + UDP

Not in pathways:
trans-zeatin + UDP-α-D-xylose = O-β-D-xylosylzeatin + UDP + H+
a dolichyl phosphate + UDP-N-acetyl-α-D-glucosamine = dolichyl N-acetyl-α-D-glucosaminyl phosphate + UDP
a β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP-N-acetyl-α-D-glucosamine = an N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosylceramide + UDP + H+
UDP-α-D-galactose + (1,6-β-D-galactosyl)n = (1,6-β-D-galactosyl)n+1 + UDP
UDP-α-D-galactose + β-D-galactosyl-1,4-N-acetyl-β-D-glucosamine = α-D-galactosyl-(1,3)-β-D-galactosyl-(1,4)-N-acetyl-D-glucosamine + UDP + H+
a dolichyl phosphate + UDP-α-D-xylose = dolichyl D-xylosyl phosphate + UDP
poly(ribitol phosphate) + UDP-N-acetyl-α-D-glucosamine = (N-acetyl-α-D-glucosaminyl)-poly(ribitol phosphate) + UDP + H+
estradiol-17-α-3-D-glucuronoside + UDP-N-acetyl-α-D-glucosamine = 17-α-(N-acetyl-α-D-glucosaminyl)estradiol 3-D-glucuronoside + UDP + H+
β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP-N-acetyl-α-D-glucosamine = N-acetyl-D-glucosaminyl-1,6-β-D-galactosyl-1,4-N-acetyl-β-D-glucosaminyl-1,3-β-D-galactosyl-1,4 β-D-glucosylceramide + UDP + H+
β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP-N-acetyl-α-D-glucosamine = N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-N-acetyl-β-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosyceramide + UDP + H+
α-D-mannosyl-(1→3)-α-D-mannosyl-(1→2)-α-D-mannosyl-(1→2)-D-mannose + UDP-N-acetyl-α-D-glucosamine = α-D-mannosyl-(1→3)-[(N-acetyl-α-D-glucosaminyl)-(1→2)]-α-D-mannosyl-(1→2)-α-D-mannosyl-(1→2)-D-mannose + UDP + H+
cyanidin-3-O-β-D-glucoside + UDP-L-rhamnose = UDP + cyanidin 3-O-rhamnosylglucoside + H+
octyl α-D-glucopyranoside + UDP-α-D-galactofuranose = octyl β-1,6-D-galactofuranosyl-α-D-glucopyranoside + UDP + H+
UDP-α-D-galactose + sucrose = UDP + loliose + H+
UDP-α-D-xylose + Glc-β-EGF-like domain = UDP + Xyl-α(1-3)-Glc-β-EGF-like domain
UDP-N-acetyl-D-galactosamine + β-D-glucuronosyl-(1->3)-β-D-galactosyl-(1->3)-β-D-galactosyl-(1->4)-β-D-xylosyl-[core protein] = α-N-acetyl-D-galactosaminyl-(1->4)-β-D-glucuronosyl-(1->3)-β-D-galactosyl-(1->3)-β-D-galactosyl-(1->4)-β-D-xylosyl-[core protein] + UDP + H+
N-acetyl-α-D-glucosaminide-[hyaluronan] + UDP-α-D-glucuronate = β-D-glucuronosyl-[hyaluronan] + UDP
UDP-N-acetyl-α-D-glucosamine + β-D-glucuronosyl-[hyaluronan] = N-acetyl-α-D-glucosaminide-[hyaluronan] + UDP
cyanidin-3-O-β-D-glucoside + UDP-α-D-glucuronate = cyanidin 3-O-β-(2-O-β-D-glucuronosyl)-β-D-glucoside + UDP + H+
UDP-N-acetyl-α-D-glucosamine + a fucosyl-protein = UDP + O-β-D-GlcNAc-fucosyl-protein
an N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosylceramide + UDP-α-D-galactose = β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP + H+
(N-acetyl-β-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R + UDP-N-acetyl-α-D-glucosamine = N-acetyl-β-D-glucosaminyl-1,4-(N-acetyl-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R + UDP + H+
N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-1,4-N-acetyl-β-D-glucosaminyl-R + UDP-N-acetyl-α-D-glucosamine = N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-(N-acetyl-β-D-glucosaminyl-1,4)-β-D-mannosyl-1,4-N-acetyl-β-D-glucosaminyl-R + UDP + H+
α-D-mannosyl-1,6-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3)-β-D-mannosyl-[glycoprotein] + UDP-N-acetyl-α-D-glucosamine = N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,6-(N-acetyl-β-D-glucosaminyl-1,2-α-D-mannosyl-1,3)-β-D-mannosyl-[glycoprotein] + UDP + H+
UDP-N-acetyl-α-D-glucosamine + a [protein]-L-threonine = UDP + an N-acetyl-α-D-glucosaminyl-L-threonine-[glycoprotein] + H+
UDP-N-acetyl-α-D-glucosamine + a [protein]-L-serine = UDP + an N-acetyl-α-D-glucosaminyl-L-serine-[glycoprotein] + H+
UDP-N-acetyl-D-galactosamine + a glycoprotein-α-L-fucosyl-(1,2)-D-galactose = glycoprotein N-acetyl-α-D-galactosaminyl-(1,3)-[α-L-fucosyl-(1,2)]-D-galactose + UDP + H+
UDP-N-acetyl-α-D-glucosamine + a [protein]-trans-4-hydroxy-L-proline = a protein-O-(N-acetyl-D-glucosaminyl)-trans-4-hydroxy-L-proline + UDP + H+
UDP-α-D-galactose + an XXXG xylogulcan = an XLXG xylogulcan + UDP
UDP-α-D-galactose + an XLXG xylogulcan = an XLLG xylogulcan + UDP + H+
an L-1-phosphatidyl-inositol + UDP-N-acetyl-α-D-glucosamine = a 6-(N-acetyl-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol + UDP + H+
UDP-α-D-galactose + an N-glycan = a galactose-β-1,3-N-glycan + UDP
UDP-α-D-galactose + β-D-glucose = α-lactose + UDP + H+
UDP-α-D-galactose + N-acetyl-β-D-glucosamine = β-D-galactosyl-1,4-N-acetyl-β-D-glucosamine + UDP + H+
UDP-N-acetyl-α-D-glucosamine = poly-β-1,6-N-acetyl-D-glucosamine + UDP
a flavonol 3-O-glycoside + UDP-α-D-xylose = a flavonol 3-[β-D-xylosyl-(1->2)-β-D-glycoside] + UDP + H+
UDP-N-acetyl-α-D-glucosamine + O-mannopyranosyl-alpha-1,3-[O-mannopyranosyl-alpha-1,3-(O-mannopyranosyl-alpha-1,6)-O-mannopyranosyl-alpha-1,6]-O-mannopyranosyl-beta-1,4-N-acetyl-D-glucosamine = UDP + O-mannopyranosyl-alpha-1,3-O-mannopyranosyl-alpha-1,3-(O-mannopyranosyl-alpha-1,6)-[N-acetylglucosamine-beta-1,4-O-mannopyranosyl-alpha-1,6]-O-mannopyranosyl-beta-1,4-N-acetyl-D-glucosamine + H+
a lipopolysaccharide + UDP-N-acetyl-α-D-glucosamine = a N-acetyl-α-D-glucosaminyl-lipopolysaccharide + UDP
mycophenolate + UDP-α-D-glucuronate = mycophenolic acid O-acyl-glucuronide + UDP
mycophenolate + UDP-α-D-glucuronate = mycophenolic acid phenolic glucuronide + UDP + H+
2 UDP-α-D-galactofuranose + α-L-rhamnopyranosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-trans,octacis-decaprenol = 2 UDP + β-D-galactofuranosyl-(1→5)-β-D-galactofuranosyl-(1→4)-α-L-rhamnopyranosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-trans,octacis-decaprenol + 2 H+
UDP-α-D-galactose + sphingosine = psychosine + UDP + H+
UDP-α-D-galactose + a glycoprotein-α-L-fucosyl-(1,2)-D-galactose = UDP + a galactosyl-(1->3)-[α-L-fucosyl(1->2)]-D-galactosyl-R + H+
UDP-α-D-galactose + a 2-(2-hydroxyacyl)sphingosine = a 1-(β-D-galactosyl)-2-(2-hydroxyacyl)sphingosine + UDP + H+
UDP-α-D-galactose + a [procollagen]-5-hydroxy-L-lysine = a procollagen 5-(galactosyloxy)-L-lysine + UDP + H+
UDP-α-D-galactose + gangloside GM2 = ganglioside GM1a + UDP + H+
UDP-α-D-galactose + a glycosaminoglycan = a D-galactosylglycosaminoglycan + UDP + H+
an N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-β-D-glucosylceramide + UDP-α-D-galactose = UDP + 1,3-β-D-galactosyl-N-acetyl-D-glucosaminyl-1,3-β-D-galactosyl-1,4-D-glucosylceramide + H+
UDP-α-D-galactose + sn-glycerol 3-phosphate = α-D-galactosyl-(1,1')-sn-glycerol 3-phosphate + UDP + H+
UDP-α-D-galactose + sn-glycerol 3-phosphate = 2-(α-D-galactosyl)-sn-glycerol 3-phosphate + UDP + H+
UDP-α-D-galactose + sucrose = 6F-α-D-galactosylsucrose + UDP + H+
UDP-α-D-galactose + β-D-galactosyl-1,4-β-D-glucosyl-R = β-D-galactosyl-1,3-β-D-galactosyl-1,4-β-D-glucosyl-R + UDP + H+
UDP-α-D-galactose + a β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide = an α-D-galactosyl-(1->4)-β-D-galactosyl-(1->4)-β-D-glucosylceramide + UDP + H+
a flavonol-3-O-D-glucoside + UDP-L-rhamnose = a flavonol 3-O-[β-L-rhamnosyl-(1->6)-β-D-glucoside] + UDP + H+
UDP-α-D-galactose + a lipopolysaccharide = a D-galactosyl-lipopolysaccharide + UDP + H+
a non-glucuronosylated glucuronoside acceptor + UDP-α-D-glucuronate = a glucuronosylated glucuronoside acceptor + UDP
UDP-L-rhamnose + a flavanone-7-O-β-D-glucoside = UDP + a flavanone 7-O-(β-L-rhamnosyl-(1,2)-β-D-glucoside + H+
UDP-N-acetyl-α-D-galactosamine + an α-D-galactosyl-(1->4)-β-D-galactosyl-(1->4)-β-D-glucosylceramide = an N-acetyl-β-D-galactosaminyl-(1,3)-α-D-galactosyl-(1,4)-β-D-galactosyl-(1,4)-β-D-glucosylceramide + UDP + H+
UDP-N-acetyl-α-D-galactosamine + an N-acetyl-β-D-galactosaminyl-(1,3)-α-D-galactosyl-(1,4)-β-D-galactosyl-(1,4)-β-D-glucosylceramide = galNAc-α1->3galNAc-β1->3gal-α1->4lacCer + UDP + H+
UDP-N-acetyl-α-D-galactosamine + a 1-O-[O-(N-acetyl-α-neuraminyl)-2,3-β-D-galactosyl-1,4-β-D-glucosyl]ceramide = gangloside GM2 + UDP + H+
UDP-N-acetyl-α-D-galactosamine + an α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide = an N-acetyl-β-D-galactosaminyl-(1→4)-[α-N-acetylneuraminyl-(2→3)]-β-D-galactosyl-(1→4)-?-D-glucosyl-(1↔1)-ceramide + UDP + H+
UDP-α-D-glucuronate + scutellarein = UDP + scutellarin + H+
2'-deoxyguanosine + UTP = dGMP + UDP + H+
2'-deoxyadenosine + UTP = dAMP + UDP + H+
2'-deoxycytidine + UTP = dCMP + UDP + H+
soyasapogenol A + UDP-α-D-glucuronate = soyasapogenol A 3-O-β-glucuronate + UDP + H+
soyasapogenol E + UDP-α-D-glucuronate = soyasapogenol E 3-O-β-glucuronate + UDP + H+
UDP-α-D-galactose + a D-glucosyl-N-acylsphingosine = a β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1)-ceramide + UDP + H+
an N-acetyl-β-D-glucosaminyl-(1-3)-β-D-galactosyl-(1-4)-β-D-glucosyl-(1↔1)-ceramide + UDP-α-D-galactose = a β-D-galactosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1-3)-β-D-galactosyl-1,4-β-D-glucosyl-(1↔1)-ceramide + UDP + H+
UDP-α-D-xylose + an anthocyanidin-3-O-β-D-glucoside = UDP + an anthocyanidin 3-O-β-D-sambubioside + H+
UDP-α-D-galactose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-galactosyl-(1→4)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-glucose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-glucosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-galactose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-galactosyl-(1→3)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-xylose + kaempferol = UDP + kaempferol 3-O-β-D-xyloside + H+
UDP-α-D-glucose + vancomycin aglycone = UDP + desvancoaminyl vancomycin + H+
O2-(α-D-mannosyl)-L-threonyl-[protein] + UDP-N-acetyl-α-D-glucosamine = O2-[N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosy]-L-threonyl-[protein] + UDP + H+
O2-[N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosy]-L-threonyl-[protein] + UDP-N-acetyl-α-D-galactosamine = O2-[N-acetyl-β-D-galactosaminyl-(1→3)-N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosyl]-L-threonyl-[protein] + UDP + H+
UDP-β-L-arabinofuranose + a [protein]-trans-4-hydroxy-L-proline = a protein-O-(β-L-arabinofuranose)-trans-4-hydroxy-L-proline + UDP + H+
tylosin + UDP-α-D-glucose = 2'-[O-(β-D-glucopyranosyl)]-tylosin + UDP + H+
UDP-α-D-xylose + N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine = UDP + N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}asparagine + H+
UDP-N-acetyl-α-D-galactosamine + an N-acetyl-β-D-glucosaminyl-R = N-acetyl-β-D-galactosaminyl-(1->4)-N-acetyl-β-D-glucosaminyl-[glycoprotein] + UDP + H+
UDP-α-D-galactose + an N-acylsphingosine = a D-galactosyl-N-acylsphingosine + UDP + H+
a [protein]-L-asparagine + UDP-N-acetyl-α-D-glucosamine = a [protein]-N4-(N-acetyl-β-D-glucosaminyl)-L-asparagine + UDP + H+
UDP-α-D-glucose + an N-acylsphingosine + H+ = a D-glucosyl-N-acylsphinganine + UDP
UDP-α-D-glucose + a procollagen 5-(galactosyloxy)-L-lysine = 1,2-D-glucosyl-5-D-(galactosyloxy)-L-lysine-[procollagen] + UDP + H+
UDP-α-D-glucose + an arylamine = N-D-glucosylarylamine + UDP + H+
an anthocyanidin + UDP-α-D-glucose = an anthocyanidin-3-O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + β-glucosyl-hydroxymethylcytosine in DNA = UDP + β-D-glucosyl-β-D-glucosyl-hydroxymethylcytosine in DNA + H+
paromamine + UDP-α-D-glucose = 3''-deamino-3''-hydroxykanamycin C + UDP + H+
UDP-α-D-glucose + an anthocyanidin-3-O-β-D-glucoside = UDP + an anthocyanidin 3,5-di-O-β-D-glucoside + H+
UDP-α-D-glucose + an anthocyanidin-3-O-β-D-glucoside = UDP + an anthocyanidin 3-O-sophoroside + H+
UDP-α-D-glucose + an anthocyanidin 3-O-(4-coumaroyl-α-L-rhamnosyl-(1→6)-β-D-glucoside = an anthocyanidin 3-O-(4-coumaroyl-α-L-rhamnosyl-(1→6)-β-D-glucoside) 5-O-glucoside + UDP + H+
UDP-α-D-glucose + an anthocyanidin 3-O-β-D-sambubioside = an anthocyanidin 5-O-β-D-glucoside 3-O-β-D-sambubioside + UDP
zeaxanthin + 2 UDP-α-D-glucose = zeaxanthin bis(β-D-glucoside) + 2 UDP + 2 H+
2 UDP-α-D-glucose + delphinidin 3-O-(6''-O-malonyl)-β-glucoside = ternatin C5 + 2 UDP + 2 H+
UDP-α-D-glucose + an anthocyanidin = an anthocyanidin-3-O-β-D-glucoside + UDP
UDP-α-D-glucose + kaempferol-3-glucoside-7-rhamnoside = kaempferol-3-O-gentiobioside-7-O-rhamnoside + UDP + H+
UDP-α-D-glucose + cyanidin-3-O-rutinoside = UDP + cyanidin-3-O-rutinoside-5-O-β-D-glucoside + H+
UDP-α-D-glucose + an N6-alkylaminopurine = an N6-alkylaminopurine-7-β-D-glucoside + UDP + H+
an isoflavone + UDP-α-D-glucose = an isoflavone-7-O-β-D-glucoside + UDP
UDP-α-D-glucose + 13-hydroxydocosanoate = 13-β-D-glucosyloxydocosanoate + UDP + H+
UDP-α-D-glucose + a flavonol = UDP + a flavonol-3-O-β-D-glucoside + H+
UDP-α-D-glucose + a lipopolysaccharide = a D-glucosyl-lipopolysaccharide + UDP
UDP-α-D-glucose + a flavonol-3-O-β-D-glucoside = UDP + a flavonol 3-O β-D-glucosyl-(1->2)-β-D-glucoside + H+
a flavonol + UDP-α-D-glucose = a flavonol-7-O-β-D-glucosides + UDP + H+
UDP-α-D-glucose + a flavanone = a flavanone-7-O-β-D-glucoside + UDP
UDP-α-D-glucose + a flavonol 3-O β-D-glucosyl-(1->2)-β-D-glucoside = UDP + a flavonol 3-O-(β-D-glucosyl-(1->2)-β-D-glucosyl (1->2)-β-D-glucoside) + H+
UDP-α-D-glucose + 5-hydroxymethylcytosine in DNA = UDP + β-glucosyl-hydroxymethylcytosine in DNA + H+
UDP-α-D-glucose + 5-hydroxymethylcytosine in DNA = UDP + α-glucosyl-hydroxymethylcytosine in DNA + H+
UDP-α-D-glucose + a phenol = UDP + an aryl β-D-glucoside + H+
UDP-α-D-glucose + DIMBOA = DIMBOA-β-D-glucoside + UDP
UDP-α-D-glucose + a 1,2-diacyl-sn-glycerol = a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol + UDP + H+
UDP-α-D-glucose + (1,3-α-D-glucosyl)(n) = (1,3-α-D-glucosyl)(n+1) + UDP
UDP-α-D-glucose + solasodine = UDP + solasodine 3-O-β-D-glucopyranoside + H+
UDP-α-D-glucose + brassicasterol = UDP + 3-O-β-D-glucosyl-brassicasterol + H+
UDP-α-D-glucose + stigmasterol = UDP + stigmasterol 3-O-β-D-glucoside + H+
UDP-α-D-glucose + cholesterol = UDP + cholesteryl-β-D-glucoside + H+
UDP-α-D-glucose + sitosterol = UDP + 3-O-β-D-glucosyl-β-sitosterol + H+
UDP-α-D-glucose + a sterol = UDP + an O-glucosylsterol + H+
indole-3-butyrate + UDP-α-D-glucose = indole-3-butyryl-glucose + UDP
UDP-α-D-glucose + limonin + H2O = UDP + glucosyl-limonin + 2 H+
UDP-α-D-glucose + 6-hydroxyflavone = 6-O-β-D-glucosyl-6-hydroxyflavone + UDP + H+
UDP-α-D-glucose + 7-hydroxyflavone = 7-O-β-D-glucosyl-7-hydroxyflavone + UDP + H+
tetrahydrobiopterin + UDP-α-D-glucose = tetrahydrobiopterin-glucoside + UDP + H+
UDP-α-D-glucose + 4-aminobenzoate = p-aminobenzoate-β-D-glucopyranosyl ester + UDP
UDP-α-D-glucose + a hydroxyanthraquinone = UDP + a glucosyloxyanthraquinone
UDP-α-D-glucose + cis-p-coumarate = UDP + 4'-O-β-D-glucosyl-cis-p-coumarate + H+
UDP-α-D-glucose + benzene-1,4-diol = hydroquinone-O-β-D-glucopyranoside + UDP + H+
UDP-α-D-glucose + (20S,22S,25S)-22,25-epoxyfurost-5-ene-3-β,26-diol = (20S,22S,25S)-22,25-epoxyfurost-5-ene-3-β,26-diol 3-o-β-D-glucoside + UDP + H+
UDP-α-D-glucose + methylazoxymethanol = UDP + cycasin + H+
UDP-α-D-glucose + 13-β-D-glucosyloxydocosanoate = 13-[O(2')-β-D-glucopyranosyl-β-D-glucopyranosyloxy]docosanoate + UDP + H+
UDP-α-D-glucose + 4-coumarate = 4-O-β-D-glucosyl-4-hydroxycinnamate + UDP + H+
UDP-α-D-glucose + (-)-menthol = (-)-menthyl O-β-D-glucoside + UDP + H+
UDP-α-D-glucose + poly(ribitol phosphate) = β-D-glucosylpoly (ribotol phosphate) + UDP + H+
UDP-α-D-glucose + (25S)-5-β-spirostan-3-β-ol = (25S)-5β-spirostan-3β-ol 3-O-β-D- glucoside + UDP + H+
UDP-α-D-glucose + 4-hydroxybenzoate = 4-(β-D-glucosyloxy)benzoate + UDP + H+
UDP-α-D-glucose + N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol = β-D-glucosyl-(1→4)-N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP + H+
UDP-α-D-glucose + pyridoxine = 5'-O-β-D-glucosylpyridoxine + UDP + H+
UDP-α-D-glucose + alizarin = 1-hydroxy-2-(β-D-glucosyloxy)-9,10- anthraquinone + UDP + H+
UDP-α-D-glucose + a lipopolysaccharide = UDP + an α-D-glucosyl-lipopolysaccharide
UDP-α-D-glucose + gibberellin A3 + H+ = gibberellin 2-O-β-D-glucoside + UDP
UDP-α-D-glucose + 7-deoxyloganetin = UDP + 7-deoxyloganin + H+
loganetin + UDP-α-D-glucose = loganin + UDP + H+
UDP-α-D-glucose + an isoprenoid monophosphate = a polyprenylphosphate-glucose + UDP
cyanidin-3-O-β-D-glucoside + UDP-L-rhamnose = cyanidin-3-O-rutinoside + UDP + H+
UDP-α-D-glucose + a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol = a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl-(1->6)-β-D-glucopyranosyl)-sn-glycerol + UDP + H+
UDP-α-D-glucose + a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol = a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol + UDP + H+
UDP-α-D-glucose + a 1,2-diacyl-3-O-(α-D-glucopyranosyl)-sn-glycerol = a 1,2-diacyl-3-O-(α-D-glucopyranosyl(1->2)-O-α-D-glucopyranosyl)-sn-glycerol + UDP + H+
n UDP-α-D-glucose + poly (glycerol phosphate) = o-(α-D-glucosyl)-polyglycerol phosphate + n UDP + n H+
β-L-arabinose 1-phosphate + UDP + H+ = UDP-β-L-arabinopyranose + phosphate

Enzymes activated by UDP, sorted by the type of activation, are:

Activator (Allosteric) of: pyruvate kinase [Singh98]

Enzymes inhibited by UDP, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: UDP-N-acetylglucosamine: dolichyl diphosphate N-acetylglucosamine, N-acetylglucosamine transferase [Sharma82] , β-1,2-xylosyltransferase [Bencur05] , UDP-glucose:glycogenin 4-α-D-glucosyltransferase [Plesner74] , UDP-D-glucose:delphinidin-3,5-diglucoside -O-β-D-glucosyltransferase [FukuchiMizutani03] , UDP-D-glucose:delphinidin 3-O-glucosyl-5-O-caffeoylglucoside -O-β-D-glucosyltransferase [FukuchiMizutani03]

Inhibitor (Uncompetitive) of: luteolin-7-O-diglucuronide 4'-O-glucuronosyltransferase [Schulz88a] , luteolin-7-O-glucuronide 2''-O-glucuronosyltransferase [Schulz88a] , luteolin 7-O-glucuronosyltransferase [Schulz88a]

Inhibitor (Noncompetitive) of: UDPG:coniferyl alcohol glucosyltransferase [Schmid82]

Inhibitor (Allosteric) of: flavonol 3-O-glycoside glucosyltransferase [Jourdan82] , quercetin 3-O-diglucoside 2"-glucosyltransferase [Jourdan82] , flavonol 3-O-glucosyltransferase [Jourdan82] , flavonol 3-O-glucoside glucosyltransferase [Jourdan82] , quercetin 3-O-glucoside 2"-glucosyltransferase [Jourdan82] , quercetin 3-O-glucosyltransferase [Jourdan82] , kaempferol 3-O-glucosyltransferase [Owens] , quercetin 3-O-glucosyltransferase [Owens] , myricetin 3-O-glucosyltransferase [Owens]

Inhibitor (Mechanism unknown) of: UDP-N-acetylmuramoylalanyl-D-glutamate 2,6-diaminopimelate ligase [AboGhalia85] , UDP-glucose 4,6-dehydratase [Martinez12] , UDP-glucuronate 4-epimerase [Munoz99] , oleanolate UDP-glucuronosyltransferase [Wojciechowski75] , sucrose synthase [morellM85] , UDP-glucuronate decarboxylase [Pattathil05] , UDP-glucose:indole-3-acetate b-D-glucosyltransferase [Leznicki88] , UDP-D-glucose/UDP-D-galactose 4-epimerase [Barber06a] , UDP-glucose:hesperitin-7-O-β-D-glucosyltransferase [Durren99] , UDP-D-glucuronic acid 4-epimerase [Gu04a] , UDP-N-acetylglucosamine-dolichyl-phosphate N-acetylglocosaminephosphotransferase [Sharma82] , UDP-D-xylose synthase [Baron72] , UDP-D-apiose synthase [Baron72, Beam77] , UDP-D-apiose synthase [Molhoj03] , UDP-D-xylose synthase [Molhoj03] , UDP-L-rhamnose: naringenin 7-O-β-D-glucoside-2''-O-β-L-rhamnosyltransferase [BarPeled91] , UDP-glucose:naringenin 7-O-β-D-glucosyltransferase [Durren99] , UDP-α-D-glucose:glycogenin α-D-glucosyltransferase [Cao93a] , UDP-α-D-glucose:glucosyl-glycogenin α-D-glucosyltransferase [Cao93a]


AboGhalia85: Abo-Ghalia M, Michaud C, Blanot D, van Heijenoort J (1985). "Specificity of the uridine-diphosphate-N-acetylmuramyl-L-alanyl-D-glutamate: meso-2,6-diaminopimelate synthetase from Escherichia coli." Eur J Biochem 1985;153(1);81-7. PMID: 3905407

Barber06a: Barber C, Rosti J, Rawat A, Findlay K, Roberts K, Seifert GJ (2006). "Distinct properties of the five UDP-D-glucose/UDP-D-galactose 4-epimerase isoforms of arabidopsis thaliana." J Biol Chem. PMID: 16644739

Baron72: Baron D, Wellmann E, Grisebach H (1972). "Purification and properties of an enzyme from cell suspension cultures of parsley catalyzing the synthesis of UDP-apiose and UDP-D-xylose from UDP-D-glucuronic acid." Biochim Biophys Acta 258(1);310-8. PMID: 4333589

BarPeled91: Bar-Peled M, Lewinsohn E, Fluhr R, Gressel J (1991). "UDP-rhamnose:flavanone-7-O-glucoside-2''-O-rhamnosyltransferase. Purification and characterization of an enzyme catalyzing the production of bitter compounds in citrus." J Biol Chem 266(31);20953-9. PMID: 1939145

Beam77: Beam KG, Nestler EJ, Greengard P (1977). "Increased cyclic GMP levels associated with contraction in muscle fibres of the giant barnacle." Nature 267(5611);534-6. PMID: 195221

Bencur05: Bencur P, Steinkellner H, Svoboda B, Mucha J, Strasser R, Kolarich D, Hann S, Kollensperger G, Glossl J, Altmann F, Mach L (2005). "Arabidopsis thaliana beta1,2-xylosyltransferase: an unusual glycosyltransferase with the potential to act at multiple stages of the plant N-glycosylation pathway." Biochem J 388(Pt 2);515-25. PMID: 15686448

Cao93a: Cao Y, Mahrenholz AM, DePaoli-Roach AA, Roach PJ (1993). "Characterization of rabbit skeletal muscle glycogenin. Tyrosine 194 is essential for function." J Biol Chem 268(20);14687-93. PMID: 8325847

Durren99: Durren RL, McIntosh CA (1999). "Flavanone-7-O-glucosyltransferase activity from Petunia hybrida.." Phytochemistry 52(5);793-8. PMID: 10626374

FukuchiMizutani03: Fukuchi-Mizutani M, Okuhara H, Fukui Y, Nakao M, Katsumoto Y, Yonekura-Sakakibara K, Kusumi T, Hase T, Tanaka Y (2003). "Biochemical and molecular characterization of a novel UDP-glucose:anthocyanin 3'-O-glucosyltransferase, a key enzyme for blue anthocyanin biosynthesis, from gentian." Plant Physiol 132(3);1652-63. PMID: 12857844

Gu04a: Gu X, Bar-Peled M (2004). "The biosynthesis of UDP-galacturonic acid in plants. Functional cloning and characterization of Arabidopsis UDP-D-glucuronic acid 4-epimerase." Plant Physiol 136(4);4256-64. PMID: 15563616

Jourdan82: Jourdan PS, Mansell RL (1982). "Isolation and partial characterization of three glucosyl transferases involved in the biosynthesis of flavonol triglucosides in Pisum sativum L." Arch Biochem Biophys 213(2);434-43. PMID: 6462109

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Leznicki88: Leznicki AJ, Bandurski RS (1988). "Enzymic synthesis of indole-3-acetyl-1-O-beta-d-glucose. II. Metabolic characteristics of the enzyme." Plant Physiol 88;1481-5. PMID: 11537439

Martinez12: Martinez V, Ingwers M, Smith J, Glushka J, Yang T, Bar-Peled M (2012). "Biosynthesis of UDP-4-keto-6-deoxyglucose and UDP-rhamnose in pathogenic fungi Magnaporthe grisea and Botryotinia fuckeliana." J Biol Chem 287(2);879-92. PMID: 22102281

Molhoj03: Molhoj M, Verma R, Reiter WD (2003). "The biosynthesis of the branched-chain sugar d-apiose in plants: functional cloning and characterization of a UDP-d-apiose/UDP-d-xylose synthase from Arabidopsis." Plant J 35(6);693-703. PMID: 12969423

morellM85: morell M., Copeland L. "Sucrose synthase of Soybean nodules." Plant Physiol. (1985) 78:149-154.

Munoz99: Munoz R, Lopez R, de Frutos M, Garcia E (1999). "First molecular characterization of a uridine diphosphate galacturonate 4-epimerase: an enzyme required for capsular biosynthesis in Streptococcus pneumoniae type 1." Mol Microbiol 31(2);703-13. PMID: 10027985

Owens: Owens DK, McIntosh CA "Identification, recombinant expression, and biochemical characterization of a flavonol 3-O-glucosyltransferase clone from Citrus paradisi." Phytochemistry 70(11-12);1382-91. PMID: 19733370

Pattathil05: Pattathil S, Harper AD, Bar-Peled M (2005). "Biosynthesis of UDP-xylose: characterization of membrane-bound AtUxs2." Planta 221(4);538-48. PMID: 15655675

Plesner74: Plesner L, Plesner IW, Esmann V (1974). "Kinetic mechanism of glycogen synthase D from human polymorphonuclear leukocytes." J Biol Chem 249(4);1119-25. PMID: 4205314

Schmid82: Schmid G, Grisebach H (1982). "Enzymic synthesis of lignin precursors. Purification and properties of UDP glucose: coniferyl-alcohol glucosyltransferase from cambial sap of spruce (Picea abies L.)." Eur J Biochem 123(2);363-70. PMID: 6210530

Schulz88a: Schulz, M, Weissenböck, G (1988). "Three specific UDP-glucuronate-flavone-glucuronosyl-transferases from primary leaves of Secale cereale." Phytochemistry 27:1261-1267.

Sharma82: Sharma CB, Lehle L, Tanner W (1982). "Solubilization and characterization of the initial enzymes of the dolichol pathway from yeast." Eur J Biochem 126(2);319-25. PMID: 6215245

Singh98: Singh DK, Malhotra SP, Singh R (1998). "Purification and characterizaton of plastidic pyruvate kinase from developing seeds of Brassica campestris L." Indian J Biochem Biophys 35(6);346-52. PMID: 10412228

Wojciechowski75: Wojciechowski, ZdzisImageaw A. (1975). "Biosynthesis of oleanolic acid glycosides by subcellular fractions of Calendula officinalis seedlings." Phytochemistry. 14:1749-1753.

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Fri Feb 27, 2015, BIOCYC13A.